ENDRPrint/.svn/pristine/c8/c8fb7c1f24e05a1e5dc830b10ec5cc1c6fb8ef4c.svn-base

11205 lines
341 KiB
Plaintext
Raw Normal View History

2024-08-14 10:33:27 +07:00
/**
* Handsontable 0.9.0
* Handsontable is a simple jQuery plugin for editable tables with basic copy-paste compatibility with Excel and Google Docs
*
* Copyright 2012, Marcin Warpechowski
* Licensed under the MIT license.
* http://handsontable.com/
*
* Date: Tue May 21 2013 02:53:16 GMT+0200 (Central European Daylight Time)
*/
/*jslint white: true, browser: true, plusplus: true, indent: 4, maxerr: 50 */
var Handsontable = { //class namespace
extension: {}, //extenstion namespace
helper: {} //helper namespace
};
(function ($, window, Handsontable) {
"use strict";
/**
* Handsontable constructor
* @param rootElement The jQuery element in which Handsontable DOM will be inserted
* @param userSettings
* @constructor
*/
Handsontable.Core = function (rootElement, userSettings) {
var priv
, hooks
, eventMap
, datamap
, grid
, selection
, editproxy
, autofill
, instance = this
, GridSettings = function () {
};
Handsontable.helper.inherit(GridSettings, DefaultSettings); //create grid settings as a copy of default settings
Handsontable.helper.extend(GridSettings.prototype, userSettings); //overwrite defaults with user settings
this.rootElement = rootElement;
this.guid = 'ht_' + Handsontable.helper.randomString(); //this is the namespace for global events
if (!this.rootElement[0].id) {
this.rootElement[0].id = this.guid; //if root element does not have an id, assign a random id
}
priv = {
columnSettings: [],
columnsSettingConflicts: ['data', 'width'],
settings: new GridSettings(), // current settings instance
settingsFromDOM: {},
selStart: new Handsontable.SelectionPoint(),
selEnd: new Handsontable.SelectionPoint(),
editProxy: false,
isPopulated: null,
scrollable: null,
undoRedo: null,
extensions: {},
colToProp: null,
propToCol: null,
dataSchema: null,
dataType: 'array',
firstRun: true
};
hooks = {
beforeInitWalkontable: [],
beforeInit: [],
beforeRender: [],
beforeChange: [],
beforeGet: [],
beforeSet: [],
beforeGetCellMeta: [],
beforeAutofill: [],
beforeKeyDown: [],
afterInit: [],
afterLoadData: [],
afterRender: [],
afterChange: [],
afterGetCellMeta: [],
afterGetColHeader: [],
afterGetColWidth: [],
afterDestroy: [],
afterRemoveRow: [],
afterCreateRow: [],
afterRemoveCol: [],
afterCreateCol: [],
afterColumnResize: [],
afterColumnMove: [],
afterDeselect: [],
afterSelection: [],
afterSelectionByProp: [],
afterSelectionEnd: [],
afterSelectionEndByProp: [],
afterCopyLimit: []
};
eventMap = {
onBeforeChange: "beforeChange",
onChange: "afterChange",
onCreateRow: "afterCreateRow",
onCreateCol: "afterCreateCol",
onSelection: "afterSelection",
onCopyLimit: "afterCopyLimit",
onSelectionEnd: "afterSelectionEnd",
onSelectionByProp: "afterSelectionByProp",
onSelectionEndByProp: "afterSelectionEndByProp"
};
datamap = {
recursiveDuckSchema: function (obj) {
var schema;
if ($.isPlainObject(obj)) {
schema = {};
for (var i in obj) {
if (obj.hasOwnProperty(i)) {
if ($.isPlainObject(obj[i])) {
schema[i] = datamap.recursiveDuckSchema(obj[i]);
}
else {
schema[i] = null;
}
}
}
}
else {
schema = [];
}
return schema;
},
recursiveDuckColumns: function (schema, lastCol, parent) {
var prop, i;
if (typeof lastCol === 'undefined') {
lastCol = 0;
parent = '';
}
if ($.isPlainObject(schema)) {
for (i in schema) {
if (schema.hasOwnProperty(i)) {
if (schema[i] === null) {
prop = parent + i;
priv.colToProp.push(prop);
priv.propToCol[prop] = lastCol;
lastCol++;
}
else {
lastCol = datamap.recursiveDuckColumns(schema[i], lastCol, i + '.');
}
}
}
}
return lastCol;
},
createMap: function () {
if (typeof datamap.getSchema() === "undefined") {
throw new Error("trying to create `columns` definition but you didnt' provide `schema` nor `data`");
}
var i, ilen, schema = datamap.getSchema();
priv.colToProp = [];
priv.propToCol = {};
if (priv.settings.columns) {
for (i = 0, ilen = priv.settings.columns.length; i < ilen; i++) {
priv.colToProp[i] = priv.settings.columns[i].data;
priv.propToCol[priv.settings.columns[i].data] = i;
}
}
else {
datamap.recursiveDuckColumns(schema);
}
},
colToProp: function (col) {
col = Handsontable.PluginModifiers.run(instance, 'col', col);
if (priv.colToProp && typeof priv.colToProp[col] !== 'undefined') {
return priv.colToProp[col];
}
else {
return col;
}
},
propToCol: function (prop) {
var col;
if (typeof priv.propToCol[prop] !== 'undefined') {
col = priv.propToCol[prop];
}
else {
col = prop;
}
col = Handsontable.PluginModifiers.run(instance, 'col', col);
return col;
},
getSchema: function () {
if (priv.settings.dataSchema) {
if (typeof priv.settings.dataSchema === 'function') {
return priv.settings.dataSchema();
}
return priv.settings.dataSchema;
}
return priv.duckDataSchema;
},
/**
* Creates row at the bottom of the data array
* @param {Number} [index] Optional. Index of the row before which the new row will be inserted
*/
createRow: function (index) {
var row
, rowCount = instance.countRows();
if (typeof index !== 'number' || index >= rowCount) {
index = rowCount;
}
if (priv.dataType === 'array') {
row = [];
for (var c = 0, clen = instance.countCols(); c < clen; c++) {
row.push(null);
}
}
else if (priv.dataType === 'function') {
row = priv.settings.dataSchema(index);
}
else {
row = $.extend(true, {}, datamap.getSchema());
}
if (index === rowCount) {
GridSettings.prototype.data.push(row);
}
else {
GridSettings.prototype.data.splice(index, 0, row);
}
instance.runHooks('afterCreateRow', index);
instance.forceFullRender = true; //used when data was changed
},
/**
* Creates col at the right of the data array
* @param {Object} [index] Optional. Index of the column before which the new column will be inserted
*/
createCol: function (index) {
if (priv.dataType === 'object' || priv.settings.columns) {
throw new Error("Cannot create new column. When data source in an object, you can only have as much columns as defined in first data row, data schema or in the 'columns' setting");
}
var r = 0, rlen = instance.countRows()
, data = GridSettings.prototype.data
, constructor = Handsontable.helper.columnFactory(GridSettings, priv.columnsSettingConflicts, Handsontable.TextCell);
if (typeof index !== 'number' || index >= instance.countCols()) {
for (; r < rlen; r++) {
if (typeof data[r] === 'undefined') {
data[r] = [];
}
data[r].push(null);
}
// Add new column constructor
priv.columnSettings.push(constructor);
}
else {
for (; r < rlen; r++) {
data[r].splice(index, 0, null);
}
// Add new column constructor at given index
priv.columnSettings.splice(index, 0, constructor);
}
instance.runHooks('afterCreateCol', index);
instance.forceFullRender = true; //used when data was changed
},
/**
* Removes row from the data array
* @param {Number} [index] Optional. Index of the row to be removed. If not provided, the last row will be removed
* @param {Number} [amount] Optional. Amount of the rows to be removed. If not provided, one row will be removed
*/
removeRow: function (index, amount) {
if (!amount) {
amount = 1;
}
if (typeof index !== 'number') {
index = -amount;
}
GridSettings.prototype.data.splice(index, amount);
instance.runHooks('afterRemoveRow', index, amount);
instance.forceFullRender = true; //used when data was changed
},
/**
* Removes column from the data array
* @param {Number} [index] Optional. Index of the column to be removed. If not provided, the last column will be removed
* @param {Number} [amount] Optional. Amount of the columns to be removed. If not provided, one column will be removed
*/
removeCol: function (index, amount) {
if (priv.dataType === 'object' || priv.settings.columns) {
throw new Error("cannot remove column with object data source or columns option specified");
}
if (!amount) {
amount = 1;
}
if (typeof index !== 'number') {
index = -amount;
}
var data = GridSettings.prototype.data;
for (var r = 0, rlen = instance.countRows(); r < rlen; r++) {
data[r].splice(index, amount);
}
instance.runHooks('afterRemoveCol', index, amount);
priv.columnSettings.splice(index, amount);
instance.forceFullRender = true; //used when data was changed
},
/**
* Add / removes data from the column
* @param {Number} col Index of column in which do you want to do splice.
* @param {Number} index Index at which to start changing the array. If negative, will begin that many elements from the end
* @param {Number} amount An integer indicating the number of old array elements to remove. If amount is 0, no elements are removed
* param {...*} elements Optional. The elements to add to the array. If you don't specify any elements, spliceCol simply removes elements from the array
*/
spliceCol: function (col, index, amount/*, elements...*/) {
var elements = 4 <= arguments.length ? [].slice.call(arguments, 3) : [];
var colData = instance.getDataAtCol(col);
var removed = colData.slice(index, index + amount);
var after = colData.slice(index + amount);
Handsontable.helper.extendArray(elements, after);
var i = 0;
while (i < amount) {
elements.push(null); //add null in place of removed elements
i++;
}
Handsontable.helper.to2dArray(elements);
instance.populateFromArray(index, col, elements, null, null, 'spliceCol');
return removed;
},
/**
* Add / removes data from the row
* @param {Number} row Index of row in which do you want to do splice.
* @param {Number} index Index at which to start changing the array. If negative, will begin that many elements from the end
* @param {Number} amount An integer indicating the number of old array elements to remove. If amount is 0, no elements are removed
* param {...*} elements Optional. The elements to add to the array. If you don't specify any elements, spliceCol simply removes elements from the array
*/
spliceRow: function (row, index, amount/*, elements...*/) {
var elements = 4 <= arguments.length ? [].slice.call(arguments, 3) : [];
var rowData = instance.getDataAtRow(row);
var removed = rowData.slice(index, index + amount);
var after = rowData.slice(index + amount);
Handsontable.helper.extendArray(elements, after);
var i = 0;
while (i < amount) {
elements.push(null); //add null in place of removed elements
i++;
}
instance.populateFromArray(row, index, [elements], null, null, 'spliceRow');
return removed;
},
/**
* Returns single value from the data array
* @param {Number} row
* @param {Number} prop
*/
getVars: {},
get: function (row, prop) {
datamap.getVars.row = row;
datamap.getVars.prop = prop;
instance.runHooks('beforeGet', datamap.getVars);
if (typeof datamap.getVars.prop === 'string' && datamap.getVars.prop.indexOf('.') > -1) {
var sliced = datamap.getVars.prop.split(".");
var out = priv.settings.data[datamap.getVars.row];
if (!out) {
return null;
}
for (var i = 0, ilen = sliced.length; i < ilen; i++) {
out = out[sliced[i]];
if (typeof out === 'undefined') {
return null;
}
}
return out;
}
else if (typeof datamap.getVars.prop === 'function') {
/**
* allows for interacting with complex structures, for example
* d3/jQuery getter/setter properties:
*
* {columns: [{
* data: function(row, value){
* if(arguments.length === 1){
* return row.property();
* }
* row.property(value);
* }
* }]}
*/
return datamap.getVars.prop(priv.settings.data.slice(
datamap.getVars.row,
datamap.getVars.row + 1
)[0]);
}
else {
return priv.settings.data[datamap.getVars.row] ? priv.settings.data[datamap.getVars.row][datamap.getVars.prop] : null;
}
},
/**
* Saves single value to the data array
* @param {Number} row
* @param {Number} prop
* @param {String} value
* @param {String} [source] Optional. Source of hook runner.
*/
setVars: {},
set: function (row, prop, value, source) {
datamap.setVars.row = row;
datamap.setVars.prop = prop;
datamap.setVars.value = value;
instance.runHooks('beforeSet', datamap.setVars, source || "datamapGet");
if (typeof datamap.setVars.prop === 'string' && datamap.setVars.prop.indexOf('.') > -1) {
var sliced = datamap.setVars.prop.split(".");
var out = priv.settings.data[datamap.setVars.row];
for (var i = 0, ilen = sliced.length - 1; i < ilen; i++) {
out = out[sliced[i]];
}
out[sliced[i]] = datamap.setVars.value;
}
else if (typeof datamap.setVars.prop === 'function') {
/* see the `function` handler in `get` */
datamap.setVars.prop(priv.settings.data.slice(
datamap.setVars.row,
datamap.setVars.row + 1
)[0], datamap.setVars.value);
}
else {
priv.settings.data[datamap.setVars.row][datamap.setVars.prop] = datamap.setVars.value;
}
},
/**
* Clears the data array
*/
clear: function () {
for (var r = 0; r < instance.countRows(); r++) {
for (var c = 0; c < instance.countCols(); c++) {
datamap.set(r, datamap.colToProp(c), '');
}
}
},
/**
* Returns the data array
* @return {Array}
*/
getAll: function () {
return priv.settings.data;
},
/**
* Returns data range as array
* @param {Object} start Start selection position
* @param {Object} end End selection position
* @return {Array}
*/
getRange: function (start, end) {
var r, rlen, c, clen, output = [], row;
rlen = Math.max(start.row, end.row);
clen = Math.max(start.col, end.col);
for (r = Math.min(start.row, end.row); r <= rlen; r++) {
row = [];
for (c = Math.min(start.col, end.col); c <= clen; c++) {
row.push(datamap.get(r, datamap.colToProp(c)));
}
output.push(row);
}
return output;
},
/**
* Return data as text (tab separated columns)
* @param {Object} start (Optional) Start selection position
* @param {Object} end (Optional) End selection position
* @return {String}
*/
getText: function (start, end) {
return SheetClip.stringify(datamap.getRange(start, end));
}
};
grid = {
/**
* Inserts or removes rows and columns
* @param {String} action Possible values: "insert_row", "insert_col", "remove_row", "remove_col"
* @param {Number} index
* @param {Number} amount
* @param {String} [source] Optional. Source of hook runner.
* @param {Boolean} [keepEmptyRows] Optional. Flag for preventing deletion of empty rows.
*/
alter: function (action, index, amount, source, keepEmptyRows) {
var oldData, newData, changes, r, rlen, c, clen, delta;
oldData = $.extend(true, [], datamap.getAll());
switch (action) {
case "insert_row":
if (!amount) {
amount = 1;
}
delta = 0;
while (delta < amount && instance.countRows() < priv.settings.maxRows) {
datamap.createRow(index);
delta++;
}
if (delta) {
if (priv.selStart.exists() && priv.selStart.row() >= index) {
priv.selStart.row(priv.selStart.row() + delta);
selection.transformEnd(delta, 0); //will call render() internally
}
else {
selection.refreshBorders(); //it will call render and prepare methods
}
}
break;
case "insert_col":
if (!amount) {
amount = 1;
}
delta = 0;
while (delta < amount && instance.countCols() < priv.settings.maxCols) {
datamap.createCol(index);
delta++;
}
if (delta) {
if (priv.selStart.exists() && priv.selStart.col() >= index) {
priv.selStart.col(priv.selStart.col() + delta);
selection.transformEnd(0, delta); //will call render() internally
}
else {
selection.refreshBorders(); //it will call render and prepare methods
}
}
break;
case "remove_row":
datamap.removeRow(index, amount);
grid.adjustRowsAndCols();
selection.refreshBorders(); //it will call render and prepare methods
break;
case "remove_col":
datamap.removeCol(index, amount);
grid.adjustRowsAndCols();
selection.refreshBorders(); //it will call render and prepare methods
break;
default:
throw Error('There is no such action "' + action + '"');
break;
}
changes = [];
newData = datamap.getAll();
for (r = 0, rlen = newData.length; r < rlen; r++) {
for (c = 0, clen = newData[r].length; c < clen; c++) {
changes.push([r, c, oldData[r] ? oldData[r][c] : null, newData[r][c]]);
}
}
instance.runHooks('afterChange', changes, source || action);
if (!keepEmptyRows) {
grid.adjustRowsAndCols(); //makes sure that we did not add rows that will be removed in next refresh
}
},
/**
* Makes sure there are empty rows at the bottom of the table
*/
adjustRowsAndCols: function () {
var r, rlen, emptyRows = instance.countEmptyRows(true), emptyCols;
//should I add empty rows to data source to meet minRows?
rlen = instance.countRows();
if (rlen < priv.settings.minRows) {
for (r = 0; r < priv.settings.minRows - rlen; r++) {
datamap.createRow();
}
}
//should I add empty rows to meet minSpareRows?
if (emptyRows < priv.settings.minSpareRows) {
for (; emptyRows < priv.settings.minSpareRows && instance.countRows() < priv.settings.maxRows; emptyRows++) {
datamap.createRow();
}
}
//count currently empty cols
emptyCols = instance.countEmptyCols(true);
//should I add empty cols to meet minCols?
if (!priv.settings.columns && instance.countCols() < priv.settings.minCols) {
for (; instance.countCols() < priv.settings.minCols; emptyCols++) {
datamap.createCol();
}
}
//should I add empty cols to meet minSpareCols?
if (!priv.settings.columns && priv.dataType === 'array' && emptyCols < priv.settings.minSpareCols) {
for (; emptyCols < priv.settings.minSpareCols && instance.countCols() < priv.settings.maxCols; emptyCols++) {
datamap.createCol();
}
}
if (priv.settings.enterBeginsEditing) {
for (; (((priv.settings.minRows || priv.settings.minSpareRows) && instance.countRows() > priv.settings.minRows) && (priv.settings.minSpareRows && emptyRows > priv.settings.minSpareRows)); emptyRows--) {
datamap.removeRow();
}
}
if (priv.settings.enterBeginsEditing && !priv.settings.columns) {
for (; (((priv.settings.minCols || priv.settings.minSpareCols) && instance.countCols() > priv.settings.minCols) && (priv.settings.minSpareCols && emptyCols > priv.settings.minSpareCols)); emptyCols--) {
datamap.removeCol();
}
}
var rowCount = instance.countRows();
var colCount = instance.countCols();
if (rowCount === 0 || colCount === 0) {
selection.deselect();
}
if (priv.selStart.exists()) {
var selectionChanged;
var fromRow = priv.selStart.row();
var fromCol = priv.selStart.col();
var toRow = priv.selEnd.row();
var toCol = priv.selEnd.col();
//if selection is outside, move selection to last row
if (fromRow > rowCount - 1) {
fromRow = rowCount - 1;
selectionChanged = true;
if (toRow > fromRow) {
toRow = fromRow;
}
} else if (toRow > rowCount - 1) {
toRow = rowCount - 1;
selectionChanged = true;
if (fromRow > toRow) {
fromRow = toRow;
}
}
//if selection is outside, move selection to last row
if (fromCol > colCount - 1) {
fromCol = colCount - 1;
selectionChanged = true;
if (toCol > fromCol) {
toCol = fromCol;
}
} else if (toCol > colCount - 1) {
toCol = colCount - 1;
selectionChanged = true;
if (fromCol > toCol) {
fromCol = toCol;
}
}
if (selectionChanged) {
instance.selectCell(fromRow, fromCol, toRow, toCol);
}
}
},
/**
* Populate cells at position with 2d array
* @param {Object} start Start selection position
* @param {Array} input 2d array
* @param {Object} [end] End selection position (only for drag-down mode)
* @param {String} [source="populateFromArray"]
* @param {String} [method="overwrite"]
* @return {Object|undefined} ending td in pasted area (only if any cell was changed)
*/
populateFromArray: function (start, input, end, source, method) {
var r, rlen, c, clen, setData = [], current = {};
rlen = input.length;
if (rlen === 0) {
return false;
}
var repeatCol
, repeatRow
, cmax
, rmax;
// insert data with specified pasteMode method
switch (method) {
case 'shift_down' :
repeatCol = end ? end.col - start.col + 1 : 0;
repeatRow = end ? end.row - start.row + 1 : 0;
input = Handsontable.helper.translateRowsToColumns(input);
for (c = 0, clen = input.length, cmax = Math.max(clen, repeatCol); c < cmax; c++) {
if (c < clen) {
for (r = 0, rlen = input[c].length; r < repeatRow - rlen; r++) {
input[c].push(input[c][r % rlen]);
}
input[c].unshift(start.col + c, start.row, 0);
instance.spliceCol.apply(instance, input[c]);
}
else {
input[c % clen][0] = start.col + c;
instance.spliceCol.apply(instance, input[c % clen]);
}
}
break;
case 'shift_right' :
repeatCol = end ? end.col - start.col + 1 : 0;
repeatRow = end ? end.row - start.row + 1 : 0;
for (r = 0, rlen = input.length, rmax = Math.max(rlen, repeatRow); r < rmax; r++) {
if (r < rlen) {
for (c = 0, clen = input[r].length; c < repeatCol - clen; c++) {
input[r].push(input[r][c % clen]);
}
input[r].unshift(start.row + r, start.col, 0);
instance.spliceRow.apply(instance, input[r]);
}
else {
input[r % rlen][0] = start.row + r;
instance.spliceRow.apply(instance, input[r % rlen]);
}
}
break;
case 'overwrite' :
default:
// overwrite and other not specified options
current.row = start.row;
current.col = start.col;
for (r = 0; r < rlen; r++) {
if ((end && current.row > end.row) || (!priv.settings.minSpareRows && current.row > instance.countRows() - 1) || (current.row >= priv.settings.maxRows)) {
break;
}
current.col = start.col;
clen = input[r] ? input[r].length : 0;
for (c = 0; c < clen; c++) {
if ((end && current.col > end.col) || (!priv.settings.minSpareCols && current.col > instance.countCols() - 1) || (current.col >= priv.settings.maxCols)) {
break;
}
if (instance.getCellMeta(current.row, current.col).isWritable) {
setData.push([current.row, current.col, input[r][c]]);
}
current.col++;
if (end && c === clen - 1) {
c = -1;
}
}
current.row++;
if (end && r === rlen - 1) {
r = -1;
}
}
instance.setDataAtCell(setData, null, null, source || 'populateFromArray');
break;
}
instance.forceFullRender = true; //used when data was changed
grid.adjustRowsAndCols();
selection.refreshBorders(null, true);
},
/**
* Returns the top left (TL) and bottom right (BR) selection coordinates
* @param {Object[]} coordsArr
* @returns {Object}
*/
getCornerCoords: function (coordsArr) {
function mapProp(func, array, prop) {
function getProp(el) {
return el[prop];
}
if (Array.prototype.map) {
return func.apply(Math, array.map(getProp));
}
return func.apply(Math, $.map(array, getProp));
}
return {
TL: {
row: mapProp(Math.min, coordsArr, "row"),
col: mapProp(Math.min, coordsArr, "col")
},
BR: {
row: mapProp(Math.max, coordsArr, "row"),
col: mapProp(Math.max, coordsArr, "col")
}
};
},
/**
* Returns array of td objects given start and end coordinates
*/
getCellsAtCoords: function (start, end) {
var corners = grid.getCornerCoords([start, end]);
var r, c, output = [];
for (r = corners.TL.row; r <= corners.BR.row; r++) {
for (c = corners.TL.col; c <= corners.BR.col; c++) {
output.push(instance.view.getCellAtCoords({
row: r,
col: c
}));
}
}
return output;
}
};
this.selection = selection = { //this public assignment is only temporary
inProgress: false,
/**
* Sets inProgress to true. This enables onSelectionEnd and onSelectionEndByProp to function as desired
*/
begin: function () {
instance.selection.inProgress = true;
},
/**
* Sets inProgress to false. Triggers onSelectionEnd and onSelectionEndByProp
*/
finish: function () {
var sel = instance.getSelected();
instance.runHooks("afterSelectionEnd", sel[0], sel[1], sel[2], sel[3]);
instance.runHooks("afterSelectionEndByProp", sel[0], instance.colToProp(sel[1]), sel[2], instance.colToProp(sel[3]));
instance.selection.inProgress = false;
},
isInProgress: function () {
return instance.selection.inProgress;
},
/**
* Starts selection range on given td object
* @param {Object} coords
*/
setRangeStart: function (coords) {
priv.selStart.coords(coords);
selection.setRangeEnd(coords);
},
/**
* Ends selection range on given td object
* @param {Object} coords
* @param {Boolean} [scrollToCell=true] If true, viewport will be scrolled to range end
*/
setRangeEnd: function (coords, scrollToCell) {
instance.selection.begin();
priv.selEnd.coords(coords);
if (!priv.settings.multiSelect) {
priv.selStart.coords(coords);
}
//set up current selection
instance.view.wt.selections.current.clear();
instance.view.wt.selections.current.add(priv.selStart.arr());
//set up area selection
instance.view.wt.selections.area.clear();
if (selection.isMultiple()) {
instance.view.wt.selections.area.add(priv.selStart.arr());
instance.view.wt.selections.area.add(priv.selEnd.arr());
}
//set up highlight
if (priv.settings.currentRowClassName || priv.settings.currentColClassName) {
instance.view.wt.selections.highlight.clear();
instance.view.wt.selections.highlight.add(priv.selStart.arr());
instance.view.wt.selections.highlight.add(priv.selEnd.arr());
}
//trigger handlers
instance.runHooks("afterSelection", priv.selStart.row(), priv.selStart.col(), priv.selEnd.row(), priv.selEnd.col());
instance.runHooks("afterSelectionByProp", priv.selStart.row(), datamap.colToProp(priv.selStart.col()), priv.selEnd.row(), datamap.colToProp(priv.selEnd.col()));
if (scrollToCell !== false) {
instance.view.scrollViewport(coords);
instance.view.wt.draw(true); //these two lines are needed to fix scrolling viewport when cell dimensions are significantly bigger than assumed by Walkontable
instance.view.scrollViewport(coords);
}
selection.refreshBorders();
},
/**
* Destroys editor, redraws borders around cells, prepares editor
* @param {Boolean} revertOriginal
* @param {Boolean} keepEditor
*/
refreshBorders: function (revertOriginal, keepEditor) {
if (!keepEditor) {
editproxy.destroy(revertOriginal);
}
instance.view.render();
if (selection.isSelected() && !keepEditor) {
editproxy.prepare();
}
},
/**
* Returns information if we have a multiselection
* @return {Boolean}
*/
isMultiple: function () {
return !(priv.selEnd.col() === priv.selStart.col() && priv.selEnd.row() === priv.selStart.row());
},
/**
* Selects cell relative to current cell (if possible)
*/
transformStart: function (rowDelta, colDelta, force) {
if (priv.selStart.row() + rowDelta > instance.countRows() - 1) {
if (force && priv.settings.minSpareRows > 0) {
instance.alter("insert_row", instance.countRows());
}
else if (priv.settings.autoWrapCol && priv.selStart.col() + colDelta < instance.countCols() - 1) {
rowDelta = 1 - instance.countRows();
colDelta = 1;
}
}
else if (priv.settings.autoWrapCol && priv.selStart.row() + rowDelta < 0 && priv.selStart.col() + colDelta >= 0) {
rowDelta = instance.countRows() - 1;
colDelta = -1;
}
if (priv.selStart.col() + colDelta > instance.countCols() - 1) {
if (force && priv.settings.minSpareCols > 0) {
instance.alter("insert_col", instance.countCols());
}
else if (priv.settings.autoWrapRow && priv.selStart.row() + rowDelta < instance.countRows() - 1) {
rowDelta = 1;
colDelta = 1 - instance.countCols();
}
}
else if (priv.settings.autoWrapRow && priv.selStart.col() + colDelta < 0 && priv.selStart.row() + rowDelta >= 0) {
rowDelta = -1;
colDelta = instance.countCols() - 1;
}
var totalRows = instance.countRows();
var totalCols = instance.countCols();
var coords = {
row: (priv.selStart.row() + rowDelta),
col: priv.selStart.col() + colDelta
};
if (coords.row < 0) {
coords.row = 0;
}
else if (coords.row > 0 && coords.row >= totalRows) {
coords.row = totalRows - 1;
}
if (coords.col < 0) {
coords.col = 0;
}
else if (coords.col > 0 && coords.col >= totalCols) {
coords.col = totalCols - 1;
}
selection.setRangeStart(coords);
},
/**
* Sets selection end cell relative to current selection end cell (if possible)
*/
transformEnd: function (rowDelta, colDelta) {
if (priv.selEnd.exists()) {
var totalRows = instance.countRows();
var totalCols = instance.countCols();
var coords = {
row: priv.selEnd.row() + rowDelta,
col: priv.selEnd.col() + colDelta
};
if (coords.row < 0) {
coords.row = 0;
}
else if (coords.row > 0 && coords.row >= totalRows) {
coords.row = totalRows - 1;
}
if (coords.col < 0) {
coords.col = 0;
}
else if (coords.col > 0 && coords.col >= totalCols) {
coords.col = totalCols - 1;
}
selection.setRangeEnd(coords);
}
},
/**
* Returns true if currently there is a selection on screen, false otherwise
* @return {Boolean}
*/
isSelected: function () {
return priv.selEnd.exists();
},
/**
* Returns true if coords is within current selection coords
* @return {Boolean}
*/
inInSelection: function (coords) {
if (!selection.isSelected()) {
return false;
}
var sel = grid.getCornerCoords([priv.selStart.coords(), priv.selEnd.coords()]);
return (sel.TL.row <= coords.row && sel.BR.row >= coords.row && sel.TL.col <= coords.col && sel.BR.col >= coords.col);
},
/**
* Deselects all selected cells
*/
deselect: function () {
if (!selection.isSelected()) {
return;
}
instance.selection.inProgress = false; //needed by HT inception
priv.selEnd = new Handsontable.SelectionPoint(); //create new empty point to remove the existing one
instance.view.wt.selections.current.clear();
instance.view.wt.selections.area.clear();
editproxy.destroy();
selection.refreshBorders();
instance.runHooks('afterDeselect');
},
/**
* Select all cells
*/
selectAll: function () {
if (!priv.settings.multiSelect) {
return;
}
selection.setRangeStart({
row: 0,
col: 0
});
selection.setRangeEnd({
row: instance.countRows() - 1,
col: instance.countCols() - 1
}, false);
},
/**
* Deletes data from selected cells
*/
empty: function () {
if (!selection.isSelected()) {
return;
}
var corners = grid.getCornerCoords([priv.selStart.coords(), priv.selEnd.coords()]);
var r, c, changes = [];
for (r = corners.TL.row; r <= corners.BR.row; r++) {
for (c = corners.TL.col; c <= corners.BR.col; c++) {
if (instance.getCellMeta(r, c).isWritable) {
changes.push([r, c, '']);
}
}
}
instance.setDataAtCell(changes);
}
};
this.autofill = autofill = { //this public assignment is only temporary
handle: null,
/**
* Create fill handle and fill border objects
*/
init: function () {
if (!autofill.handle) {
autofill.handle = {};
}
else {
autofill.handle.disabled = false;
}
},
/**
* Hide fill handle and fill border permanently
*/
disable: function () {
autofill.handle.disabled = true;
},
/**
* Selects cells down to the last row in the left column, then fills down to that cell
*/
selectAdjacent: function () {
var select, data, r, maxR, c;
if (selection.isMultiple()) {
select = instance.view.wt.selections.area.getCorners();
}
else {
select = instance.view.wt.selections.current.getCorners();
}
data = datamap.getAll();
rows : for (r = select[2] + 1; r < instance.countRows(); r++) {
for (c = select[1]; c <= select[3]; c++) {
if (data[r][c]) {
break rows;
}
}
if (!!data[r][select[1] - 1] || !!data[r][select[3] + 1]) {
maxR = r;
}
}
if (maxR) {
instance.view.wt.selections.fill.clear();
instance.view.wt.selections.fill.add([select[0], select[1]]);
instance.view.wt.selections.fill.add([maxR, select[3]]);
autofill.apply();
}
},
/**
* Apply fill values to the area in fill border, omitting the selection border
*/
apply: function () {
var drag, select, start, end, _data;
autofill.handle.isDragged = 0;
drag = instance.view.wt.selections.fill.getCorners();
if (!drag) {
return;
}
instance.view.wt.selections.fill.clear();
if (selection.isMultiple()) {
select = instance.view.wt.selections.area.getCorners();
}
else {
select = instance.view.wt.selections.current.getCorners();
}
if (drag[0] === select[0] && drag[1] < select[1]) {
start = {
row: drag[0],
col: drag[1]
};
end = {
row: drag[2],
col: select[1] - 1
};
}
else if (drag[0] === select[0] && drag[3] > select[3]) {
start = {
row: drag[0],
col: select[3] + 1
};
end = {
row: drag[2],
col: drag[3]
};
}
else if (drag[0] < select[0] && drag[1] === select[1]) {
start = {
row: drag[0],
col: drag[1]
};
end = {
row: select[0] - 1,
col: drag[3]
};
}
else if (drag[2] > select[2] && drag[1] === select[1]) {
start = {
row: select[2] + 1,
col: drag[1]
};
end = {
row: drag[2],
col: drag[3]
};
}
if (start) {
_data = SheetClip.parse(datamap.getText(priv.selStart.coords(), priv.selEnd.coords()));
instance.runHooks('beforeAutofill', start, end, _data);
grid.populateFromArray(start, _data, end, 'autofill');
selection.setRangeStart({row: drag[0], col: drag[1]});
selection.setRangeEnd({row: drag[2], col: drag[3]});
}
/*else {
//reset to avoid some range bug
selection.refreshBorders();
}*/
},
/**
* Show fill border
*/
showBorder: function (coords) {
coords.row = coords[0];
coords.col = coords[1];
var corners = grid.getCornerCoords([priv.selStart.coords(), priv.selEnd.coords()]);
if (priv.settings.fillHandle !== 'horizontal' && (corners.BR.row < coords.row || corners.TL.row > coords.row)) {
coords = [coords.row, corners.BR.col];
}
else if (priv.settings.fillHandle !== 'vertical') {
coords = [corners.BR.row, coords.col];
}
else {
return; //wrong direction
}
instance.view.wt.selections.fill.clear();
instance.view.wt.selections.fill.add([priv.selStart.coords().row, priv.selStart.coords().col]);
instance.view.wt.selections.fill.add([priv.selEnd.coords().row, priv.selEnd.coords().col]);
instance.view.wt.selections.fill.add(coords);
instance.view.render();
}
};
editproxy = { //this public assignment is only temporary
/**
* Create input field
*/
init: function () {
function onCut() {
selection.empty();
}
function onPaste(str) {
var input = str.replace(/^[\r\n]*/g, '').replace(/[\r\n]*$/g, '') //remove newline from the start and the end of the input
, inputArray = SheetClip.parse(input)
, coords = grid.getCornerCoords([priv.selStart.coords(), priv.selEnd.coords()])
, areaStart = coords.TL
, areaEnd = {
row: Math.max(coords.BR.row, inputArray.length - 1 + coords.TL.row),
col: Math.max(coords.BR.col, inputArray[0].length - 1 + coords.TL.col)
};
instance.addHookOnce('afterChange', function (changes, source) {
if (changes.length) {
instance.selectCell(areaStart.row, areaStart.col, areaEnd.row, areaEnd.col);
}
});
grid.populateFromArray(areaStart, inputArray, areaEnd, 'paste', priv.settings.pasteMode);
}
var $body = $(document.body);
function onKeyDown(event) {
if (priv.settings.beforeOnKeyDown) { // HOT in HOT Plugin
priv.settings.beforeOnKeyDown.call(instance, event);
}
if ($body.children('.context-menu-list:visible').length) {
return;
}
if (event.keyCode === 17 || event.keyCode === 224 || event.keyCode === 91 || event.keyCode === 93) {
//when CTRL is pressed, prepare selectable text in textarea
//http://stackoverflow.com/questions/3902635/how-does-one-capture-a-macs-command-key-via-javascript
editproxy.setCopyableText();
return;
}
priv.lastKeyCode = event.keyCode;
if (selection.isSelected()) {
var ctrlDown = (event.ctrlKey || event.metaKey) && !event.altKey; //catch CTRL but not right ALT (which in some systems triggers ALT+CTRL)
if (Handsontable.helper.isPrintableChar(event.keyCode) && ctrlDown) {
if (event.keyCode === 65) { //CTRL + A
selection.selectAll(); //select all cells
editproxy.setCopyableText();
event.preventDefault();
}
else if (event.keyCode === 89 || (event.shiftKey && event.keyCode === 90)) { //CTRL + Y or CTRL + SHIFT + Z
priv.undoRedo && priv.undoRedo.redo();
}
else if (event.keyCode === 90) { //CTRL + Z
priv.undoRedo && priv.undoRedo.undo();
}
return;
}
var rangeModifier = event.shiftKey ? selection.setRangeEnd : selection.setRangeStart;
instance.runHooks('beforeKeyDown', event);
if (!event.isImmediatePropagationStopped()) {
switch (event.keyCode) {
case 38: /* arrow up */
if (event.shiftKey) {
selection.transformEnd(-1, 0);
}
else {
selection.transformStart(-1, 0);
}
event.preventDefault();
event.stopPropagation(); //required by HandsontableEditor
break;
case 9: /* tab */
var tabMoves = typeof priv.settings.tabMoves === 'function' ? priv.settings.tabMoves(event) : priv.settings.tabMoves;
if (event.shiftKey) {
selection.transformStart(-tabMoves.row, -tabMoves.col); //move selection left
}
else {
selection.transformStart(tabMoves.row, tabMoves.col, true); //move selection right (add a new column if needed)
}
event.preventDefault();
event.stopPropagation(); //required by HandsontableEditor
break;
case 39: /* arrow right */
if (event.shiftKey) {
selection.transformEnd(0, 1);
}
else {
selection.transformStart(0, 1);
}
event.preventDefault();
event.stopPropagation(); //required by HandsontableEditor
break;
case 37: /* arrow left */
if (event.shiftKey) {
selection.transformEnd(0, -1);
}
else {
selection.transformStart(0, -1);
}
event.preventDefault();
event.stopPropagation(); //required by HandsontableEditor
break;
case 8: /* backspace */
case 46: /* delete */
selection.empty(event);
event.preventDefault();
break;
case 40: /* arrow down */
if (event.shiftKey) {
selection.transformEnd(1, 0); //expanding selection down with shift
}
else {
selection.transformStart(1, 0); //move selection down
}
event.preventDefault();
event.stopPropagation(); //required by HandsontableEditor
break;
case 113: /* F2 */
event.preventDefault(); //prevent Opera from opening Go to Page dialog
break;
case 13: /* return/enter */
var enterMoves = typeof priv.settings.enterMoves === 'function' ? priv.settings.enterMoves(event) : priv.settings.enterMoves;
if (event.shiftKey) {
selection.transformStart(-enterMoves.row, -enterMoves.col); //move selection up
}
else {
selection.transformStart(enterMoves.row, enterMoves.col, true); //move selection down (add a new row if needed)
}
event.preventDefault(); //don't add newline to field
break;
case 36: /* home */
if (event.ctrlKey || event.metaKey) {
rangeModifier({row: 0, col: priv.selStart.col()});
}
else {
rangeModifier({row: priv.selStart.row(), col: 0});
}
event.preventDefault(); //don't scroll the window
event.stopPropagation(); //required by HandsontableEditor
break;
case 35: /* end */
if (event.ctrlKey || event.metaKey) {
rangeModifier({row: instance.countRows() - 1, col: priv.selStart.col()});
}
else {
rangeModifier({row: priv.selStart.row(), col: instance.countCols() - 1});
}
event.preventDefault(); //don't scroll the window
event.stopPropagation(); //required by HandsontableEditor
break;
case 33: /* pg up */
selection.transformStart(-instance.countVisibleRows(), 0);
instance.view.wt.scrollVertical(-instance.countVisibleRows());
instance.view.render();
event.preventDefault(); //don't page up the window
event.stopPropagation(); //required by HandsontableEditor
break;
case 34: /* pg down */
selection.transformStart(instance.countVisibleRows(), 0);
instance.view.wt.scrollVertical(instance.countVisibleRows());
instance.view.render();
event.preventDefault(); //don't page down the window
event.stopPropagation(); //required by HandsontableEditor
break;
default:
break;
}
}
}
}
instance.copyPaste = new CopyPaste(instance.rootElement[0]);
instance.copyPaste.onCut(onCut);
instance.copyPaste.onPaste(onPaste);
instance.rootElement.on('keydown.handsontable.' + instance.guid, onKeyDown);
},
/**
* Destroy current editor, if exists
* @param {Boolean} revertOriginal
*/
destroy: function (revertOriginal) {
if (typeof priv.editorDestroyer === "function") {
var destroyer = priv.editorDestroyer; //this copy is needed, otherwise destroyer can enter an infinite loop
priv.editorDestroyer = null;
destroyer(revertOriginal);
}
},
/**
* Prepares copyable text in the invisible textarea
*/
setCopyableText: function () {
var startRow = Math.min(priv.selStart.row(), priv.selEnd.row());
var startCol = Math.min(priv.selStart.col(), priv.selEnd.col());
var endRow = Math.max(priv.selStart.row(), priv.selEnd.row());
var endCol = Math.max(priv.selStart.col(), priv.selEnd.col());
var finalEndRow = Math.min(endRow, startRow + priv.settings.copyRowsLimit - 1);
var finalEndCol = Math.min(endCol, startCol + priv.settings.copyColsLimit - 1);
instance.copyPaste.copyable(datamap.getText({row: startRow, col: startCol}, {row: finalEndRow, col: finalEndCol}));
if (endRow !== finalEndRow || endCol !== finalEndCol) {
instance.runHooks("afterCopyLimit", endRow - startRow + 1, endCol - startCol + 1, priv.settings.copyRowsLimit, priv.settings.copyColsLimit);
}
},
/**
* Prepare text input to be displayed at given grid cell
*/
prepare: function () {
if (!instance.getCellMeta(priv.selStart.row(), priv.selStart.col()).isWritable) {
return;
}
instance.listen();
var TD = instance.view.getCellAtCoords(priv.selStart.coords());
priv.editorDestroyer = instance.view.applyCellTypeMethod('editor', TD, priv.selStart.row(), priv.selStart.col());
//presumably TD can be removed from here. Cell editor should also listen for changes if editable cell is outside from viewport
}
};
this.init = function () {
instance.runHooks('beforeInit');
editproxy.init();
this.updateSettings(priv.settings, true);
this.parseSettingsFromDOM();
this.focusCatcher = new Handsontable.FocusCatcher(this);
this.view = new Handsontable.TableView(this);
this.forceFullRender = true; //used when data was changed
this.view.render();
if (typeof priv.firstRun === 'object') {
instance.runHooks('afterChange', priv.firstRun[0], priv.firstRun[1]);
priv.firstRun = false;
}
instance.runHooks('afterInit');
};
function validateChanges(changes, source) {
var validated = $.Deferred();
var deferreds = [];
//validate strict autocompletes
var process = function (i) {
var deferred = $.Deferred();
deferreds.push(deferred);
var originalVal = changes[i][3];
var lowercaseVal = typeof originalVal === 'string' ? originalVal.toLowerCase() : null;
return function (source) {
var found = false;
for (var s = 0, slen = source.length; s < slen; s++) {
if (originalVal === source[s]) {
found = true; //perfect match
break;
}
else if (lowercaseVal === source[s].toLowerCase()) {
changes[i][3] = source[s]; //good match, fix the case
found = true;
break;
}
}
if (!found) {
changes[i] = null;
}
deferred.resolve();
}
};
for (var i = changes.length - 1; i >= 0; i--) {
var cellProperties = instance.getCellMeta(changes[i][0], datamap.propToCol(changes[i][1]));
if (cellProperties.strict && cellProperties.source) {
$.isFunction(cellProperties.source) ? cellProperties.source(changes[i][3], process(i)) : process(i)(cellProperties.source);
}
}
$.when.apply($, deferreds).then(function () {
for (var i = changes.length - 1; i >= 0; i--) {
if (changes[i] === null) {
changes.splice(i, 1);
} else {
var cellProperties = instance.getCellMeta(changes[i][0], datamap.propToCol(changes[i][1]));
if (cellProperties.dataType === 'number' && typeof changes[i][3] === 'string') {
if (changes[i][3].length > 0 && /^[0-9\s]*[.]*[0-9]*$/.test(changes[i][3])) {
changes[i][3] = numeral().unformat(changes[i][3] || '0'); //numeral cannot unformat empty string
}
}
}
}
if (changes.length) {
var result = instance.runHooks("beforeChange", changes, source);
if (typeof result === 'function') {
$.when(result).then(function () {
validated.resolve();
});
}
else {
if (result === false) {
changes.splice(0, changes.length); //invalidate all changes (remove everything from array)
}
validated.resolve();
}
}
else {
validated.resolve();
}
});
return $.when(validated);
}
var fireEvent = function (name, params) {
instance.rootElement.triggerHandler(name, params);
};
/**
* Internal function to apply changes. Called after validateChanges
* @param {Array} changes Array in form of [row, prop, oldValue, newValue]
* @param {String} source String that identifies how this change will be described in changes array (useful in onChange callback)
*/
function applyChanges(changes, source) {
var i = changes.length - 1;
if (i < 0) {
return;
}
for (; 0 <= i; i--) {
if (changes[i] === null) {
changes.splice(i, 1);
continue;
}
if (priv.settings.minSpareRows) {
while (changes[i][0] > instance.countRows() - 1) {
datamap.createRow();
}
}
if (priv.dataType === 'array' && priv.settings.minSpareCols) {
while (datamap.propToCol(changes[i][1]) > instance.countCols() - 1) {
datamap.createCol();
}
}
datamap.set(changes[i][0], changes[i][1], changes[i][3]);
}
instance.forceFullRender = true; //used when data was changed
grid.adjustRowsAndCols();
selection.refreshBorders();
instance.runHooks('afterChange', changes, source || 'edit');
}
function setDataInputToArray(row, prop_or_col, value) {
if (typeof row === "object") { //is it an array of changes
return row;
}
else if ($.isPlainObject(value)) { //backwards compatibility
return value;
}
else {
return [
[row, prop_or_col, value]
];
}
}
/**
* Set data at given cell
* @public
* @param {Number|Array} row or array of changes in format [[row, col, value], ...]
* @param {Number|String} col or source String
* @param {String} value
* @param {String} source String that identifies how this change will be described in changes array (useful in onChange callback)
*/
this.setDataAtCell = function (row, col, value, source) {
var input = setDataInputToArray(row, col, value)
, i
, ilen
, changes = []
, prop;
for (i = 0, ilen = input.length; i < ilen; i++) {
if (typeof input[i] !== 'object') {
throw new Error('Method `setDataAtCell` accepts row number or changes array of arrays as its first parameter');
}
if (typeof input[i][1] !== 'number') {
throw new Error('Method `setDataAtCell` accepts row and column number as its parameters. If you want to use object property name, use method `setDataAtRowProp`');
}
prop = datamap.colToProp(input[i][1]);
changes.push([
input[i][0],
prop,
datamap.get(input[i][0], prop),
input[i][2]
]);
}
if (!source && typeof row === "object") {
source = col;
}
validateChanges(changes, source).then(function () {
applyChanges(changes, source);
});
};
/**
* Set data at given row property
* @public
* @param {Number|Array} row or array of changes in format [[row, prop, value], ...]
* @param {String} prop or source String
* @param {String} value
* @param {String} source String that identifies how this change will be described in changes array (useful in onChange callback)
*/
this.setDataAtRowProp = function (row, prop, value, source) {
var input = setDataInputToArray(row, prop, value)
, i
, ilen
, changes = [];
for (i = 0, ilen = input.length; i < ilen; i++) {
changes.push([
input[i][0],
input[i][1],
datamap.get(input[i][0], input[i][1]),
input[i][2]
]);
}
if (!source && typeof row === "object") {
source = prop;
}
validateChanges(changes, source).then(function () {
applyChanges(changes, source);
});
};
/**
* Listen to keyboard input
*/
this.listen = function () {
instance.focusCatcher.listen();
};
/**
* Destroys current editor, renders and selects current cell. If revertOriginal != true, edited data is saved
* @param {Boolean} revertOriginal
*/
this.destroyEditor = function (revertOriginal) {
selection.refreshBorders(revertOriginal);
};
/**
* Populate cells at position with 2d array
* @param {Number} row Start row
* @param {Number} col Start column
* @param {Array} input 2d array
* @param {Number=} endRow End row (use when you want to cut input when certain row is reached)
* @param {Number=} endCol End column (use when you want to cut input when certain column is reached)
* @param {String=} [source="populateFromArray"]
* @param {String=} [method="overwrite"]
* @return {Object|undefined} ending td in pasted area (only if any cell was changed)
*/
this.populateFromArray = function (row, col, input, endRow, endCol, source, method) {
if (typeof input !== 'object') {
throw new Error("populateFromArray parameter `input` must be an array"); //API changed in 0.9-beta2, let's check if you use it correctly
}
return grid.populateFromArray({row: row, col: col}, input, typeof endRow === 'number' ? {row: endRow, col: endCol} : null, source, method);
};
/**
* Adds/removes data from the column
* @param {Number} col Index of column in which do you want to do splice.
* @param {Number} index Index at which to start changing the array. If negative, will begin that many elements from the end
* @param {Number} amount An integer indicating the number of old array elements to remove. If amount is 0, no elements are removed
* param {...*} elements Optional. The elements to add to the array. If you don't specify any elements, spliceCol simply removes elements from the array
*/
this.spliceCol = function (col, index, amount/*, elements... */) {
return datamap.spliceCol.apply(null, arguments);
};
/**
* Adds/removes data from the row
* @param {Number} row Index of column in which do you want to do splice.
* @param {Number} index Index at which to start changing the array. If negative, will begin that many elements from the end
* @param {Number} amount An integer indicating the number of old array elements to remove. If amount is 0, no elements are removed
* param {...*} elements Optional. The elements to add to the array. If you don't specify any elements, spliceCol simply removes elements from the array
*/
this.spliceRow = function (row, index, amount/*, elements... */) {
return datamap.spliceRow.apply(null, arguments);
};
/**
* Returns the top left (TL) and bottom right (BR) selection coordinates
* @param {Object[]} coordsArr
* @returns {Object}
*/
this.getCornerCoords = function (coordsArr) {
return grid.getCornerCoords(coordsArr);
};
/**
* Returns current selection. Returns undefined if there is no selection.
* @public
* @return {Array} [`startRow`, `startCol`, `endRow`, `endCol`]
*/
this.getSelected = function () { //https://github.com/warpech/jquery-handsontable/issues/44 //cjl
if (selection.isSelected()) {
return [priv.selStart.row(), priv.selStart.col(), priv.selEnd.row(), priv.selEnd.col()];
}
};
/**
* Parse settings from DOM and CSS
* @public
*/
this.parseSettingsFromDOM = function () {
var overflow = this.rootElement.css('overflow');
if (overflow === 'scroll' || overflow === 'auto') {
this.rootElement[0].style.overflow = 'visible';
priv.settingsFromDOM.overflow = overflow;
}
else if (priv.settings.width === void 0 || priv.settings.height === void 0) {
priv.settingsFromDOM.overflow = 'auto';
}
if (priv.settings.width === void 0) {
priv.settingsFromDOM.width = this.rootElement.width();
}
else {
priv.settingsFromDOM.width = void 0;
}
priv.settingsFromDOM.height = void 0;
if (priv.settings.height === void 0) {
if (priv.settingsFromDOM.overflow === 'scroll' || priv.settingsFromDOM.overflow === 'auto') {
//this needs to read only CSS/inline style and not actual height
//so we need to call getComputedStyle on cloned container
var clone = this.rootElement[0].cloneNode(false);
var parent = this.rootElement[0].parentNode;
if (parent) {
clone.removeAttribute('id');
parent.appendChild(clone);
var computedHeight = parseInt(window.getComputedStyle(clone, null).getPropertyValue('height'), 10);
if (computedHeight > 0) {
priv.settingsFromDOM.height = computedHeight;
}
parent.removeChild(clone);
}
}
}
};
/**
* Render visible data
* @public
*/
this.render = function () {
if (instance.view) {
instance.forceFullRender = true; //used when data was changed
instance.parseSettingsFromDOM();
selection.refreshBorders(null, true);
}
};
/**
* Load data from array
* @public
* @param {Array} data
*/
this.loadData = function (data) {
if (!(data.push && data.splice)) { //check if data is array. Must use duck-type check so Backbone Collections also pass it
throw new Error("loadData only accepts array of objects or array of arrays (" + typeof data + " given)");
}
priv.isPopulated = false;
GridSettings.prototype.data = data;
if (priv.settings.dataSchema instanceof Array || data[0] instanceof Array) {
priv.dataType = 'array';
}
else if ($.isFunction(priv.settings.dataSchema)) {
priv.dataType = 'function';
}
else {
priv.dataType = 'object';
}
if (data[0]) {
priv.duckDataSchema = datamap.recursiveDuckSchema(data[0]);
}
else {
priv.duckDataSchema = {};
}
datamap.createMap();
grid.adjustRowsAndCols();
instance.runHooks('afterLoadData');
if (priv.firstRun) {
priv.firstRun = [null, 'loadData'];
}
else {
instance.runHooks('afterChange', null, 'loadData');
instance.render();
}
priv.isPopulated = true;
instance.clearUndo();
};
/**
* Return the current data object (the same that was passed by `data` configuration option or `loadData` method). Optionally you can provide cell range `r`, `c`, `r2`, `c2` to get only a fragment of grid data
* @public
* @param {Number} r (Optional) From row
* @param {Number} c (Optional) From col
* @param {Number} r2 (Optional) To row
* @param {Number} c2 (Optional) To col
* @return {Array|Object}
*/
this.getData = function (r, c, r2, c2) {
if (typeof r === 'undefined') {
return datamap.getAll();
}
else {
return datamap.getRange({row: r, col: c}, {row: r2, col: c2});
}
};
/**
* Update settings
* @public
*/
this.updateSettings = function (settings, init) {
var i, r, rlen, c, clen;
if (typeof settings.rows !== "undefined") {
throw new Error("'rows' setting is no longer supported. do you mean startRows, minRows or maxRows?");
}
if (typeof settings.cols !== "undefined") {
throw new Error("'cols' setting is no longer supported. do you mean startCols, minCols or maxCols?");
}
if (typeof settings.undo !== "undefined") {
if (priv.undoRedo && settings.undo === false) {
priv.undoRedo = null;
}
else if (!priv.undoRedo && settings.undo === true) {
priv.undoRedo = new Handsontable.UndoRedo(instance);
}
}
for (i in settings) {
if (i === 'data') {
continue; //loadData will be triggered later
}
else {
if (hooks[i] !== void 0 || eventMap[i] !== void 0) {
instance.addHook(i, settings[i]);
}
else {
// Update settings
if (!init && settings.hasOwnProperty(i)) {
GridSettings.prototype[i] = settings[i];
}
//launch extensions
if (Handsontable.extension[i]) {
priv.extensions[i] = new Handsontable.extension[i](instance, settings[i]);
}
}
}
}
// Load data or create data map
if (settings.data === void 0 && priv.settings.data === void 0) {
var data = [];
var row;
for (r = 0, rlen = priv.settings.startRows; r < rlen; r++) {
row = [];
for (c = 0, clen = priv.settings.startCols; c < clen; c++) {
row.push(null);
}
data.push(row);
}
instance.loadData(data); //data source created just now
}
else if (settings.data !== void 0) {
instance.loadData(settings.data); //data source given as option
}
else if (settings.columns !== void 0) {
datamap.createMap();
}
// Init columns constructors configuration
clen = instance.countCols();
if (clen > 0) {
var prop, proto, column;
for (i = 0; i < clen; i++) {
priv.columnSettings[i] = Handsontable.helper.columnFactory(GridSettings, priv.columnsSettingConflicts, Handsontable.TextCell);
// shortcut for prototype
proto = priv.columnSettings[i].prototype;
// Use settings provided by user
if (GridSettings.prototype.columns) {
column = GridSettings.prototype.columns[i];
for (prop in column) {
if (column.hasOwnProperty(prop)) {
proto[prop] = column[prop];
}
}
}
}
}
if (typeof settings.fillHandle !== "undefined") {
if (autofill.handle && settings.fillHandle === false) {
autofill.disable();
}
else if (!autofill.handle && settings.fillHandle !== false) {
autofill.init();
}
}
grid.adjustRowsAndCols();
if (instance.view) {
instance.forceFullRender = true; //used when data was changed
selection.refreshBorders(null, true);
}
};
/**
* Returns current settings object
* @return {Object}
*/
this.getSettings = function () {
return priv.settings;
};
/**
* Returns current settingsFromDOM object
* @return {Object}
*/
this.getSettingsFromDOM = function () {
return priv.settingsFromDOM;
};
/**
* Clears grid
* @public
*/
this.clear = function () {
selection.selectAll();
selection.empty();
};
/**
* Return true if undo can be performed, false otherwise
* @public
*/
this.isUndoAvailable = function () {
return priv.undoRedo && priv.undoRedo.isUndoAvailable();
};
/**
* Return true if redo can be performed, false otherwise
* @public
*/
this.isRedoAvailable = function () {
return priv.undoRedo && priv.undoRedo.isRedoAvailable();
};
/**
* Undo last edit
* @public
*/
this.undo = function () {
priv.undoRedo && priv.undoRedo.undo();
};
/**
* Redo edit (used to reverse an undo)
* @public
*/
this.redo = function () {
priv.undoRedo && priv.undoRedo.redo();
};
/**
* Clears undo history
* @public
*/
this.clearUndo = function () {
priv.undoRedo && priv.undoRedo.clear();
};
/**
* Inserts or removes rows and columns
* @param {String} action See grid.alter for possible values
* @param {Number} index
* @param {Number} amount
* @param {String} [source] Optional. Source of hook runner.
* @param {Boolean} [keepEmptyRows] Optional. Flag for preventing deletion of empty rows.
* @public
*/
this.alter = function (action, index, amount, source, keepEmptyRows) {
grid.alter(action, index, amount, source, keepEmptyRows);
};
/**
* Returns <td> element corresponding to params row, col
* @param {Number} row
* @param {Number} col
* @public
* @return {Element}
*/
this.getCell = function (row, col) {
return instance.view.getCellAtCoords({row: row, col: col});
};
/**
* Returns property name associated with column number
* @param {Number} col
* @public
* @return {String}
*/
this.colToProp = function (col) {
return datamap.colToProp(col);
};
/**
* Returns column number associated with property name
* @param {String} prop
* @public
* @return {Number}
*/
this.propToCol = function (prop) {
return datamap.propToCol(prop);
};
/**
* Return value at `row`, `col`
* @param {Number} row
* @param {Number} col
* @public
* @return value (mixed data type)
*/
this.getDataAtCell = function (row, col) {
return datamap.get(row, datamap.colToProp(col));
};
/**
* Return value at `row`, `prop`
* @param {Number} row
* @param {String} prop
* @public
* @return value (mixed data type)
*/
this.getDataAtRowProp = function (row, prop) {
return datamap.get(row, prop);
};
/**
* Return value at `col`
* @param {Number} col
* @public
* @return value (mixed data type)
*/
this.getDataAtCol = function (col) {
return [].concat.apply([], datamap.getRange({row: 0, col: col}, {row: priv.settings.data.length - 1, col: col}));
};
/**
* Return value at `prop`
* @param {String} prop
* @public
* @return value (mixed data type)
*/
this.getDataAtProp = function (prop) {
return [].concat.apply([], datamap.getRange({row: 0, col: datamap.propToCol(prop)}, {row: priv.settings.data.length - 1, col: datamap.propToCol(prop)}));
};
/**
* Return value at `row`
* @param {Number} row
* @public
* @return value (mixed data type)
*/
this.getDataAtRow = function (row) {
return priv.settings.data[row];
};
/**
* Returns cell meta data object corresponding to params row, col
* @param {Number} row
* @param {Number} col
* @public
* @return {Object}
*/
this.getCellMeta = function (row, col) {
var cellConstructor = function () {
}
, prop = datamap.colToProp(col)
, cellProperties
, type
, i;
if ("undefined" === typeof priv.columnSettings[col]) {
priv.columnSettings[col] = Handsontable.helper.columnFactory(GridSettings, priv.columnsSettingConflicts, Handsontable.TextCell);
}
cellConstructor.prototype = new priv.columnSettings[col]();
if (priv.settings.cells) {
var settings = priv.settings.cells(row, col, prop) || {}
, key;
for (key in settings) {
if (settings.hasOwnProperty(key)) {
cellConstructor.prototype[key] = settings[key];
}
}
}
cellProperties = new cellConstructor();
instance.runHooks('beforeGetCellMeta', row, col, cellProperties);
if (typeof cellProperties.type === 'string') {
type = Handsontable.cellTypes[cellProperties.type];
if (type === void 0) {
throw new Error('You declared cell type "' + cellProperties.type + '" as a string that is not mapped to a known object. Cell type must be an object or a string mapped to an object in Handsontable.cellTypes');
}
}
else if (typeof cellProperties.type === 'object') {
type = cellProperties.type;
}
if (type) {
for (i in type) {
if (type.hasOwnProperty(i)) {
cellProperties[i] = type[i];
}
}
}
cellProperties.isWritable = !cellProperties.readOnly;
instance.runHooks('afterGetCellMeta', row, col, cellProperties);
return cellProperties;
};
/**
* Return array of row headers (if they are enabled). If param `row` given, return header at given row as string
* @param {Number} row (Optional)
* @return {Array|String}
*/
this.getRowHeader = function (row) {
if (row === void 0) {
var out = [];
for (var i = 0, ilen = instance.countRows(); i < ilen; i++) {
out.push(instance.getRowHeader(i));
}
return out;
}
else if (Object.prototype.toString.call(priv.settings.rowHeaders) === '[object Array]' && priv.settings.rowHeaders[row] !== void 0) {
return priv.settings.rowHeaders[row];
}
else if (typeof priv.settings.rowHeaders === 'function') {
return priv.settings.rowHeaders(row);
}
else if (priv.settings.rowHeaders && typeof priv.settings.rowHeaders !== 'string' && typeof priv.settings.rowHeaders !== 'number') {
return row + 1;
}
else {
return priv.settings.rowHeaders;
}
};
/**
* Return array of column headers (if they are enabled). If param `col` given, return header at given column as string
* @param {Number} col (Optional)
* @return {Array|String}
*/
this.getColHeader = function (col) {
if (col === void 0) {
var out = [];
for (var i = 0, ilen = instance.countCols(); i < ilen; i++) {
out.push(instance.getColHeader(i));
}
return out;
}
else {
col = Handsontable.PluginModifiers.run(instance, 'col', col);
if (priv.settings.columns && priv.settings.columns[col] && priv.settings.columns[col].title) {
return priv.settings.columns[col].title;
}
else if (Object.prototype.toString.call(priv.settings.colHeaders) === '[object Array]' && priv.settings.colHeaders[col] !== void 0) {
return priv.settings.colHeaders[col];
}
else if (typeof priv.settings.colHeaders === 'function') {
return priv.settings.colHeaders(col);
}
else if (priv.settings.colHeaders && typeof priv.settings.colHeaders !== 'string' && typeof priv.settings.colHeaders !== 'number') {
return Handsontable.helper.spreadsheetColumnLabel(col);
}
else {
return priv.settings.colHeaders;
}
}
};
/**
* Return column width
* @param {Number} col
* @return {Number}
*/
this.getColWidth = function (col) {
col = Handsontable.PluginModifiers.run(instance, 'col', col);
var response = {};
if (priv.settings.columns && priv.settings.columns[col] && priv.settings.columns[col].width) {
response.width = priv.settings.columns[col].width;
}
else if (Object.prototype.toString.call(priv.settings.colWidths) === '[object Array]' && priv.settings.colWidths[col] !== void 0) {
response.width = priv.settings.colWidths[col];
}
else {
response.width = 50;
}
instance.runHooks('afterGetColWidth', col, response);
return response.width;
};
/**
* Return total number of rows in grid
* @return {Number}
*/
this.countRows = function () {
return priv.settings.data.length;
};
/**
* Return total number of columns in grid
* @return {Number}
*/
this.countCols = function () {
if (priv.dataType === 'object' || priv.dataType === 'function') {
if (priv.settings.columns && priv.settings.columns.length) {
return priv.settings.columns.length;
}
else {
return priv.colToProp.length;
}
}
else if (priv.dataType === 'array') {
if (priv.settings.columns && priv.settings.columns.length) {
return priv.settings.columns.length;
}
else if (priv.settings.data && priv.settings.data[0] && priv.settings.data[0].length) {
return priv.settings.data[0].length;
}
else {
return 0;
}
}
};
/**
* Return index of first visible row
* @return {Number}
*/
this.rowOffset = function () {
return instance.view.wt.getSetting('offsetRow');
};
/**
* Return index of first visible column
* @return {Number}
*/
this.colOffset = function () {
return instance.view.wt.getSetting('offsetColumn');
};
/**
* Return number of visible rows
* @return {Number}
*/
this.countVisibleRows = function () {
return instance.view.wt.wtTable.countVisibleRows();
};
/**
* Return number of visible columns
* @return {Number}
*/
this.countVisibleCols = function () {
return instance.view.wt.wtTable.countVisibleColumns();
};
/**
* Return number of empty rows
* @return {Boolean} ending If true, will only count empty rows at the end of the data source
*/
this.countEmptyRows = function (ending) {
var i = instance.countRows() - 1
, empty = 0;
while (i >= 0) {
if (instance.isEmptyRow(i)) {
empty++;
}
else if (ending) {
break;
}
i--;
}
return empty;
};
/**
* Return number of empty columns
* @return {Boolean} ending If true, will only count empty columns at the end of the data source row
*/
this.countEmptyCols = function (ending) {
if (instance.countRows() < 1) {
return 0;
}
var i = instance.countCols() - 1
, empty = 0;
while (i >= 0) {
if (instance.isEmptyCol(i)) {
empty++;
}
else if (ending) {
break;
}
i--;
}
return empty;
};
/**
* Return true if the row at the given index is empty, false otherwise
* @param {Number} r Row index
* @return {Boolean}
*/
this.isEmptyRow = function (r) {
if (priv.settings.isEmptyRow) {
return priv.settings.isEmptyRow.call(this, r);
}
var val;
for (var c = 0, clen = this.countCols(); c < clen; c++) {
val = this.getDataAtCell(r, c);
if (val !== '' && val !== null && typeof val !== 'undefined') {
return false;
}
}
return true;
};
/**
* Return true if the column at the given index is empty, false otherwise
* @param {Number} c Column index
* @return {Boolean}
*/
this.isEmptyCol = function (c) {
if (priv.settings.isEmptyCol) {
return priv.settings.isEmptyCol.call(this, c);
}
var val;
for (var r = 0, rlen = this.countRows(); r < rlen; r++) {
val = this.getDataAtCell(r, c);
if (val !== '' && val !== null && typeof val !== 'undefined') {
return false;
}
}
return true;
};
/**
* Selects cell on grid. Optionally selects range to another cell
* @param {Number} row
* @param {Number} col
* @param {Number} [endRow]
* @param {Number} [endCol]
* @param {Boolean} [scrollToCell=true] If true, viewport will be scrolled to the selection
* @public
* @return {Boolean}
*/
this.selectCell = function (row, col, endRow, endCol, scrollToCell) {
if (typeof row !== 'number' || row < 0 || row >= instance.countRows()) {
return false;
}
if (typeof col !== 'number' || col < 0 || col >= instance.countCols()) {
return false;
}
if (typeof endRow !== "undefined") {
if (typeof endRow !== 'number' || endRow < 0 || endRow >= instance.countRows()) {
return false;
}
if (typeof endCol !== 'number' || endCol < 0 || endCol >= instance.countCols()) {
return false;
}
}
priv.selStart.coords({row: row, col: col});
instance.listen(); //needed or otherwise prepare won't focus the cell. selectionSpec tests this (should move focus to selected cell)
if (typeof endRow === "undefined") {
selection.setRangeEnd({row: row, col: col}, scrollToCell);
}
else {
selection.setRangeEnd({row: endRow, col: endCol}, scrollToCell);
}
instance.selection.finish();
return true;
};
this.selectCellByProp = function (row, prop, endRow, endProp, scrollToCell) {
arguments[1] = datamap.propToCol(arguments[1]);
if (typeof arguments[3] !== "undefined") {
arguments[3] = datamap.propToCol(arguments[3]);
}
return instance.selectCell.apply(instance, arguments);
};
/**
* Deselects current sell selection on grid
* @public
*/
this.deselectCell = function () {
selection.deselect();
};
/**
* Remove grid from DOM
* @public
*/
this.destroy = function () {
instance.clearTimeouts();
if (instance.view) { //in case HT is destroyed before initialization has finished
instance.view.wt.destroy();
}
instance.rootElement.empty();
instance.rootElement.removeData('handsontable');
instance.rootElement.off('.handsontable');
$(window).off('.' + instance.guid);
$(document.documentElement).off('.' + instance.guid);
instance.runHooks('afterDestroy');
};
/**
* Return Handsontable instance
* @public
* @return {Object}
*/
this.getInstance = function () {
return instance.rootElement.data("handsontable");
};
/**
* Add PluginHook to this instance
* @public
*/
this.addHook = function (key, fn) {
// provide support for old versions of HOT
if (key in eventMap) {
key = eventMap[key];
}
if (typeof hooks[key] === "undefined") {
hooks[key] = [];
}
if (fn instanceof Array) {
for (var i = 0, len = fn.length; i < len; i++) {
hooks[key].push(fn[i]);
}
} else {
hooks[key].push(fn);
}
};
/**
* Add 'once run' PluginHook to this instance
* @public
*/
this.addHookOnce = function (key, fn) {
// provide support for old versions of HOT
if (key in eventMap) {
key = eventMap[key];
}
if (typeof hooks[key] === "undefined") {
hooks[key] = [];
}
var wrapper = function () {
this.removeHook(key, wrapper);
return fn.apply(this, arguments);
};
hooks[key].push(wrapper);
};
/**
* Remove PluginHook from this instance
* @public
* @return {Boolean}
*/
this.removeHook = function (key, fn) {
// provide support for old versions of HOT
if (key in eventMap) {
key = eventMap[key];
}
for (var i = 0, len = hooks[key].length; i < len; i++) {
if (hooks[key][i] == fn) {
hooks[key].splice(i, 1);
return true;
}
}
return false;
};
/**
* Run all PluginHooks (global and public)
* @public
*/
this.runHooks = function (key, p1, p2, p3, p4, p5) {
// provide support for old versions of HOT
if (key in eventMap) {
key = eventMap[key];
}
if (typeof hooks[key] !== 'undefined') {
for (var i = 0, len = hooks[key].length; i < len; i++) {
hooks[key][i].call(instance, p1, p2, p3, p4, p5);
}
}
Handsontable.PluginHooks.run(instance, key, p1, p2, p3, p4, p5);
};
this.timeouts = {};
/**
* Sets timeout. Purpose of this method is to clear all known timeouts when `destroy` method is called
* @public
*/
this.registerTimeout = function (key, handle, ms) {
clearTimeout(this.timeouts[key]);
this.timeouts[key] = setTimeout(handle, ms || 0);
};
/**
* Clears all known timeouts
* @public
*/
this.clearTimeouts = function () {
for (var key in this.timeouts) {
if (this.timeouts.hasOwnProperty(key)) {
clearTimeout(this.timeouts[key]);
}
}
};
/**
* Handsontable version
*/
this.version = '0.9.0'; //inserted by grunt from package.json
};
var DefaultSettings = function () {
};
DefaultSettings.prototype = {
data: void 0,
width: void 0,
height: void 0,
startRows: 5,
startCols: 5,
minRows: 0,
minCols: 0,
maxRows: Infinity,
maxCols: Infinity,
minSpareRows: 0,
minSpareCols: 0,
multiSelect: true,
fillHandle: true,
undo: true,
outsideClickDeselects: true,
enterBeginsEditing: true,
enterMoves: {row: 1, col: 0},
tabMoves: {row: 0, col: 1},
autoWrapRow: false,
autoWrapCol: false,
copyRowsLimit: 1000,
copyColsLimit: 1000,
pasteMode: 'overwrite',
currentRowClassName: void 0,
currentColClassName: void 0,
stretchH: 'hybrid',
isEmptyRow: void 0,
isEmptyCol: void 0,
observeDOMVisibility: true
};
$.fn.handsontable = function (action) {
var i
, ilen
, args
, output
, userSettings
, $this = this.first() // Use only first element from list
, instance = $this.data('handsontable');
// Init case
if (typeof action !== 'string') {
userSettings = action || {};
if (instance) {
instance.updateSettings(userSettings);
}
else {
instance = new Handsontable.Core($this, userSettings);
$this.data('handsontable', instance);
instance.init();
}
return $this;
}
// Action case
else {
args = [];
if (arguments.length > 1) {
for (i = 1, ilen = arguments.length; i < ilen; i++) {
args.push(arguments[i]);
}
}
if (instance) {
if (typeof instance[action] !== 'undefined') {
output = instance[action].apply(instance, args);
}
else {
throw new Error('Handsontable do not provide action: ' + action);
}
}
return output;
}
};
Handsontable.FocusCatcher = function (instance) {
this.el = document.createElement('DIV');
this.el.style.position = 'fixed';
this.el.style.top = '0';
this.el.style.left = '0';
this.el.style.width = '1px';
this.el.style.height = '1px';
this.el.setAttribute('tabindex', 10000); //http://www.barryvan.com.au/2009/01/onfocus-and-onblur-for-divs-in-fx/; 32767 is max tabindex for IE7,8
instance.rootElement.append(this.el);
this.$el = $(this.el);
};
Handsontable.FocusCatcher.prototype.listen = function () {
this.el.focus();
};
/**
* Handsontable TableView constructor
* @param {Object} instance
*/
Handsontable.TableView = function (instance) {
var that = this
, $window = $(window)
, $documentElement = $(document.documentElement);
this.instance = instance;
this.settings = instance.getSettings();
this.settingsFromDOM = instance.getSettingsFromDOM();
instance.rootElement.data('originalStyle', instance.rootElement.attr('style')); //needed to retrieve original style in jsFiddle link generator in HT examples. may be removed in future versions
instance.rootElement.addClass('handsontable');
var table = document.createElement('TABLE');
table.className = 'htCore';
table.appendChild(document.createElement('THEAD'));
table.appendChild(document.createElement('TBODY'));
instance.$table = $(table);
instance.rootElement.prepend(instance.$table);
$documentElement.on('keyup.' + instance.guid, function (event) {
if (instance.selection.isInProgress() && !event.shiftKey) {
instance.selection.finish();
}
});
var isMouseDown
, dragInterval;
$documentElement.on('mouseup.' + instance.guid, function (event) {
if (instance.selection.isInProgress() && event.which === 1) { //is left mouse button
instance.selection.finish();
}
isMouseDown = false;
clearInterval(dragInterval);
dragInterval = null;
if (instance.autofill.handle && instance.autofill.handle.isDragged) {
if (instance.autofill.handle.isDragged > 1) {
instance.autofill.apply();
}
instance.autofill.handle.isDragged = 0;
}
});
$documentElement.on('mousedown.' + instance.guid, function (event) {
var next = event.target;
if (next !== that.wt.wtTable.spreader) { //immediate click on "spreader" means click on the right side of vertical scrollbar
while (next !== null && next !== document.documentElement) {
//X-HANDSONTABLE is the tag name in Web Components version of HOT. Removal of this breaks cell selection
if (next === instance.rootElement[0] || next.nodeName === 'X-HANDSONTABLE' || next.id === 'context-menu-layer' || $(next).is('.context-menu-list') || $(next).is('.typeahead li')) {
return; //click inside container
}
next = next.parentNode;
}
}
if (that.settings.outsideClickDeselects) {
instance.deselectCell();
}
else {
instance.destroyEditor();
}
});
instance.$table.on('selectstart', function (event) {
//https://github.com/warpech/jquery-handsontable/issues/160
//selectstart is IE only event. Prevent text from being selected when performing drag down in IE8
event.preventDefault();
});
instance.$table.on('mouseenter', function () {
if (dragInterval) { //if dragInterval was set (that means mouse was really outside of table, not over an element that is outside of <table> in DOM
clearInterval(dragInterval);
dragInterval = null;
}
});
instance.$table.on('mouseleave', function (event) {
if (!(isMouseDown || (instance.autofill.handle && instance.autofill.handle.isDragged))) {
return;
}
var tolerance = 1 //this is needed because width() and height() contains stuff like cell borders
, offset = that.wt.wtDom.offset(table)
, offsetTop = offset.top + tolerance
, offsetLeft = offset.left + tolerance
, width = that.containerWidth - that.wt.getSetting('scrollbarWidth') - 2 * tolerance
, height = that.containerHeight - that.wt.getSetting('scrollbarHeight') - 2 * tolerance
, method
, row = 0
, col = 0
, dragFn;
if (event.pageY < offsetTop) { //top edge crossed
row = -1;
method = 'scrollVertical';
}
else if (event.pageY >= offsetTop + height) { //bottom edge crossed
row = 1;
method = 'scrollVertical';
}
else if (event.pageX < offsetLeft) { //left edge crossed
col = -1;
method = 'scrollHorizontal';
}
else if (event.pageX >= offsetLeft + width) { //right edge crossed
col = 1;
method = 'scrollHorizontal';
}
if (method) {
dragFn = function () {
if (isMouseDown || (instance.autofill.handle && instance.autofill.handle.isDragged)) {
//instance.selection.transformEnd(row, col);
that.wt[method](row + col).draw();
}
};
dragFn();
dragInterval = setInterval(dragFn, 100);
}
});
var clearTextSelection = function () {
//http://stackoverflow.com/questions/3169786/clear-text-selection-with-javascript
if (window.getSelection) {
if (window.getSelection().empty) { // Chrome
window.getSelection().empty();
} else if (window.getSelection().removeAllRanges) { // Firefox
window.getSelection().removeAllRanges();
}
} else if (document.selection) { // IE?
document.selection.empty();
}
};
var walkontableConfig = {
table: table,
stretchH: this.settings.stretchH,
data: instance.getDataAtCell,
totalRows: instance.countRows,
totalColumns: instance.countCols,
offsetRow: 0,
offsetColumn: 0,
width: this.getWidth(),
height: this.getHeight(),
fixedColumnsLeft: this.settings.fixedColumnsLeft,
fixedRowsTop: this.settings.fixedRowsTop,
rowHeaders: this.settings.rowHeaders ? [function (index, TH) {
that.appendRowHeader(index, TH);
}] : [],
columnHeaders: this.settings.colHeaders ? [function (index, TH) {
that.appendColHeader(index, TH);
}] : [],
columnWidth: instance.getColWidth,
cellRenderer: function (row, column, TD) {
that.applyCellTypeMethod('renderer', TD, row, column);
},
selections: {
current: {
className: 'current',
border: {
width: 2,
color: '#5292F7',
style: 'solid',
cornerVisible: function () {
return that.settings.fillHandle && !that.isCellEdited() && !instance.selection.isMultiple()
}
}
},
area: {
className: 'area',
border: {
width: 1,
color: '#89AFF9',
style: 'solid',
cornerVisible: function () {
return that.settings.fillHandle && !that.isCellEdited() && instance.selection.isMultiple()
}
}
},
highlight: {
highlightRowClassName: that.settings.currentRowClassName,
highlightColumnClassName: that.settings.currentColClassName
},
fill: {
className: 'fill',
border: {
width: 1,
color: 'red',
style: 'solid'
}
}
},
onCellMouseDown: function (event, coords, TD) {
isMouseDown = true;
var coordsObj = {row: coords[0], col: coords[1]};
if (event.button === 2 && instance.selection.inInSelection(coordsObj)) { //right mouse button
//do nothing
}
else if (event.shiftKey) {
instance.selection.setRangeEnd(coordsObj);
}
else {
instance.selection.setRangeStart(coordsObj);
}
event.preventDefault();
clearTextSelection();
if (that.settings.afterOnCellMouseDown) {
that.settings.afterOnCellMouseDown.call(instance, event, coords, TD);
}
setTimeout(function () {
instance.listen(); //fix IE7-8 bug that sets focus to TD after mousedown
});
},
onCellMouseOver: function (event, coords, TD) {
var coordsObj = {row: coords[0], col: coords[1]};
if (isMouseDown) {
instance.selection.setRangeEnd(coordsObj);
}
else if (instance.autofill.handle && instance.autofill.handle.isDragged) {
instance.autofill.handle.isDragged++;
instance.autofill.showBorder(coords);
}
},
onCellCornerMouseDown: function (event) {
instance.autofill.handle.isDragged = 1;
event.preventDefault();
},
onCellCornerDblClick: function () {
instance.autofill.selectAdjacent();
},
beforeDraw: function (force) {
that.beforeRender(force);
}
};
instance.runHooks('beforeInitWalkontable', walkontableConfig);
this.wt = new Walkontable(walkontableConfig);
$window.on('resize.' + instance.guid, function () {
instance.registerTimeout('resizeTimeout', function () {
instance.parseSettingsFromDOM();
var newWidth = that.getWidth();
var newHeight = that.getHeight();
if (walkontableConfig.width !== newWidth || walkontableConfig.height !== newHeight) {
instance.forceFullRender = true;
that.render();
walkontableConfig.width = newWidth;
walkontableConfig.height = newHeight;
}
}, 60);
});
$(that.wt.wtTable.spreader).on('mousedown.handsontable, contextmenu.handsontable', function (event) {
if (event.target === that.wt.wtTable.spreader && event.which === 3) { //right mouse button exactly on spreader means right clickon the right hand side of vertical scrollbar
event.stopPropagation();
}
});
$documentElement.on('click.' + instance.guid, function () {
if (that.settings.observeDOMVisibility) {
if (that.wt.drawInterrupted) {
that.instance.forceFullRender = true;
that.render();
}
}
});
};
Handsontable.TableView.prototype.isCellEdited = function () {
return (this.instance.textEditor && this.instance.textEditor.isCellEdited) || (this.instance.autocompleteEditor && this.instance.autocompleteEditor.isCellEdited) || (this.instance.handsontableEditor && this.instance.handsontableEditor.isCellEdited);
};
Handsontable.TableView.prototype.getWidth = function () {
var val = this.settings.width !== void 0 ? this.settings.width : this.settingsFromDOM.width;
return typeof val === 'function' ? val() : val;
};
Handsontable.TableView.prototype.getHeight = function () {
var val = this.settings.height !== void 0 ? this.settings.height : this.settingsFromDOM.height;
return typeof val === 'function' ? val() : val;
};
Handsontable.TableView.prototype.beforeRender = function (force) {
if (force) {
this.instance.runHooks('beforeRender');
this.wt.update('width', this.getWidth());
this.wt.update('height', this.getHeight());
}
};
Handsontable.TableView.prototype.render = function () {
this.wt.draw(!this.instance.forceFullRender);
this.instance.rootElement.triggerHandler('render.handsontable');
if (this.instance.forceFullRender) {
this.instance.runHooks('afterRender');
}
this.instance.forceFullRender = false;
};
Handsontable.TableView.prototype.applyCellTypeMethod = function (methodName, td, row, col) {
var prop = this.instance.colToProp(col)
, cellProperties = this.instance.getCellMeta(row, col)
, method = Handsontable.helper.getCellMethod(methodName, cellProperties[methodName]); //methodName is 'renderer' or 'editor'
return method(this.instance, td, row, col, prop, this.instance.getDataAtRowProp(row, prop), cellProperties);
};
/**
* Returns td object given coordinates
*/
Handsontable.TableView.prototype.getCellAtCoords = function (coords) {
var td = this.wt.wtTable.getCell([coords.row, coords.col]);
if (td < 0) { //there was an exit code (cell is out of bounds)
return null;
}
else {
return td;
}
};
/**
* Scroll viewport to selection
* @param coords
*/
Handsontable.TableView.prototype.scrollViewport = function (coords) {
this.wt.scrollViewport([coords.row, coords.col]);
};
/**
* Append row header to a TH element
* @param row
* @param TH
*/
Handsontable.TableView.prototype.appendRowHeader = function (row, TH) {
if (row > -1) {
this.wt.wtDom.avoidInnerHTML(TH, this.instance.getRowHeader(row));
}
else {
this.wt.wtDom.empty(TH);
}
};
/**
* Append column header to a TH element
* @param col
* @param TH
*/
Handsontable.TableView.prototype.appendColHeader = function (col, TH) {
var DIV = document.createElement('DIV')
, SPAN = document.createElement('SPAN');
DIV.className = 'relative';
SPAN.className = 'colHeader';
this.wt.wtDom.avoidInnerHTML(SPAN, this.instance.getColHeader(col));
DIV.appendChild(SPAN);
while (TH.firstChild) {
TH.removeChild(TH.firstChild); //empty TH node
}
TH.appendChild(DIV);
this.instance.runHooks('afterGetColHeader', col, TH);
};
/**
* Returns true if keyCode represents a printable character
* @param {Number} keyCode
* @return {Boolean}
*/
Handsontable.helper.isPrintableChar = function (keyCode) {
return ((keyCode == 32) || //space
(keyCode >= 48 && keyCode <= 57) || //0-9
(keyCode >= 96 && keyCode <= 111) || //numpad
(keyCode >= 186 && keyCode <= 192) || //;=,-./`
(keyCode >= 219 && keyCode <= 222) || //[]{}\|"'
keyCode >= 226 || //special chars (229 for Asian chars)
(keyCode >= 65 && keyCode <= 90)); //a-z
};
/**
* Converts a value to string
* @param value
* @return {String}
*/
Handsontable.helper.stringify = function (value) {
switch (typeof value) {
case 'string':
case 'number':
return value + '';
break;
case 'object':
if (value === null) {
return '';
}
else {
return value.toString();
}
break;
case 'undefined':
return '';
break;
default:
return value.toString();
}
};
/**
* Generates spreadsheet-like column names: A, B, C, ..., Z, AA, AB, etc
* @param index
* @returns {String}
*/
Handsontable.helper.spreadsheetColumnLabel = function (index) {
var dividend = index + 1;
var columnLabel = '';
var modulo;
while (dividend > 0) {
modulo = (dividend - 1) % 26;
columnLabel = String.fromCharCode(65 + modulo) + columnLabel;
dividend = parseInt((dividend - modulo) / 26, 10);
}
return columnLabel;
};
/**
* Checks if child is a descendant of given parent node
* http://stackoverflow.com/questions/2234979/how-to-check-in-javascript-if-one-element-is-a-child-of-another
* @param parent
* @param child
* @returns {boolean}
*/
Handsontable.helper.isDescendant = function (parent, child) {
var node = child.parentNode;
while (node != null) {
if (node == parent) {
return true;
}
node = node.parentNode;
}
return false;
};
/**
* Generates a random hex string. Used as namespace for Handsontable instance events.
* @return {String} - 16 character random string: "92b1bfc74ec4"
*/
Handsontable.helper.randomString = function () {
function s4() {
return Math.floor((1 + Math.random()) * 0x10000)
.toString(16)
.substring(1);
}
return s4() + s4() + s4() + s4();
};
/**
* Inherit without without calling parent constructor, and setting `Child.prototype.constructor` to `Child` instead of `Parent`.
* Creates temporary dummy function to call it as constructor.
* Described in ticket: https://github.com/warpech/jquery-handsontable/pull/516
* @param {Object} Child child class
* @param {Object} Parent parent class
* @return {Object} extended Child
*/
Handsontable.helper.inherit = function (Child, Parent) {
function Bridge() {
}
Bridge.prototype = Parent.prototype;
Child.prototype = new Bridge();
Child.prototype.constructor = Child;
return Child;
};
/**
* Perform shallow extend of a target object with extension's own properties
* @param {Object} target An object that will receive the new properties
* @param {Object} extension An object containing additional properties to merge into the target
*/
Handsontable.helper.extend = function (target, extension) {
for (var i in extension) {
if (extension.hasOwnProperty(i)) {
target[i] = extension[i];
}
}
};
/**
* Factory for columns constructors.
* @param {Object} GridSettings
* @param {Array} conflictList
* @param {Object} defaultCell
* @return {Object} ColumnSettings
*/
Handsontable.helper.columnFactory = function (GridSettings, conflictList, defaultCell) {
var i = 0, len = conflictList.length, ColumnSettings = function () {
};
// Inherit prototype from grid settings
ColumnSettings.prototype = new GridSettings();
// Clear conflict settings
for (; i < len; i++) {
ColumnSettings.prototype[conflictList[i]] = void 0;
}
// Inherit settings from default (text) cell
for (i in defaultCell) {
if (defaultCell.hasOwnProperty(i)) {
ColumnSettings.prototype[i] = defaultCell[i];
}
}
return ColumnSettings;
};
Handsontable.helper.translateRowsToColumns = function (input) {
var i
, ilen
, j
, jlen
, output = []
, olen = 0;
for (i = 0, ilen = input.length; i < ilen; i++) {
for (j = 0, jlen = input[i].length; j < jlen; j++) {
if (j == olen) {
output.push([]);
olen++;
}
output[j].push(input[i][j])
}
}
return output;
};
Handsontable.helper.to2dArray = function (arr) {
var i = 0
, ilen = arr.length;
while (i < ilen) {
arr[i] = [arr[i]];
i++;
}
};
Handsontable.helper.extendArray = function (arr, extension) {
var i = 0
, ilen = extension.length;
while (i < ilen) {
arr.push(extension[i]);
i++;
}
};
/**
* Returns cell renderer or editor function directly or through lookup map
*/
Handsontable.helper.getCellMethod = function (methodName, methodFunction) {
if (typeof methodFunction === 'string') {
var result = Handsontable.cellLookup[methodName][methodFunction];
if (result === void 0) {
throw new Error('You declared cell ' + methodName + ' "' + methodFunction + '" as a string that is not mapped to a known function. Cell ' + methodName + ' must be a function or a string mapped to a function in Handsontable.cellLookup.' + methodName + ' lookup object');
}
return result;
}
else {
return methodFunction;
}
};
/**
* Handsontable UndoRedo class
*/
Handsontable.UndoRedo = function (instance) {
var that = this;
this.instance = instance;
this.clear();
Handsontable.PluginHooks.add("afterChange", function (changes, origin) {
if (origin !== 'undo' && origin !== 'redo') {
that.add(changes, origin);
}
});
};
/**
* Undo operation from current revision
*/
Handsontable.UndoRedo.prototype.undo = function () {
var i, ilen;
if (this.isUndoAvailable()) {
var setData = $.extend(true, [], this.data[this.rev]);
for (i = 0, ilen = setData.length; i < ilen; i++) {
setData[i].splice(3, 1);
}
this.instance.setDataAtRowProp(setData, null, null, 'undo');
this.rev--;
}
};
/**
* Redo operation from current revision
*/
Handsontable.UndoRedo.prototype.redo = function () {
var i, ilen;
if (this.isRedoAvailable()) {
this.rev++;
var setData = $.extend(true, [], this.data[this.rev]);
for (i = 0, ilen = setData.length; i < ilen; i++) {
setData[i].splice(2, 1);
}
this.instance.setDataAtRowProp(setData, null, null, 'redo');
}
};
/**
* Returns true if undo point is available
* @return {Boolean}
*/
Handsontable.UndoRedo.prototype.isUndoAvailable = function () {
return (this.rev >= 0);
};
/**
* Returns true if redo point is available
* @return {Boolean}
*/
Handsontable.UndoRedo.prototype.isRedoAvailable = function () {
return (this.rev < this.data.length - 1);
};
/**
* Add new history poins
* @param changes
*/
Handsontable.UndoRedo.prototype.add = function (changes, source) {
this.rev++;
this.data.splice(this.rev); //if we are in point abcdef(g)hijk in history, remove everything after (g)
this.data.push(changes);
};
/**
* Clears undo history
*/
Handsontable.UndoRedo.prototype.clear = function () {
this.data = [];
this.rev = -1;
};
Handsontable.SelectionPoint = function () {
this._row = null; //private use intended
this._col = null;
};
Handsontable.SelectionPoint.prototype.exists = function () {
return (this._row !== null);
};
Handsontable.SelectionPoint.prototype.row = function (val) {
if (val !== void 0) {
this._row = val;
}
return this._row;
};
Handsontable.SelectionPoint.prototype.col = function (val) {
if (val !== void 0) {
this._col = val;
}
return this._col;
};
Handsontable.SelectionPoint.prototype.coords = function (coords) {
if (coords !== void 0) {
this._row = coords.row;
this._col = coords.col;
}
return {
row: this._row,
col: this._col
}
};
Handsontable.SelectionPoint.prototype.arr = function (arr) {
if (arr !== void 0) {
this._row = arr[0];
this._col = arr[1];
}
return [this._row, this._col]
};
/**
* Default text renderer
* @param {Object} instance Handsontable instance
* @param {Element} TD Table cell where to render
* @param {Number} row
* @param {Number} col
* @param {String|Number} prop Row object property name
* @param value Value to render (remember to escape unsafe HTML before inserting to DOM!)
* @param {Object} cellProperties Cell properites (shared by cell renderer and editor)
*/
Handsontable.TextRenderer = function (instance, TD, row, col, prop, value, cellProperties) {
var escaped = Handsontable.helper.stringify(value);
if (escaped.match(/\n/)) {
escaped = escaped.replace(/&/g, "&amp;").replace(/</g, "&lt;").replace(/>/g, "&gt;").replace(/"/g, "&quot;").replace(/'/g, "&#039;"); //escape html special chars
TD.innerHTML = escaped.replace(/\n/g, '<br/>');
}
else {
instance.view.wt.wtDom.empty(TD); //TODO identify under what circumstances this line can be removed
TD.appendChild(document.createTextNode(escaped));
//this is faster than innerHTML. See: https://github.com/warpech/jquery-handsontable/wiki/JavaScript-&-DOM-performance-tips
}
if (cellProperties.readOnly) {
TD.className = 'htDimmed';
}
};
/**
* Autocomplete renderer
* @param {Object} instance Handsontable instance
* @param {Element} TD Table cell where to render
* @param {Number} row
* @param {Number} col
* @param {String|Number} prop Row object property name
* @param value Value to render (remember to escape unsafe HTML before inserting to DOM!)
* @param {Object} cellProperties Cell properites (shared by cell renderer and editor)
*/
Handsontable.AutocompleteRenderer = function (instance, TD, row, col, prop, value, cellProperties) {
var TEXT = document.createElement('DIV');
TEXT.className = 'htAutocomplete';
var ARROW = document.createElement('DIV');
ARROW.className = 'htAutocompleteArrow';
ARROW.appendChild(document.createTextNode('\u25BC'));
//this is faster than innerHTML. See: https://github.com/warpech/jquery-handsontable/wiki/JavaScript-&-DOM-performance-tips
if (!instance.acArrowListener) {
//not very elegant but easy and fast
instance.acArrowListener = function () {
instance.view.wt.getSetting('onCellDblClick');
};
instance.rootElement.on('mouseup', '.htAutocompleteArrow', instance.acArrowListener); //this way we don't bind event listener to each arrow. We rely on propagation instead
}
Handsontable.TextRenderer(instance, TEXT, row, col, prop, value, cellProperties);
if (!TEXT.firstChild) { //http://jsperf.com/empty-node-if-needed
//otherwise empty fields appear borderless in demo/renderers.html (IE)
TEXT.appendChild(document.createTextNode('\u00A0')); //\u00A0 equals &nbsp; for a text node
//this is faster than innerHTML. See: https://github.com/warpech/jquery-handsontable/wiki/JavaScript-&-DOM-performance-tips
}
TEXT.appendChild(ARROW);
instance.view.wt.wtDom.empty(TD); //TODO identify under what circumstances this line can be removed
TD.appendChild(TEXT);
};
/**
* Checkbox renderer
* @param {Object} instance Handsontable instance
* @param {Element} TD Table cell where to render
* @param {Number} row
* @param {Number} col
* @param {String|Number} prop Row object property name
* @param value Value to render (remember to escape unsafe HTML before inserting to DOM!)
* @param {Object} cellProperties Cell properites (shared by cell renderer and editor)
*/
Handsontable.CheckboxRenderer = function (instance, TD, row, col, prop, value, cellProperties) {
if (typeof cellProperties.checkedTemplate === "undefined") {
cellProperties.checkedTemplate = true;
}
if (typeof cellProperties.uncheckedTemplate === "undefined") {
cellProperties.uncheckedTemplate = false;
}
instance.view.wt.wtDom.empty(TD); //TODO identify under what circumstances this line can be removed
var INPUT = document.createElement('INPUT');
INPUT.className = 'htCheckboxRendererInput';
INPUT.type = 'checkbox';
INPUT.setAttribute('autocomplete', 'off');
if (value === cellProperties.checkedTemplate || value === Handsontable.helper.stringify(cellProperties.checkedTemplate)) {
INPUT.checked = true;
TD.appendChild(INPUT);
}
else if (value === cellProperties.uncheckedTemplate || value === Handsontable.helper.stringify(cellProperties.uncheckedTemplate)) {
TD.appendChild(INPUT);
}
else if (value === null) { //default value
INPUT.className += ' noValue';
TD.appendChild(INPUT);
}
else {
TD.appendChild(document.createTextNode('#bad value#'));
//this is faster than innerHTML. See: https://github.com/warpech/jquery-handsontable/wiki/JavaScript-&-DOM-performance-tips
}
var $input = $(INPUT);
if (cellProperties.readOnly) {
$input.on('click', function (event) {
event.preventDefault();
});
}
else {
$input.on('mousedown', function (event) {
if (!this.checked) {
instance.setDataAtRowProp(row, prop, cellProperties.checkedTemplate);
}
else {
instance.setDataAtRowProp(row, prop, cellProperties.uncheckedTemplate);
}
event.stopPropagation(); //otherwise can confuse cell mousedown handler
});
$input.on('mouseup', function (event) {
event.stopPropagation(); //otherwise can confuse cell dblclick handler
});
}
return TD;
};
/**
* Numeric cell renderer
* @param {Object} instance Handsontable instance
* @param {Element} TD Table cell where to render
* @param {Number} row
* @param {Number} col
* @param {String|Number} prop Row object property name
* @param value Value to render (remember to escape unsafe HTML before inserting to DOM!)
* @param {Object} cellProperties Cell properites (shared by cell renderer and editor)
*/
Handsontable.NumericRenderer = function (instance, TD, row, col, prop, value, cellProperties) {
if (typeof value === 'number') {
if (typeof cellProperties.language !== 'undefined') {
numeral.language(cellProperties.language)
}
instance.view.wt.wtDom.empty(TD); //TODO identify under what circumstances this line can be removed
TD.className = 'htNumeric';
TD.appendChild(document.createTextNode(numeral(value).format(cellProperties.format || '0'))); //docs: http://numeraljs.com/
//this is faster than innerHTML. See: https://github.com/warpech/jquery-handsontable/wiki/JavaScript-&-DOM-performance-tips
}
else {
Handsontable.TextRenderer(instance, TD, row, col, prop, value, cellProperties);
}
};
function HandsontableTextEditorClass(instance) {
this.isCellEdited = false;
this.instance = instance;
this.createElements();
this.bindEvents();
}
HandsontableTextEditorClass.prototype.createElements = function () {
this.wtDom = new WalkontableDom();
this.TEXTAREA = document.createElement('TEXTAREA');
this.TEXTAREA.className = 'handsontableInput';
this.textareaStyle = this.TEXTAREA.style;
this.textareaStyle.width = 0;
this.textareaStyle.height = 0;
this.$textarea = $(this.TEXTAREA);
this.TEXTAREA_PARENT = document.createElement('DIV');
this.TEXTAREA_PARENT.className = 'handsontableInputHolder';
this.textareaParentStyle = this.TEXTAREA_PARENT.style;
this.textareaParentStyle.top = 0;
this.textareaParentStyle.left = 0;
this.textareaParentStyle.display = 'none';
this.$textareaParent = $(this.TEXTAREA_PARENT);
this.TEXTAREA_PARENT.appendChild(this.TEXTAREA);
this.instance.rootElement[0].appendChild(this.TEXTAREA_PARENT);
var that = this;
Handsontable.PluginHooks.add('afterRender', function () {
that.instance.registerTimeout('refresh_editor_dimensions', function () {
that.refreshDimensions();
}, 0);
});
};
HandsontableTextEditorClass.prototype.bindEvents = function () {
var that = this;
this.$textareaParent.off('.editor').on('keydown.editor', function (event) {
//if we are here then isCellEdited === true
var ctrlDown = (event.ctrlKey || event.metaKey) && !event.altKey; //catch CTRL but not right ALT (which in some systems triggers ALT+CTRL)
if (event.keyCode === 17 || event.keyCode === 224 || event.keyCode === 91 || event.keyCode === 93) {
//when CTRL or its equivalent is pressed and cell is edited, don't prepare selectable text in textarea
event.stopImmediatePropagation();
return;
}
switch (event.keyCode) {
case 38: /* arrow up */
case 40: /* arrow down */
that.finishEditing(false);
break;
case 9: /* tab */
that.finishEditing(false);
event.preventDefault();
break;
case 39: /* arrow right */
if (that.getCaretPosition(that.TEXTAREA) === that.TEXTAREA.value.length) {
that.finishEditing(false);
}
else {
event.stopImmediatePropagation();
}
break;
case 37: /* arrow left */
if (that.getCaretPosition(that.TEXTAREA) === 0) {
that.finishEditing(false);
}
else {
event.stopImmediatePropagation();
}
break;
case 27: /* ESC */
that.instance.destroyEditor(true);
event.stopImmediatePropagation();
break;
case 13: /* return/enter */
var selected = that.instance.getSelected();
var isMultipleSelection = !(selected[0] === selected[2] && selected[1] === selected[3]);
if ((event.ctrlKey && !isMultipleSelection) || event.altKey) { //if ctrl+enter or alt+enter, add new line
that.TEXTAREA.value = that.TEXTAREA.value + '\n';
that.TEXTAREA.focus();
event.stopImmediatePropagation();
}
else {
that.finishEditing(false, ctrlDown);
}
event.preventDefault(); //don't add newline to field
break;
default:
event.stopImmediatePropagation(); //backspace, delete, home, end, CTRL+A, CTRL+C, CTRL+V, CTRL+X should only work locally when cell is edited (not in table context)
break;
}
});
};
HandsontableTextEditorClass.prototype.bindTemporaryEvents = function (td, row, col, prop, value, cellProperties) {
this.TD = td;
this.row = row;
this.col = col;
this.prop = prop;
this.originalValue = value;
this.cellProperties = cellProperties;
var that = this;
this.instance.focusCatcher.$el.on('keydown.editor', function (event) {
var ctrlDown = (event.ctrlKey || event.metaKey) && !event.altKey; //catch CTRL but not right ALT (which in some systems triggers ALT+CTRL)
if (!that.isCellEdited) {
if (Handsontable.helper.isPrintableChar(event.keyCode)) {
if (!ctrlDown) { //disregard CTRL-key shortcuts
that.beginEditing(row, col, prop);
}
}
else if (event.keyCode === 113) { //f2
that.beginEditing(row, col, prop, true); //show edit field
event.stopImmediatePropagation();
event.preventDefault(); //prevent Opera from opening Go to Page dialog
}
else if (event.keyCode === 13 && that.instance.getSettings().enterBeginsEditing) { //enter
var selected = that.instance.getSelected();
var isMultipleSelection = !(selected[0] === selected[2] && selected[1] === selected[3]);
if ((ctrlDown && !isMultipleSelection) || event.altKey) { //if ctrl+enter or alt+enter, add new line
that.beginEditing(row, col, prop, true, '\n'); //show edit field
}
else {
that.beginEditing(row, col, prop, true); //show edit field
}
event.preventDefault(); //prevent new line at the end of textarea
event.stopImmediatePropagation();
}
}
});
function onDblClick() {
that.beginEditing(row, col, prop, true);
}
this.instance.view.wt.update('onCellDblClick', onDblClick);
};
HandsontableTextEditorClass.prototype.unbindTemporaryEvents = function () {
this.instance.focusCatcher.$el.off(".editor");
this.instance.view.wt.update('onCellDblClick', null);
};
/**
* Returns caret position in edit proxy
* @author http://stackoverflow.com/questions/263743/how-to-get-caret-position-in-textarea
* @return {Number}
*/
HandsontableTextEditorClass.prototype.getCaretPosition = function (el) {
if (el.selectionStart) {
return el.selectionStart;
}
else if (document.selection) {
el.focus();
var r = document.selection.createRange();
if (r == null) {
return 0;
}
var re = el.createTextRange(),
rc = re.duplicate();
re.moveToBookmark(r.getBookmark());
rc.setEndPoint('EndToStart', re);
return rc.text.length;
}
return 0;
};
/**
* Sets caret position in edit proxy
* @author http://blog.vishalon.net/index.php/javascript-getting-and-setting-caret-position-in-textarea/
* @param {Number}
*/
HandsontableTextEditorClass.prototype.setCaretPosition = function (el, pos) {
if (el.setSelectionRange) {
el.focus();
el.setSelectionRange(pos, pos);
}
else if (el.createTextRange) {
var range = el.createTextRange();
range.collapse(true);
range.moveEnd('character', pos);
range.moveStart('character', pos);
range.select();
}
};
HandsontableTextEditorClass.prototype.beginEditing = function (row, col, prop, useOriginalValue, suffix) {
if (this.isCellEdited) {
return;
}
this.isCellEdited = true;
this.row = row;
this.col = col;
this.prop = prop;
var coords = {row: row, col: col};
this.instance.view.scrollViewport(coords);
this.instance.view.render();
this.$textarea.on('cut.editor', function (event) {
event.stopPropagation();
});
this.$textarea.on('paste.editor', function (event) {
event.stopPropagation();
});
if (useOriginalValue) {
this.TEXTAREA.value = Handsontable.helper.stringify(this.originalValue) + (suffix || '');
}
else {
this.TEXTAREA.value = '';
}
this.refreshDimensions(); //need it instantly, to prevent https://github.com/warpech/jquery-handsontable/issues/348
this.TEXTAREA.focus();
this.setCaretPosition(this.TEXTAREA, this.TEXTAREA.value.length);
};
HandsontableTextEditorClass.prototype.refreshDimensions = function () {
if (!this.isCellEdited) {
return;
}
///start prepare textarea position
this.TD = this.instance.getCell(this.row, this.col);
var $td = $(this.TD); //because old td may have been scrolled out with scrollViewport
var currentOffset = this.wtDom.offset(this.TD);
var containerOffset = this.wtDom.offset(this.instance.rootElement[0]);
var scrollTop = this.instance.rootElement.scrollTop();
var scrollLeft = this.instance.rootElement.scrollLeft();
var editTop = currentOffset.top - containerOffset.top + scrollTop - 1;
var editLeft = currentOffset.left - containerOffset.left + scrollLeft - 1;
var settings = this.instance.getSettings();
var rowHeadersCount = settings.rowHeaders === false ? 0 : 1;
var colHeadersCount = settings.colHeaders === false ? 0 : 1;
if (editTop < 0) {
editTop = 0;
}
if (editLeft < 0) {
editLeft = 0;
}
if (rowHeadersCount > 0 && parseInt($td.css('border-top-width'), 10) > 0) {
editTop += 1;
}
if (colHeadersCount > 0 && parseInt($td.css('border-left-width'), 10) > 0) {
editLeft += 1;
}
if ($.browser.msie && parseInt($.browser.version, 10) <= 7) {
editTop -= 1;
}
this.textareaParentStyle.top = editTop + 'px';
this.textareaParentStyle.left = editLeft + 'px';
///end prepare textarea position
var width = $td.width()
, height = $td.outerHeight() - 4;
if (parseInt($td.css('border-top-width'), 10) > 0) {
height -= 1;
}
if (parseInt($td.css('border-left-width'), 10) > 0) {
if (rowHeadersCount > 0) {
width -= 1;
}
}
this.$textarea.autoResize({
maxHeight: 200,
minHeight: height,
minWidth: width,
maxWidth: Math.max(168, width),
animate: false,
extraSpace: 0
});
this.textareaParentStyle.display = 'block';
};
HandsontableTextEditorClass.prototype.finishEditing = function (isCancelled, ctrlDown) {
if (this.isCellEdited) {
this.isCellEdited = false;
if (!isCancelled) {
var val = [
[$.trim(this.TEXTAREA.value)]
];
if (ctrlDown) { //if ctrl+enter and multiple cells selected, behave like Excel (finish editing and apply to all cells)
var sel = this.instance.getSelected();
this.instance.populateFromArray(sel[0], sel[1], val, sel[2], sel[3], 'edit');
}
else {
this.instance.populateFromArray(this.row, this.col, val, null, null, 'edit');
}
}
}
this.unbindTemporaryEvents();
if (document.activeElement === this.TEXTAREA) {
this.instance.listen(); //don't refocus the table if user focused some cell outside of HT on purpose
}
this.textareaParentStyle.display = 'none';
};
/**
* Default text editor
* @param {Object} instance Handsontable instance
* @param {Element} td Table cell where to render
* @param {Number} row
* @param {Number} col
* @param {String|Number} prop Row object property name
* @param value Original value (remember to escape unsafe HTML before inserting to DOM!)
* @param {Object} cellProperties Cell properites (shared by cell renderer and editor)
*/
Handsontable.TextEditor = function (instance, td, row, col, prop, value, cellProperties) {
if (!instance.textEditor) {
instance.textEditor = new HandsontableTextEditorClass(instance);
}
instance.textEditor.bindTemporaryEvents(td, row, col, prop, value, cellProperties);
return function (isCancelled) {
instance.textEditor.finishEditing(isCancelled);
}
};
function HandsontableAutocompleteEditorClass(instance) {
this.isCellEdited = false;
this.instance = instance;
this.createElements();
this.bindEvents();
this.emptyStringLabel = '\u00A0\u00A0\u00A0'; //3 non-breaking spaces
}
Handsontable.helper.inherit(HandsontableAutocompleteEditorClass, HandsontableTextEditorClass);
/**
* @see HandsontableTextEditorClass.prototype.createElements
*/
HandsontableAutocompleteEditorClass.prototype.createElements = function () {
HandsontableTextEditorClass.prototype.createElements.call(this);
this.$textarea.typeahead();
this.typeahead = this.$textarea.data('typeahead');
this.typeahead._render = this.typeahead.render;
this.typeahead.minLength = 0;
this.typeahead.lookup = function () {
var items;
this.query = this.$element.val();
items = $.isFunction(this.source) ? this.source(this.query, $.proxy(this.process, this)) : this.source;
return items ? this.process(items) : this;
};
this.typeahead.matcher = function () {
return true;
};
var _process = this.typeahead.process;
var that = this;
this.typeahead.process = function (items) {
var cloned = false;
for (var i = 0, ilen = items.length; i < ilen; i++) {
if (items[i] === '') {
//this is needed because because of issue #254
//empty string ('') is a falsy value and breaks the loop in bootstrap-typeahead.js method `sorter`
//best solution would be to change line: `while (item = items.shift()) {`
// to: `while ((item = items.shift()) !== void 0) {`
if (!cloned) {
//need to clone items before applying emptyStringLabel
//(otherwise validateChanges fails for empty string)
items = $.extend([], items);
cloned = true;
}
items[i] = that.emptyStringLabel;
}
}
return _process.call(this, items);
};
};
/**
* @see HandsontableTextEditorClass.prototype.bindEvents
*/
HandsontableAutocompleteEditorClass.prototype.bindEvents = function () {
var that = this;
this.$textarea.off('keydown').off('keyup').off('keypress'); //unlisten
this.$textareaParent.off('.acEditor').on('keydown.acEditor', function (event) {
switch (event.keyCode) {
case 38: /* arrow up */
that.typeahead.prev();
event.stopImmediatePropagation(); //stops TextEditor and core onKeyDown handler
break;
case 40: /* arrow down */
that.typeahead.next();
event.stopImmediatePropagation(); //stops TextEditor and core onKeyDown handler
break;
case 13: /* enter */
event.preventDefault();
break;
}
});
this.$textareaParent.on('keyup.acEditor', function (event) {
if (Handsontable.helper.isPrintableChar(event.keyCode) || event.keyCode === 113 || event.keyCode === 13 || event.keyCode === 8 || event.keyCode === 46) {
that.typeahead.lookup();
}
});
HandsontableTextEditorClass.prototype.bindEvents.call(this);
};
/**
* @see HandsontableTextEditorClass.prototype.bindTemporaryEvents
*/
HandsontableAutocompleteEditorClass.prototype.bindTemporaryEvents = function (td, row, col, prop, value, cellProperties) {
var that = this
, i
, j;
this.typeahead.select = function () {
var output = this.hide(); //need to hide it before destroyEditor, because destroyEditor checks if menu is expanded
that.instance.destroyEditor(true);
var val = this.$menu.find('.active').attr('data-value');
if (val === that.emptyStringLabel) {
val = '';
}
if (typeof cellProperties.onSelect === 'function') {
cellProperties.onSelect(row, col, prop, val, this.$menu.find('.active').index());
}
else {
that.instance.setDataAtRowProp(row, prop, val);
}
return output;
};
this.typeahead.render = function (items) {
that.typeahead._render.call(this, items);
if (!cellProperties.strict) {
this.$menu.find('li:eq(0)').removeClass('active');
}
return this;
};
/* overwrite typeahead options and methods (matcher, sorter, highlighter, updater, etc) if provided in cellProperties */
for (i in cellProperties) {
// if (cellProperties.hasOwnProperty(i)) {
if (i === 'options') {
for (j in cellProperties.options) {
// if (cellProperties.options.hasOwnProperty(j)) {
this.typeahead.options[j] = cellProperties.options[j];
// }
}
}
else {
this.typeahead[i] = cellProperties[i];
}
// }
}
HandsontableTextEditorClass.prototype.bindTemporaryEvents.call(this, td, row, col, prop, value, cellProperties);
function onDblClick() {
that.beginEditing(row, col, prop, true);
that.instance.registerTimeout('IE9_align_fix', function () { //otherwise is misaligned in IE9
that.typeahead.lookup();
}, 1);
}
this.instance.view.wt.update('onCellDblClick', onDblClick);
};
/**
* @see HandsontableTextEditorClass.prototype.finishEditing
*/
HandsontableAutocompleteEditorClass.prototype.finishEditing = function (isCancelled, ctrlDown) {
if (!isCancelled) {
if (this.isMenuExpanded() && this.typeahead.$menu.find('.active').length) {
this.typeahead.select();
this.isCellEdited = false; //cell value was updated by this.typeahead.select (issue #405)
}
else if (this.cellProperties.strict) {
this.isCellEdited = false; //cell value was not picked from this.typeahead.select (issue #405)
}
}
HandsontableTextEditorClass.prototype.finishEditing.call(this, isCancelled, ctrlDown);
};
HandsontableAutocompleteEditorClass.prototype.isMenuExpanded = function () {
if (this.typeahead.$menu.is(":visible")) {
return this.typeahead;
}
else {
return false;
}
};
/**
* Autocomplete editor
* @param {Object} instance Handsontable instance
* @param {Element} td Table cell where to render
* @param {Number} row
* @param {Number} col
* @param {String|Number} prop Row object property name
* @param value Original value (remember to escape unsafe HTML before inserting to DOM!)
* @param {Object} cellProperties Cell properites (shared by cell renderer and editor)
*/
Handsontable.AutocompleteEditor = function (instance, td, row, col, prop, value, cellProperties) {
if (!instance.autocompleteEditor) {
instance.autocompleteEditor = new HandsontableAutocompleteEditorClass(instance);
}
instance.autocompleteEditor.bindTemporaryEvents(td, row, col, prop, value, cellProperties);
return function (isCancelled) {
instance.autocompleteEditor.finishEditing(isCancelled);
}
};
function toggleCheckboxCell(instance, row, prop, cellProperties) {
if (Handsontable.helper.stringify(instance.getDataAtRowProp(row, prop)) === Handsontable.helper.stringify(cellProperties.checkedTemplate)) {
instance.setDataAtRowProp(row, prop, cellProperties.uncheckedTemplate);
}
else {
instance.setDataAtRowProp(row, prop, cellProperties.checkedTemplate);
}
}
/**
* Checkbox editor
* @param {Object} instance Handsontable instance
* @param {Element} td Table cell where to render
* @param {Number} row
* @param {Number} col
* @param {String|Number} prop Row object property name
* @param value Original value (remember to escape unsafe HTML before inserting to DOM!)
* @param {Object} cellProperties Cell properites (shared by cell renderer and editor)
*/
Handsontable.CheckboxEditor = function (instance, td, row, col, prop, value, cellProperties) {
if (typeof cellProperties === "undefined") {
cellProperties = {};
}
if (typeof cellProperties.checkedTemplate === "undefined") {
cellProperties.checkedTemplate = true;
}
if (typeof cellProperties.uncheckedTemplate === "undefined") {
cellProperties.uncheckedTemplate = false;
}
instance.$table.on("keydown.editor", function (event) {
var ctrlDown = (event.ctrlKey || event.metaKey) && !event.altKey; //catch CTRL but not right ALT (which in some systems triggers ALT+CTRL)
if (!ctrlDown && Handsontable.helper.isPrintableChar(event.keyCode)) {
toggleCheckboxCell(instance, row, prop, cellProperties);
event.stopImmediatePropagation(); //stops core onKeyDown handler
event.preventDefault(); //some keys have special behavior, eg. space bar scrolls screen down
}
});
instance.view.wt.update('onCellDblClick', function () {
toggleCheckboxCell(instance, row, prop, cellProperties);
});
return function () {
instance.$table.off(".editor");
instance.view.wt.update('onCellDblClick', null);
}
};
function HandsontableDateEditorClass(instance) {
if (!$.datepicker) {
throw new Error("jQuery UI Datepicker dependency not found. Did you forget to include jquery-ui.custom.js or its substitute?");
}
this.isCellEdited = false;
this.instance = instance;
this.createElements();
this.bindEvents();
}
Handsontable.helper.inherit(HandsontableDateEditorClass, HandsontableTextEditorClass);
/**
* @see HandsontableTextEditorClass.prototype.createElements
*/
HandsontableDateEditorClass.prototype.createElements = function () {
HandsontableTextEditorClass.prototype.createElements.call(this);
this.datePicker = document.createElement('DIV');
this.datePickerStyle = this.datePicker.style;
this.datePickerStyle.position = 'absolute';
this.datePickerStyle.top = 0;
this.datePickerStyle.left = 0;
this.datePickerStyle.zIndex = 99;
this.instance.rootElement[0].appendChild(this.datePicker);
this.$datePicker = $(this.datePicker);
var that = this;
var defaultOptions = {
dateFormat: "yy-mm-dd",
showButtonPanel: true,
changeMonth: true,
changeYear: true,
altField: this.$textarea,
onSelect: function () {
that.finishEditing(false);
}
};
this.$datePicker.datepicker(defaultOptions);
this.hideDatepicker();
};
/**
* @see HandsontableTextEditorClass.prototype.beginEditing
*/
HandsontableDateEditorClass.prototype.beginEditing = function (row, col, prop, useOriginalValue, suffix) {
HandsontableTextEditorClass.prototype.beginEditing.call(this, row, col, prop, useOriginalValue, suffix);
this.showDatepicker();
};
/**
* @see HandsontableTextEditorClass.prototype.finishEditing
*/
HandsontableDateEditorClass.prototype.finishEditing = function (isCancelled, ctrlDown) {
this.hideDatepicker();
HandsontableTextEditorClass.prototype.finishEditing.call(this, isCancelled, ctrlDown);
};
HandsontableDateEditorClass.prototype.showDatepicker = function () {
var $td = $(this.instance.dateEditor.TD);
var position = $td.position();
this.datePickerStyle.top = (position.top + $td.height()) + 'px';
this.datePickerStyle.left = position.left + 'px';
var dateOptions = {
defaultDate: this.originalValue || void 0
};
$.extend(dateOptions, this.cellProperties);
this.$datePicker.datepicker("option", dateOptions);
if (this.originalValue) {
this.$datePicker.datepicker("setDate", this.originalValue);
}
this.datePickerStyle.display = 'block';
};
HandsontableDateEditorClass.prototype.hideDatepicker = function () {
this.datePickerStyle.display = 'none';
};
/**
* Date editor (uses jQuery UI Datepicker)
* @param {Object} instance Handsontable instance
* @param {Element} td Table cell where to render
* @param {Number} row
* @param {Number} col
* @param {String|Number} prop Row object property name
* @param value Original value (remember to escape unsafe HTML before inserting to DOM!)
* @param {Object} cellProperties Cell properites (shared by cell renderer and editor)
*/
Handsontable.DateEditor = function (instance, td, row, col, prop, value, cellProperties) {
if (!instance.dateEditor) {
instance.dateEditor = new HandsontableDateEditorClass(instance);
}
instance.dateEditor.bindTemporaryEvents(td, row, col, prop, value, cellProperties);
return function (isCancelled) {
instance.dateEditor.finishEditing(isCancelled);
}
};
/**
* This is inception. Using Handsontable as Handsontable editor
*/
function HandsontableHandsontableEditorClass(instance) {
this.isCellEdited = false;
this.instance = instance;
this.createElements();
this.bindEvents();
}
Handsontable.helper.inherit(HandsontableHandsontableEditorClass, HandsontableTextEditorClass);
HandsontableHandsontableEditorClass.prototype.createElements = function () {
HandsontableTextEditorClass.prototype.createElements.call(this);
var DIV = document.createElement('DIV');
DIV.className = 'handsontableEditor';
this.TEXTAREA_PARENT.appendChild(DIV);
this.$htContainer = $(DIV);
};
HandsontableHandsontableEditorClass.prototype.bindTemporaryEvents = function (td, row, col, prop, value, cellProperties) {
var parent = this;
var options = {
colHeaders: true,
cells: function () {
return {
readOnly: true
}
},
fillHandle: false,
width: 2000,
//width: 'auto',
afterOnCellMouseDown: function () {
var sel = this.getSelected();
parent.TEXTAREA.value = this.getDataAtCell(sel[0], sel[1]);
parent.instance.destroyEditor();
},
beforeOnKeyDown: function (event) {
switch (event.keyCode) {
case 27: //esc
parent.instance.destroyEditor(true);
break;
case 13: //enter
var sel = this.getSelected();
parent.TEXTAREA.value = this.getDataAtCell(sel[0], sel[1]);
parent.instance.destroyEditor();
break;
}
}
};
if (cellProperties.handsontable) {
options = $.extend(options, cellProperties.handsontable);
}
this.$htContainer.handsontable(options);
HandsontableTextEditorClass.prototype.bindTemporaryEvents.call(this, td, row, col, prop, value, cellProperties);
};
HandsontableHandsontableEditorClass.prototype.beginEditing = function (row, col, prop, useOriginalValue, suffix) {
var onBeginEditing = this.instance.getSettings().onBeginEditing;
if (onBeginEditing && onBeginEditing() === false) {
return;
}
HandsontableTextEditorClass.prototype.beginEditing.call(this, row, col, prop, useOriginalValue, suffix);
this.$htContainer.handsontable('render');
this.$htContainer.handsontable('selectCell', 0, 0);
};
HandsontableHandsontableEditorClass.prototype.finishEditing = function (isCancelled, ctrlDown) {
if (Handsontable.helper.isDescendant(this.instance.rootElement[0], document.activeElement)) {
var that = this;
setTimeout(function () {
that.instance.listen(); //return the focus to the cell must be done after destroyer to work in IE7-9
}, 0);
that.instance.listen(); //return the focus to the cell
}
this.$htContainer.handsontable('destroy');
HandsontableTextEditorClass.prototype.finishEditing.call(this, isCancelled, ctrlDown);
};
HandsontableHandsontableEditorClass.prototype.isMenuExpanded = function () {
if (this.typeahead.$menu.is(":visible")) {
return this.typeahead;
}
else {
return false;
}
};
/**
* Handsontable editor
* @param {Object} instance Handsontable instance
* @param {Element} td Table cell where to render
* @param {Number} row
* @param {Number} col
* @param {String|Number} prop Row object property name
* @param value Original value (remember to escape unsafe HTML before inserting to DOM!)
* @param {Object} cellProperties Cell properites (shared by cell renderer and editor)
*/
Handsontable.HandsontableEditor = function (instance, td, row, col, prop, value, cellProperties) {
if (!instance.handsontableEditor) {
instance.handsontableEditor = new HandsontableHandsontableEditorClass(instance);
}
instance.handsontableEditor.bindTemporaryEvents(td, row, col, prop, value, cellProperties);
instance.registerEditor = instance.handsontableEditor;
return function (isCancelled) {
instance.handsontableEditor.finishEditing(isCancelled);
}
};
/**
* Cell type is just a shortcut for setting bunch of cellProperties (used in getCellMeta)
*/
Handsontable.AutocompleteCell = {
renderer: Handsontable.AutocompleteRenderer,
editor: Handsontable.AutocompleteEditor
};
Handsontable.CheckboxCell = {
renderer: Handsontable.CheckboxRenderer,
editor: Handsontable.CheckboxEditor
};
Handsontable.TextCell = {
renderer: Handsontable.TextRenderer,
editor: Handsontable.TextEditor
};
Handsontable.NumericCell = {
renderer: Handsontable.NumericRenderer,
editor: Handsontable.TextEditor,
dataType: 'number'
};
Handsontable.DateCell = {
renderer: Handsontable.AutocompleteRenderer, //displays small gray arrow on right side of the cell
editor: Handsontable.DateEditor
};
Handsontable.HandsontableCell = {
renderer: Handsontable.AutocompleteRenderer, //displays small gray arrow on right side of the cell
editor: Handsontable.HandsontableEditor
};
//here setup the friendly aliases that are used by cellProperties.type
Handsontable.cellTypes = {
autocomplete: Handsontable.AutocompleteCell,
checkbox: Handsontable.CheckboxCell,
text: Handsontable.TextCell,
numeric: Handsontable.NumericCell,
date: Handsontable.DateCell,
handsontable: Handsontable.HandsontableCell
};
//here setup the friendly aliases that are used by cellProperties.renderer and cellProperties.editor
Handsontable.cellLookup = {
renderer: {
autocomplete: Handsontable.AutocompleteRenderer,
checkbox: Handsontable.CheckboxRenderer,
text: Handsontable.TextRenderer,
numeric: Handsontable.NumericRenderer
},
editor: {
autocomplete: Handsontable.AutocompleteEditor,
checkbox: Handsontable.CheckboxEditor,
text: Handsontable.TextEditor,
date: Handsontable.DateEditor,
handsontable: Handsontable.HandsontableEditor
}
};
Handsontable.PluginHooks = (function () {
var hooks = {
beforeInitWalkontable: [],
beforeInit: [],
beforeRender: [],
beforeChange: [],
beforeGet: [],
beforeSet: [],
beforeGetCellMeta: [],
beforeAutofill : [],
beforeKeyDown: [],
afterInit: [],
afterLoadData: [],
afterRender: [],
afterChange: [],
afterGetCellMeta: [],
afterGetColHeader: [],
afterGetColWidth: [],
afterDestroy: [],
afterRemoveRow: [],
afterCreateRow: [],
afterRemoveCol: [],
afterCreateCol: [],
afterColumnResize: [],
afterColumnMove: [],
afterDeselect: [],
afterSelection: [],
afterSelectionByProp: [],
afterSelectionEnd: [],
afterSelectionEndByProp: [],
afterCopyLimit: []
};
var eventMap = {
onBeforeChange : "beforeChange",
onChange : "afterChange",
onCreateRow : "afterCreateRow",
onCreateCol : "afterCreateCol",
onSelection : "afterSelection",
onCopyLimit : "afterCopyLimit",
onSelectionEnd : "afterSelectionEnd",
onSelectionByProp: "afterSelectionByProp",
onSelectionEndByProp: "afterSelectionEndByProp"
};
return {
add: function (key, fn) {
// provide support for old versions of HOT
if (key in eventMap) {
key = eventMap[key];
}
hooks[key].push(fn);
},
remove: function (key, fn) {
// provide support for old versions of HOT
if (key in eventMap) {
key = eventMap[key];
}
for(var i = 0, len = hooks[key].length; i < len; i++) {
if (hooks[key][i] == fn) {
hooks[key].splice(i, 1);
return true;
}
}
return false;
},
run: function (instance, key, p1, p2, p3, p4, p5) {
// provide support for old versions of HOT
if (key in eventMap) {
key = eventMap[key];
}
//performance considerations - http://jsperf.com/call-vs-apply-for-a-plugin-architecture
if (typeof hooks[key] !== 'undefined') {
for (var i = 0, len = hooks[key].length; i < len; i++) {
hooks[key][i].call(instance, p1, p2, p3, p4, p5);
}
}
}
}
})();
Handsontable.PluginModifiers = {
modifiers: {
col: []
},
push: function (key, fn) {
this.modifiers[key].push(fn);
},
unshift: function (key, fn) {
this.modifiers[key].unshift(fn);
},
run: function (instance, key, p1, p2, p3, p4, p5) {
for (var i = 0, ilen = this.modifiers[key].length; i < ilen; i++) {
p1 = this.modifiers[key][i].call(instance, p1, p2, p3, p4, p5);
}
return p1;
}
};
function HandsontableAutoColumnSize() {
var that = this
, instance
, sampleCount = 5; //number of samples to take of each value length
this.beforeInit = function () {
this.autoColumnWidths = [];
this.autoColumnSizeTmp = {
thead: null,
theadTh: null,
theadStyle: null,
tbody: null,
tbodyTd: null,
noRenderer: null,
noRendererTd: null,
renderer: null,
rendererTd: null,
container: null,
containerStyle: null,
$container: null,
$noRenderer: null,
$renderer: null
};
};
this.determineColumnWidth = function (col) {
var tmp = instance.autoColumnSizeTmp
, d;
if (!tmp.container) {
d = document;
tmp.thead = d.createElement('table');
tmp.thead.appendChild(d.createElement('thead')).appendChild(d.createElement('tr')).appendChild(d.createElement('th'));
tmp.theadTh = tmp.thead.getElementsByTagName('th')[0];
tmp.thead.className = 'htTable';
tmp.theadStyle = tmp.thead.style;
tmp.theadStyle.tableLayout = 'auto';
tmp.theadStyle.width = 'auto';
tmp.tbody = tmp.thead.cloneNode(false);
tmp.tbody.appendChild(d.createElement('tbody')).appendChild(d.createElement('tr')).appendChild(d.createElement('td'));
tmp.tbodyTd = tmp.tbody.getElementsByTagName('td')[0];
tmp.noRenderer = tmp.tbody.cloneNode(true);
tmp.noRendererTd = tmp.noRenderer.getElementsByTagName('td')[0];
tmp.renderer = tmp.tbody.cloneNode(true);
tmp.rendererTd = tmp.renderer.getElementsByTagName('td')[0];
tmp.container = d.createElement('div');
tmp.container.className = instance.rootElement[0].className + ' hidden';
tmp.containerStyle = tmp.container.style;
tmp.container.appendChild(tmp.thead);
tmp.container.appendChild(tmp.tbody);
tmp.container.appendChild(tmp.noRenderer);
tmp.container.appendChild(tmp.renderer);
tmp.$container = $(tmp.container);
tmp.$noRenderer = $(tmp.noRenderer);
tmp.$renderer = $(tmp.renderer);
instance.rootElement[0].parentNode.appendChild(tmp.container);
}
tmp.container.className = instance.rootElement[0].className + ' hidden';
var rows = instance.countRows();
var samples = {};
var maxLen = 0;
for (var r = 0; r < rows; r++) {
var value = Handsontable.helper.stringify(instance.getDataAtCell(r, col));
var len = value.length;
if (len > maxLen) {
maxLen = len;
}
if (!samples[len]) {
samples[len] = {
needed: sampleCount,
strings: []
};
}
if (samples[len].needed) {
samples[len].strings.push(value);
samples[len].needed--;
}
}
var settings = instance.getSettings();
if (settings.colHeaders) {
instance.view.appendColHeader(col, tmp.theadTh); //TH innerHTML
}
var txt = '';
for (var i in samples) {
if (samples.hasOwnProperty(i)) {
for (var j = 0, jlen = samples[i].strings.length; j < jlen; j++) {
txt += samples[i].strings[j] + '<br>';
}
}
}
tmp.tbodyTd.innerHTML = txt; //TD innerHTML
instance.view.wt.wtDom.empty(tmp.rendererTd);
instance.view.wt.wtDom.empty(tmp.noRendererTd);
tmp.containerStyle.display = 'block';
var width = tmp.$container.outerWidth();
var cellProperties = instance.getCellMeta(0, col);
if (cellProperties.renderer) {
var str = 9999999999;
tmp.noRendererTd.appendChild(document.createTextNode(str));
var renderer = Handsontable.helper.getCellMethod('renderer', cellProperties.renderer);
renderer(instance, tmp.rendererTd, 0, col, instance.colToProp(col), str, cellProperties);
width += tmp.$renderer.width() - tmp.$noRenderer.width(); //add renderer overhead to the calculated width
}
tmp.containerStyle.display = 'none';
return width;
};
this.determineColumnsWidth = function () {
instance = this;
var settings = this.getSettings();
if (settings.autoColumnSize || !settings.colWidths) {
var cols = this.countCols();
for (var c = 0; c < cols; c++) {
this.autoColumnWidths[c] = that.determineColumnWidth(c);
}
}
};
this.getColWidth = function (col, response) {
if (this.autoColumnWidths[col] && this.autoColumnWidths[col] > response.width) {
response.width = this.autoColumnWidths[col];
}
};
}
var htAutoColumnSize = new HandsontableAutoColumnSize();
Handsontable.PluginHooks.add('beforeInit', htAutoColumnSize.beforeInit);
Handsontable.PluginHooks.add('beforeRender', htAutoColumnSize.determineColumnsWidth);
Handsontable.PluginHooks.add('afterGetColWidth', htAutoColumnSize.getColWidth);
/**
* This plugin sorts the view by a column (but does not sort the data source!)
* @constructor
*/
function HandsontableColumnSorting() {
var plugin = this;
var sortingEnabled;
this.afterInit = function () {
var instance = this;
if (this.getSettings().columnSorting) {
this.sortIndex = [];
this.rootElement.on('click.handsontable', '.columnSorting', function (e) {
var $target = $(e.target);
if ($target.is('.columnSorting')) {
var col = $target.closest('th').index();
if (instance.getSettings().rowHeaders) {
col--;
}
if (instance.sortColumn === col) {
instance.sortOrder = !instance.sortOrder;
}
else {
instance.sortColumn = col;
instance.sortOrder = true;
}
plugin.sort.call(instance);
instance.render();
}
});
}
};
this.sort = function () {
sortingEnabled = false;
var instance = this;
this.sortIndex.length = 0;
//var data = this.getData();
for (var i = 0, ilen = this.countRows(); i < ilen; i++) {
//this.sortIndex.push([i, data[i][this.sortColumn]]);
this.sortIndex.push([i, instance.getDataAtCell(i, this.sortColumn)]);
}
this.sortIndex.sort(function (a, b) {
if (a[1] === b[1]) {
return 0;
}
if (a[1] === null) {
return 1;
}
if (b[1] === null) {
return -1;
}
if (a[1] < b[1]) return instance.sortOrder ? -1 : 1;
if (a[1] > b[1]) return instance.sortOrder ? 1 : -1;
return 0;
});
sortingEnabled = true;
};
this.translateRow = function (getVars) {
if (sortingEnabled && this.sortIndex && this.sortIndex.length) {
getVars.row = this.sortIndex[getVars.row][0];
}
};
this.getColHeader = function (col, TH) {
if (this.getSettings().columnSorting) {
$(TH).find('span.colHeader')[0].className += ' columnSorting';
}
};
}
var htSortColumn = new HandsontableColumnSorting();
Handsontable.PluginHooks.add('afterInit', htSortColumn.afterInit);
Handsontable.PluginHooks.add('beforeGet', htSortColumn.translateRow);
Handsontable.PluginHooks.add('beforeSet', htSortColumn.translateRow);
Handsontable.PluginHooks.add('afterGetColHeader', htSortColumn.getColHeader);
function createContextMenu() {
var instance = this
, selectorId = instance.rootElement[0].id
, allItems = {
"row_above": {name: "Insert row above", disabled: isDisabled},
"row_below": {name: "Insert row below", disabled: isDisabled},
"hsep1": "---------",
"col_left": {name: "Insert column on the left", disabled: isDisabled},
"col_right": {name: "Insert column on the right", disabled: isDisabled},
"hsep2": "---------",
"remove_row": {name: "Remove row", disabled: isDisabled},
"remove_col": {name: "Remove column", disabled: isDisabled},
"hsep3": "---------",
"undo": {name: "Undo", disabled: function () {
return !instance.isUndoAvailable();
}},
"redo": {name: "Redo", disabled: function () {
return !instance.isRedoAvailable();
}}
}
, defaultOptions = {
selector : "#" + selectorId + ' table, #' + selectorId + ' div',
trigger : 'right',
callback : onContextClick
}
, options = {}
, i
, ilen
, settings = instance.getSettings();
function onContextClick(key) {
var corners = instance.getSelected(); //[top left row, top left col, bottom right row, bottom right col]
if (!corners) {
return; //needed when there are 2 grids on a page
}
switch (key) {
case "row_above":
instance.alter("insert_row", corners[0]);
break;
case "row_below":
instance.alter("insert_row", corners[2] + 1);
break;
case "col_left":
instance.alter("insert_col", corners[1]);
break;
case "col_right":
instance.alter("insert_col", corners[3] + 1);
break;
case "remove_row":
instance.alter(key, corners[0], (corners[2] - corners[0]) + 1);
break;
case "remove_col":
instance.alter(key, corners[1], (corners[3] - corners[1]) + 1);
break;
case "undo":
instance.undo();
break;
case "redo":
instance.redo();
break;
}
}
function isDisabled(key) {
//TODO rewrite
/*if (instance.blockedCols.main.find('th.htRowHeader.active').length && (key === "remove_col" || key === "col_left" || key === "col_right")) {
return true;
}
else if (instance.blockedRows.main.find('th.htColHeader.active').length && (key === "remove_row" || key === "row_above" || key === "row_below")) {
return true;
}
else*/
if (instance.countRows() >= instance.getSettings().maxRows && (key === "row_above" || key === "row_below")) {
return true;
}
else if (instance.countCols() >= instance.getSettings().maxCols && (key === "col_left" || key === "col_right")) {
return true;
}
else {
return false;
}
}
if (!settings.contextMenu) {
return;
}
else if (settings.contextMenu === true) { //contextMenu is true
options.items = allItems;
}
else if (Object.prototype.toString.apply(settings.contextMenu) === '[object Array]') { //contextMenu is an array
options.items = {};
for (i = 0, ilen = settings.contextMenu.length; i < ilen; i++) {
var key = settings.contextMenu[i];
if (typeof allItems[key] === 'undefined') {
throw new Error('Context menu key "' + key + '" is not recognised');
}
options.items[key] = allItems[key];
}
}
else if (Object.prototype.toString.apply(settings.contextMenu) === '[object Object]') { //contextMenu is an options object as defined in http://medialize.github.com/jQuery-contextMenu/docs.html
options = settings.contextMenu;
if (options.items) {
for (i in options.items) {
if (options.items.hasOwnProperty(i) && allItems[i]) {
if (typeof options.items[i] === 'string') {
options.items[i] = allItems[i];
}
else {
options.items[i] = $.extend(true, allItems[i], options.items[i]);
}
}
}
}
else {
options.items = allItems;
}
if (options.callback) {
var handsontableCallback = defaultOptions.callback;
var customCallback = options.callback;
options.callback = function (key, options) {
handsontableCallback(key, options);
customCallback(key, options);
}
}
}
if (!selectorId) {
throw new Error("Handsontable container must have an id");
}
$.contextMenu($.extend(true, defaultOptions, options));
}
function destroyContextMenu() {
var id = this.rootElement[0].id;
$.contextMenu('destroy', "#" + id + ' table, #' + id + ' div');
}
Handsontable.PluginHooks.add('afterInit', createContextMenu);
Handsontable.PluginHooks.add('afterDestroy', destroyContextMenu);
/**
* This plugin adds support for legacy features, deprecated APIs, etc.
*/
/**
* Support for old autocomplete syntax
* For old syntax, see: https://github.com/warpech/jquery-handsontable/blob/8c9e701d090ea4620fe08b6a1a048672fadf6c7e/README.md#defining-autocomplete
*/
Handsontable.PluginHooks.add('beforeGetCellMeta', function (row, col, cellProperties) {
var settings = this.getSettings(), data = this.getData(), i, ilen, a;
if (settings.autoComplete) {
for (i = 0, ilen = settings.autoComplete.length; i < ilen; i++) {
if (settings.autoComplete[i].match(row, col, data)) {
if (typeof cellProperties.type === 'undefined') {
cellProperties.type = Handsontable.AutocompleteCell;
}
else {
if (typeof cellProperties.type.renderer === 'undefined') {
cellProperties.type.renderer = Handsontable.AutocompleteCell.renderer;
}
if (typeof cellProperties.type.editor === 'undefined') {
cellProperties.type.editor = Handsontable.AutocompleteCell.editor;
}
}
for (a in settings.autoComplete[i]) {
if (settings.autoComplete[i].hasOwnProperty(a) && a !== 'match' && typeof cellProperties[i] === 'undefined') {
if (a === 'source') {
cellProperties[a] = settings.autoComplete[i][a](row, col);
}
else {
cellProperties[a] = settings.autoComplete[i][a];
}
}
}
break;
}
}
}
});
function HandsontableManualColumnMove() {
var instance
, pressed
, startCol
, endCol
, startX
, startOffset;
var ghost = document.createElement('DIV')
, ghostStyle = ghost.style;
ghost.className = 'ghost';
ghostStyle.position = 'absolute';
ghostStyle.top = '25px';
ghostStyle.left = 0;
ghostStyle.width = '10px';
ghostStyle.height = '10px';
ghostStyle.backgroundColor = '#CCC';
ghostStyle.opacity = 0.7;
$(document).mousemove(function (e) {
if (pressed) {
ghostStyle.left = startOffset + e.pageX - startX + 6 + 'px';
if (ghostStyle.display === 'none') {
ghostStyle.display = 'block';
}
}
});
$(document).mouseup(function () {
if (pressed) {
if (startCol < endCol) {
endCol--;
}
if (instance.getSettings().rowHeaders) {
startCol--;
endCol--;
}
instance.manualColumnPositions.splice(endCol, 0, instance.manualColumnPositions.splice(startCol, 1)[0]);
$('.manualColumnMover.active').removeClass('active');
pressed = false;
instance.forceFullRender = true;
instance.view.render(); //updates all
ghostStyle.display = 'none';
instance.runHooks('afterColumnMove', startCol, endCol);
}
});
this.beforeInit = function () {
this.manualColumnPositions = [];
};
this.afterInit = function () {
if (this.getSettings().manualColumnMove) {
var that = this;
this.rootElement.on('mousedown.handsontable', '.manualColumnMover', function (e) {
instance = that;
var $resizer = $(e.target);
var th = $resizer.closest('th');
startCol = th.index();
pressed = true;
startX = e.pageX;
var $table = that.rootElement.find('.htCore');
$table.parent()[0].appendChild(ghost);
ghostStyle.width = $resizer.parent().width() + 'px';
ghostStyle.height = $table.height() + 'px';
startOffset = parseInt(th.offset().left - $table.offset().left, 10);
ghostStyle.left = startOffset + 6 + 'px';
});
this.rootElement.on('mouseenter.handsontable', 'td, th', function () {
if (pressed) {
$('.manualColumnMover.active').removeClass('active');
var $ths = that.rootElement.find('thead th');
endCol = $(this).index();
var $hover = $ths.eq(endCol).find('.manualColumnMover').addClass('active');
$ths.not($hover).removeClass('active');
}
});
}
};
this.modifyCol = function (col) {
//TODO test performance: http://jsperf.com/object-wrapper-vs-primitive/2
if (this.getSettings().manualColumnMove) {
if (typeof this.manualColumnPositions[col] === 'undefined') {
this.manualColumnPositions[col] = col;
}
return this.manualColumnPositions[col];
}
return col;
};
this.getColHeader = function (col, TH) {
if (this.getSettings().manualColumnMove) {
var DIV = document.createElement('DIV');
DIV.className = 'manualColumnMover';
TH.firstChild.appendChild(DIV);
}
};
}
var htManualColumnMove = new HandsontableManualColumnMove();
Handsontable.PluginHooks.add('beforeInit', htManualColumnMove.beforeInit);
Handsontable.PluginHooks.add('afterInit', htManualColumnMove.afterInit);
Handsontable.PluginHooks.add('afterGetColHeader', htManualColumnMove.getColHeader);
Handsontable.PluginModifiers.push('col', htManualColumnMove.modifyCol);
function HandsontableManualColumnResize() {
var pressed
, currentCol
, currentWidth
, autoresizeTimeout
, instance
, newSize
, start
, startX
, startWidth
, startOffset
, dblclick = 0
, resizer = document.createElement('DIV')
, line = document.createElement('DIV')
, lineStyle = line.style;
resizer.className = 'manualColumnResizer';
line.className = 'manualColumnResizerLine';
lineStyle.position ='absolute';
lineStyle.top = 0;
lineStyle.left = 0;
lineStyle.width = 0;
lineStyle.borderRight = '1px dashed #777';
line.appendChild(resizer);
$(document).mousemove(function (e) {
if (pressed) {
currentWidth = startWidth + (e.pageX - startX);
newSize = setManualSize(currentCol, currentWidth); //save col width
lineStyle.left = startOffset + currentWidth - 1 + 'px';
if (lineStyle.display === 'none') {
lineStyle.display = 'block';
}
}
});
$(document).mouseup(function () {
if (pressed) {
$('.manualColumnResizer.active').removeClass('active');
pressed = false;
instance.forceFullRender = true;
instance.view.render(); //updates all
lineStyle.display = 'none';
instance.runHooks('afterColumnResize', currentCol, newSize);
}
});
this.beforeInit = function () {
this.manualColumnWidths = [];
};
this.afterInit = function () {
if (this.getSettings().manualColumnResize) {
var that = this;
this.rootElement.on('mousedown.handsontable', '.manualColumnResizer', function (e) {
if (autoresizeTimeout == null) {
autoresizeTimeout = setTimeout(function () {
if (dblclick >= 2) {
setManualSize(currentCol, htAutoColumnSize.determineColumnWidth.call(instance, currentCol));
instance.runHooks('afterColumnResize', currentCol, newSize);
}
dblclick = 0;
autoresizeTimeout = null;
}, 500);
}
dblclick++;
});
this.rootElement.on('mousedown.handsontable', '.manualColumnResizer', function (e) {
var _resizer = e.target,
$table = that.rootElement.find('.htCore'),
$grandpa = $(_resizer.parentNode.parentNode);
instance = that;
currentCol = _resizer.getAttribute('rel');
start = $(that.rootElement[0].getElementsByTagName('col')[$grandpa.index()]);
pressed = true;
startX = e.pageX;
startWidth = start.width();
currentWidth = startWidth;
_resizer.className += ' active';
lineStyle.height = $table.height() + 'px';
$table.parent()[0].appendChild(line);
startOffset = parseInt($grandpa.offset().left - $table.offset().left, 10);
lineStyle.left = startOffset + currentWidth - 1 + 'px';
});
}
};
var setManualSize = function (col, width) {
width = Math.max(width, 20);
width = Math.min(width, 500);
instance.manualColumnWidths[col] = width;
return width;
};
this.getColHeader = function (col, TH) {
if (this.getSettings().manualColumnResize) {
var DIV = document.createElement('DIV');
DIV.className = 'manualColumnResizer';
DIV.setAttribute('rel', col);
TH.firstChild.appendChild(DIV);
}
};
this.getColWidth = function (col, response) {
if (this.getSettings().manualColumnResize && this.manualColumnWidths[col]) {
response.width = this.manualColumnWidths[col];
}
};
}
var htManualColumnResize = new HandsontableManualColumnResize();
Handsontable.PluginHooks.add('beforeInit', htManualColumnResize.beforeInit);
Handsontable.PluginHooks.add('afterInit', htManualColumnResize.afterInit);
Handsontable.PluginHooks.add('afterGetColHeader', htManualColumnResize.getColHeader);
Handsontable.PluginHooks.add('afterGetColWidth', htManualColumnResize.getColWidth);
/*
* jQuery.fn.autoResize 1.1+
* --
* https://github.com/warpech/jQuery.fn.autoResize
*
* This fork differs from others in a way that it autoresizes textarea in 2-dimensions (horizontally and vertically).
* It was originally forked from alexbardas's repo but maybe should be merged with dpashkevich's repo in future.
*
* originally forked from:
* https://github.com/jamespadolsey/jQuery.fn.autoResize
* which is now located here:
* https://github.com/alexbardas/jQuery.fn.autoResize
* though the mostly maintained for is here:
* https://github.com/dpashkevich/jQuery.fn.autoResize/network
*
* --
* This program is free software. It comes without any warranty, to
* the extent permitted by applicable law. You can redistribute it
* and/or modify it under the terms of the Do What The Fuck You Want
* To Public License, Version 2, as published by Sam Hocevar. See
* http://sam.zoy.org/wtfpl/COPYING for more details. */
(function($){
autoResize.defaults = {
onResize: function(){},
animate: {
duration: 200,
complete: function(){}
},
extraSpace: 50,
minHeight: 'original',
maxHeight: 500,
minWidth: 'original',
maxWidth: 500
};
autoResize.cloneCSSProperties = [
'lineHeight', 'textDecoration', 'letterSpacing',
'fontSize', 'fontFamily', 'fontStyle', 'fontWeight',
'textTransform', 'textAlign', 'direction', 'wordSpacing', 'fontSizeAdjust',
'padding'
];
autoResize.cloneCSSValues = {
position: 'absolute',
top: -9999,
left: -9999,
opacity: 0,
overflow: 'hidden',
border: '1px solid black',
padding: '0.49em' //this must be about the width of caps W character
};
autoResize.resizableFilterSelector = 'textarea,input:not(input[type]),input[type=text],input[type=password]';
autoResize.AutoResizer = AutoResizer;
$.fn.autoResize = autoResize;
function autoResize(config) {
this.filter(autoResize.resizableFilterSelector).each(function(){
new AutoResizer( $(this), config );
});
return this;
}
function AutoResizer(el, config) {
if(this.clones) return;
this.config = $.extend({}, autoResize.defaults, config);
this.el = el;
this.nodeName = el[0].nodeName.toLowerCase();
this.previousScrollTop = null;
if (config.maxWidth === 'original') config.maxWidth = el.width();
if (config.minWidth === 'original') config.minWidth = el.width();
if (config.maxHeight === 'original') config.maxHeight = el.height();
if (config.minHeight === 'original') config.minHeight = el.height();
if (this.nodeName === 'textarea') {
el.css({
resize: 'none',
overflowY: 'hidden'
});
}
el.data('AutoResizer', this);
this.createClone();
this.injectClone();
this.bind();
}
AutoResizer.prototype = {
bind: function() {
var check = $.proxy(function(){
this.check();
return true;
}, this);
this.unbind();
this.el
.bind('keyup.autoResize', check)
//.bind('keydown.autoResize', check)
.bind('change.autoResize', check);
this.check(null, true);
},
unbind: function() {
this.el.unbind('.autoResize');
},
createClone: function() {
var el = this.el,
self = this,
config = this.config;
this.clones = $();
if (config.minHeight !== 'original' || config.maxHeight !== 'original') {
this.hClone = el.clone().height('auto');
this.clones = this.clones.add(this.hClone);
}
if (config.minWidth !== 'original' || config.maxWidth !== 'original') {
this.wClone = $('<div/>').width('auto').css({
whiteSpace: 'nowrap',
'float': 'left'
});
this.clones = this.clones.add(this.wClone);
}
$.each(autoResize.cloneCSSProperties, function(i, p){
self.clones.css(p, el.css(p));
});
this.clones
.removeAttr('name')
.removeAttr('id')
.attr('tabIndex', -1)
.css(autoResize.cloneCSSValues);
},
check: function(e, immediate) {
var config = this.config,
wClone = this.wClone,
hClone = this.hClone,
el = this.el,
value = el.val();
if (wClone) {
wClone.text(value);
// Calculate new width + whether to change
var cloneWidth = wClone.outerWidth(),
newWidth = (cloneWidth + config.extraSpace) >= config.minWidth ?
cloneWidth + config.extraSpace : config.minWidth,
currentWidth = el.width();
newWidth = Math.min(newWidth, config.maxWidth);
if (
(newWidth < currentWidth && newWidth >= config.minWidth) ||
(newWidth >= config.minWidth && newWidth <= config.maxWidth)
) {
config.onResize.call(el);
el.scrollLeft(0);
config.animate && !immediate ?
el.stop(1,1).animate({
width: newWidth
}, config.animate)
: el.width(newWidth);
}
}
if (hClone) {
if (newWidth) {
hClone.width(newWidth);
}
hClone.height(0).val(value).scrollTop(10000);
var scrollTop = hClone[0].scrollTop + config.extraSpace;
// Don't do anything if scrollTop hasen't changed:
if (this.previousScrollTop === scrollTop) {
return;
}
this.previousScrollTop = scrollTop;
if (scrollTop >= config.maxHeight) {
el.css('overflowY', '');
return;
}
el.css('overflowY', 'hidden');
if (scrollTop < config.minHeight) {
scrollTop = config.minHeight;
}
config.onResize.call(el);
// Either animate or directly apply height:
config.animate && !immediate ?
el.stop(1,1).animate({
height: scrollTop
}, config.animate)
: el.height(scrollTop);
}
},
destroy: function() {
this.unbind();
this.el.removeData('AutoResizer');
this.clones.remove();
delete this.el;
delete this.hClone;
delete this.wClone;
delete this.clones;
},
injectClone: function() {
(
autoResize.cloneContainer ||
(autoResize.cloneContainer = $('<arclones/>').appendTo('body'))
).empty().append(this.clones); //this should be refactored so that a node is never cloned more than once
}
};
})(jQuery);
/**
* SheetClip - Spreadsheet Clipboard Parser
* version 0.2
*
* This tiny library transforms JavaScript arrays to strings that are pasteable by LibreOffice, OpenOffice,
* Google Docs and Microsoft Excel.
*
* Copyright 2012, Marcin Warpechowski
* Licensed under the MIT license.
* http://github.com/warpech/sheetclip/
*/
/*jslint white: true*/
(function (global) {
"use strict";
function countQuotes(str) {
return str.split('"').length - 1;
}
global.SheetClip = {
parse: function (str) {
var r, rlen, rows, arr = [], a = 0, c, clen, multiline, last;
rows = str.split('\n');
if (rows.length > 1 && rows[rows.length - 1] === '') {
rows.pop();
}
for (r = 0, rlen = rows.length; r < rlen; r += 1) {
rows[r] = rows[r].split('\t');
for (c = 0, clen = rows[r].length; c < clen; c += 1) {
if (!arr[a]) {
arr[a] = [];
}
if (multiline && c === 0) {
last = arr[a].length - 1;
arr[a][last] = arr[a][last] + '\n' + rows[r][0];
if (multiline && (countQuotes(rows[r][0]) & 1)) { //& 1 is a bitwise way of performing mod 2
multiline = false;
arr[a][last] = arr[a][last].substring(0, arr[a][last].length - 1).replace(/""/g, '"');
}
}
else {
if (c === clen - 1 && rows[r][c].indexOf('"') === 0) {
arr[a].push(rows[r][c].substring(1).replace(/""/g, '"'));
multiline = true;
}
else {
arr[a].push(rows[r][c].replace(/""/g, '"'));
multiline = false;
}
}
}
if (!multiline) {
a += 1;
}
}
return arr;
},
stringify: function (arr) {
var r, rlen, c, clen, str = '', val;
for (r = 0, rlen = arr.length; r < rlen; r += 1) {
for (c = 0, clen = arr[r].length; c < clen; c += 1) {
if (c > 0) {
str += '\t';
}
val = arr[r][c];
if (typeof val === 'string') {
if (val.indexOf('\n') > -1) {
str += '"' + val.replace(/"/g, '""') + '"';
}
else {
str += val;
}
}
else if (val === null || val === void 0) { //void 0 resolves to undefined
str += '';
}
else {
str += val;
}
}
str += '\n';
}
return str;
}
};
}(window));
/**
* CopyPaste.js
* Creates a textarea that stays hidden on the page and gets focused when user presses CTRL while not having a form input focused
* In future we may implement a better driver when better APIs are available
* @constructor
*/
function CopyPaste(listenerElement) {
var that = this
, style;
listenerElement = listenerElement || document.body;
this.elDiv = document.createElement('DIV');
style = this.elDiv.style;
style.position = 'fixed';
style.top = 0;
style.left = 0;
listenerElement.appendChild(this.elDiv);
this.elTextarea = document.createElement('TEXTAREA');
this.elTextarea.className = 'copyPaste';
style = this.elTextarea.style;
style.width = '1px';
style.height = '1px';
this.elDiv.appendChild(this.elTextarea);
if (typeof style.opacity !== 'undefined') {
style.opacity = 0;
}
else {
/*@cc_on @if (@_jscript)
if(typeof style.filter === 'string') {
style.filter = 'alpha(opacity=0)';
}
@end @*/
}
this._bindEvent(listenerElement, 'keydown', function (event) {
var isCtrlDown = false;
if (event.metaKey) { //mac
isCtrlDown = true;
}
else if (event.ctrlKey && navigator.userAgent.indexOf('Mac') === -1) { //pc
isCtrlDown = true;
}
if (isCtrlDown) {
that.selectNodeText(that.elTextarea);
setTimeout(function () {
that.selectNodeText(that.elTextarea);
}, 0);
}
/* 67 = c
* 86 = v
* 88 = x
*/
if (isCtrlDown && (event.keyCode === 67 || event.keyCode === 86 || event.keyCode === 88)) {
// that.selectNodeText(that.elTextarea);
if (event.keyCode === 88) { //works in all browsers, incl. Opera < 12.12
setTimeout(function () {
that.triggerCut(event);
}, 0);
}
else if (event.keyCode === 86) {
setTimeout(function () {
that.triggerPaste(event);
}, 0);
}
}
});
}
//http://jsperf.com/textara-selection
//http://stackoverflow.com/questions/1502385/how-can-i-make-this-code-work-in-ie
CopyPaste.prototype.selectNodeText = function (el) {
el.select();
};
CopyPaste.prototype.copyable = function (str) {
if (typeof str !== 'string' && str.toString === void 0) {
throw new Error('copyable requires string parameter');
}
this.elTextarea.value = str;
};
CopyPaste.prototype.onCopy = function (fn) {
this.copyCallback = fn;
};
CopyPaste.prototype.onCut = function (fn) {
this.cutCallback = fn;
};
CopyPaste.prototype.onPaste = function (fn) {
this.pasteCallback = fn;
};
CopyPaste.prototype.triggerCut = function (event) {
var that = this;
if (that.cutCallback) {
setTimeout(function () {
that.cutCallback(event);
}, 0);
}
};
CopyPaste.prototype.triggerPaste = function (event, str) {
var that = this;
if (that.pasteCallback) {
setTimeout(function () {
that.pasteCallback((str || that.elTextarea.value).replace(/\n$/, ''), event); //remove trailing newline
}, 0);
}
};
//http://net.tutsplus.com/tutorials/javascript-ajax/javascript-from-null-cross-browser-event-binding/
//http://stackoverflow.com/questions/4643249/cross-browser-event-object-normalization
CopyPaste.prototype._bindEvent = (function () {
if (document.addEventListener) {
return function (elem, type, cb) {
elem.addEventListener(type, cb, false);
};
}
else {
return function (elem, type, cb) {
elem.attachEvent('on' + type, function () {
var e = window['event'];
e.target = e.srcElement;
e.relatedTarget = e.relatedTarget || e.type == 'mouseover' ? e.fromElement : e.toElement;
if (e.target.nodeType === 3) e.target = e.target.parentNode; //Safari bug
return cb.call(elem, e)
});
};
}
})();
function WalkontableBorder(instance, settings) {
var style;
//reference to instance
this.instance = instance;
this.settings = settings;
this.wtDom = this.instance.wtDom;
this.main = document.createElement("div");
style = this.main.style;
style.position = 'absolute';
style.top = 0;
style.left = 0;
for (var i = 0; i < 5; i++) {
var DIV = document.createElement('DIV');
DIV.className = 'wtBorder ' + (settings.className || '');
style = DIV.style;
style.backgroundColor = settings.border.color;
style.height = settings.border.width + 'px';
style.width = settings.border.width + 'px';
this.main.appendChild(DIV);
}
this.top = this.main.childNodes[0];
this.left = this.main.childNodes[1];
this.bottom = this.main.childNodes[2];
this.right = this.main.childNodes[3];
this.topStyle = this.top.style;
this.leftStyle = this.left.style;
this.bottomStyle = this.bottom.style;
this.rightStyle = this.right.style;
this.corner = this.main.childNodes[4];
this.corner.className += ' corner';
this.cornerStyle = this.corner.style;
this.cornerStyle.width = '5px';
this.cornerStyle.height = '5px';
this.cornerStyle.border = '2px solid #FFF';
this.disappear();
instance.wtTable.hider.appendChild(this.main);
}
/**
* Show border around one or many cells
* @param {Array} corners
*/
WalkontableBorder.prototype.appear = function (corners) {
var isMultiple, fromTD, toTD, fromOffset, toOffset, containerOffset, top, minTop, left, minLeft, height, width;
if (this.disabled) {
return;
}
var instance = this.instance
, fromRow
, fromColumn
, toRow
, toColumn
, hideTop = false
, hideLeft = false
, hideBottom = false
, hideRight = false
, i
, ilen
, s;
if (!instance.wtTable.isRowInViewport(corners[0])) {
hideTop = true;
}
if (!instance.wtTable.isRowInViewport(corners[2])) {
hideBottom = true;
}
ilen = instance.wtTable.rowStrategy.countVisible();
for (i = 0; i < ilen; i++) {
s = instance.wtTable.rowFilter.visibleToSource(i);
if (s >= corners[0] && s <= corners[2]) {
fromRow = s;
break;
}
}
for (i = ilen - 1; i >= 0; i--) {
s = instance.wtTable.rowFilter.visibleToSource(i);
if (s >= corners[0] && s <= corners[2]) {
toRow = s;
break;
}
}
if (hideTop && hideBottom) {
hideLeft = true;
hideRight = true;
}
else {
if (!instance.wtTable.isColumnInViewport(corners[1])) {
hideLeft = true;
}
if (!instance.wtTable.isColumnInViewport(corners[3])) {
hideRight = true;
}
ilen = instance.wtTable.columnStrategy.countVisible();
for (i = 0; i < ilen; i++) {
s = instance.wtTable.columnFilter.visibleToSource(i);
if (s >= corners[1] && s <= corners[3]) {
fromColumn = s;
break;
}
}
for (i = ilen - 1; i >= 0; i--) {
s = instance.wtTable.columnFilter.visibleToSource(i);
if (s >= corners[1] && s <= corners[3]) {
toColumn = s;
break;
}
}
}
if (fromRow !== void 0 && fromColumn !== void 0) {
isMultiple = (fromRow !== toRow || fromColumn !== toColumn);
fromTD = instance.wtTable.getCell([fromRow, fromColumn]);
toTD = isMultiple ? instance.wtTable.getCell([toRow, toColumn]) : fromTD;
fromOffset = this.wtDom.offset(fromTD);
toOffset = isMultiple ? this.wtDom.offset(toTD) : fromOffset;
containerOffset = this.wtDom.offset(instance.wtTable.TABLE);
minTop = fromOffset.top;
height = toOffset.top + this.wtDom.outerHeight(toTD) - minTop;
minLeft = fromOffset.left;
width = toOffset.left + this.wtDom.outerWidth(toTD) - minLeft;
top = minTop - containerOffset.top - 1;
left = minLeft - containerOffset.left - 1;
var style = this.wtDom.getComputedStyle(fromTD);
if (parseInt(style['borderTopWidth'], 10) > 0) {
top += 1;
height -= 1;
}
if (parseInt(style['borderLeftWidth'], 10) > 0) {
left += 1;
width -= 1;
}
}
else {
this.disappear();
return;
}
if (hideTop) {
this.topStyle.display = 'none';
}
else {
this.topStyle.top = top + 'px';
this.topStyle.left = left + 'px';
this.topStyle.width = width + 'px';
this.topStyle.display = 'block';
}
if (hideLeft) {
this.leftStyle.display = 'none';
}
else {
this.leftStyle.top = top + 'px';
this.leftStyle.left = left + 'px';
this.leftStyle.height = height + 'px';
this.leftStyle.display = 'block';
}
var delta = Math.floor(this.settings.border.width / 2);
if (hideBottom) {
this.bottomStyle.display = 'none';
}
else {
this.bottomStyle.top = top + height - delta + 'px';
this.bottomStyle.left = left + 'px';
this.bottomStyle.width = width + 'px';
this.bottomStyle.display = 'block';
}
if (hideRight) {
this.rightStyle.display = 'none';
}
else {
this.rightStyle.top = top + 'px';
this.rightStyle.left = left + width - delta + 'px';
this.rightStyle.height = height + 1 + 'px';
this.rightStyle.display = 'block';
}
if (hideBottom || hideRight || !this.hasSetting(this.settings.border.cornerVisible)) {
this.cornerStyle.display = 'none';
}
else {
this.cornerStyle.top = top + height - 4 + 'px';
this.cornerStyle.left = left + width - 4 + 'px';
this.cornerStyle.display = 'block';
}
};
/**
* Hide border
*/
WalkontableBorder.prototype.disappear = function () {
this.topStyle.display = 'none';
this.leftStyle.display = 'none';
this.bottomStyle.display = 'none';
this.rightStyle.display = 'none';
this.cornerStyle.display = 'none';
};
WalkontableBorder.prototype.hasSetting = function (setting) {
if (typeof setting === 'function') {
return setting();
}
return !!setting;
};
/**
* WalkontableCellFilter
* @constructor
*/
function WalkontableCellFilter() {
this.offset = 0;
this.total = 0;
this.fixedCount = 0;
}
WalkontableCellFilter.prototype.source = function (n) {
return n;
};
WalkontableCellFilter.prototype.offsetted = function (n) {
return n + this.offset;
};
WalkontableCellFilter.prototype.unOffsetted = function (n) {
return n - this.offset;
};
WalkontableCellFilter.prototype.fixed = function (n) {
if (n < this.fixedCount) {
return n - this.offset;
}
else {
return n;
}
};
WalkontableCellFilter.prototype.unFixed = function (n) {
if (n < this.fixedCount) {
return n + this.offset;
}
else {
return n;
}
};
WalkontableCellFilter.prototype.visibleToSource = function (n) {
return this.source(this.offsetted(this.fixed(n)));
};
WalkontableCellFilter.prototype.sourceToVisible = function (n) {
return this.source(this.unOffsetted(this.unFixed(n)));
};
/**
* WalkontableCellStrategy
* @constructor
*/
function WalkontableCellStrategy() {
}
WalkontableCellStrategy.prototype.getSize = function (index) {
return this.cellSizes[index];
};
WalkontableCellStrategy.prototype.getContainerSize = function (proposedSize) {
return typeof this.containerSizeFn === 'function' ? this.containerSizeFn(proposedSize) : this.containerSizeFn;
};
WalkontableCellStrategy.prototype.countVisible = function () {
return this.cellCount;
};
WalkontableCellStrategy.prototype.isLastIncomplete = function () {
return this.remainingSize > 0;
};
/**
* WalkontableClassNameList
* @constructor
*/
function WalkontableClassNameCache() {
this.cache = [];
}
WalkontableClassNameCache.prototype.add = function (r, c, cls) {
if (!this.cache[r]) {
this.cache[r] = [];
}
if (!this.cache[r][c]) {
this.cache[r][c] = [];
}
this.cache[r][c][cls] = true;
};
WalkontableClassNameCache.prototype.test = function (r, c, cls) {
return (this.cache[r] && this.cache[r][c] && this.cache[r][c][cls]);
};
/**
* WalkontableColumnFilter
* @constructor
*/
function WalkontableColumnFilter() {
this.countTH = 0;
}
WalkontableColumnFilter.prototype = new WalkontableCellFilter();
WalkontableColumnFilter.prototype.readSettings = function (instance) {
this.offset = instance.wtSettings.settings.offsetColumn;
this.total = instance.getSetting('totalColumns');
this.fixedCount = instance.getSetting('fixedColumnsLeft');
this.countTH = instance.getSetting('rowHeaders').length;
};
WalkontableColumnFilter.prototype.offsettedTH = function (n) {
return n - this.countTH;
};
WalkontableColumnFilter.prototype.unOffsettedTH = function (n) {
return n + this.countTH;
};
WalkontableColumnFilter.prototype.visibleRowHeadedColumnToSourceColumn = function (n) {
return this.visibleToSource(this.offsettedTH(n));
};
WalkontableColumnFilter.prototype.sourceColumnToVisibleRowHeadedColumn = function (n) {
return this.unOffsettedTH(this.sourceToVisible(n));
};
/**
* WalkontableColumnStrategy
* @param containerSizeFn
* @param sizeAtIndex
* @param strategy - all, last, none
* @constructor
*/
function WalkontableColumnStrategy(containerSizeFn, sizeAtIndex, strategy) {
var size
, i = 0;
this.containerSizeFn = containerSizeFn;
this.cellSizesSum = 0;
this.cellSizes = [];
this.cellCount = 0;
this.remainingSize = 0;
this.strategy = strategy;
//step 1 - determine cells that fit containerSize and cache their widths
while (true) {
size = sizeAtIndex(i);
if (size === void 0) {
break; //total columns exceeded
}
if (this.cellSizesSum >= this.getContainerSize(this.cellSizesSum + size)) {
break; //total width exceeded
}
this.cellSizes.push(size);
this.cellSizesSum += size;
this.cellCount++;
i++;
}
var containerSize = this.getContainerSize(this.cellSizesSum);
this.remainingSize = this.cellSizesSum - containerSize;
//negative value means the last cell is fully visible and there is some space left for stretching
//positive value means the last cell is not fully visible
}
WalkontableColumnStrategy.prototype = new WalkontableCellStrategy();
WalkontableColumnStrategy.prototype.stretch = function () {
//step 2 - apply stretching strategy
var containerSize = this.getContainerSize(this.cellSizesSum)
, i = 0;
this.remainingSize = this.cellSizesSum - containerSize;
if (this.strategy === 'all') {
if (this.remainingSize < 0) {
var ratio = containerSize / this.cellSizesSum;
var newSize;
while (i < this.cellCount - 1) { //"i < this.cellCount - 1" is needed because last cellSize is adjusted after the loop
newSize = Math.floor(ratio * this.cellSizes[i]);
this.remainingSize += newSize - this.cellSizes[i];
this.cellSizes[i] = newSize;
i++;
}
this.cellSizes[this.cellCount - 1] -= this.remainingSize;
this.remainingSize = 0;
}
}
else if (this.strategy === 'last') {
if (this.remainingSize < 0) {
this.cellSizes[this.cellCount - 1] -= this.remainingSize;
this.remainingSize = 0;
}
}
};
function Walkontable(settings) {
var that = this,
originalHeaders = [];
//bootstrap from settings
this.wtSettings = new WalkontableSettings(this, settings);
this.wtDom = new WalkontableDom();
this.wtTable = new WalkontableTable(this);
this.wtScroll = new WalkontableScroll(this);
this.wtScrollbars = new WalkontableScrollbars(this);
this.wtViewport = new WalkontableViewport(this);
this.wtWheel = new WalkontableWheel(this);
this.wtEvent = new WalkontableEvent(this);
//find original headers
if (this.wtTable.THEAD.childNodes.length && this.wtTable.THEAD.childNodes[0].childNodes.length) {
for (var c = 0, clen = this.wtTable.THEAD.childNodes[0].childNodes.length; c < clen; c++) {
originalHeaders.push(this.wtTable.THEAD.childNodes[0].childNodes[c].innerHTML);
}
if (!this.getSetting('columnHeaders').length) {
this.update('columnHeaders', [function (column, TH) {
that.wtDom.avoidInnerHTML(TH, originalHeaders[column]);
}]);
}
}
//initialize selections
this.selections = {};
var selectionsSettings = this.getSetting('selections');
if (selectionsSettings) {
for (var i in selectionsSettings) {
if (selectionsSettings.hasOwnProperty(i)) {
this.selections[i] = new WalkontableSelection(this, selectionsSettings[i]);
}
}
}
this.drawn = false;
this.drawInterrupted = false;
}
Walkontable.prototype.draw = function (selectionsOnly) {
this.drawInterrupted = false;
if (!selectionsOnly && !this.wtDom.isVisible(this.wtTable.TABLE)) {
this.drawInterrupted = true; //draw interrupted because TABLE is not visible
return;
}
this.getSetting('beforeDraw', !selectionsOnly);
selectionsOnly = selectionsOnly && this.getSetting('offsetRow') === this.lastOffsetRow && this.getSetting('offsetColumn') === this.lastOffsetColumn;
if (this.drawn) { //fix offsets that might have changed
this.scrollVertical(0);
this.scrollHorizontal(0);
}
this.lastOffsetRow = this.getSetting('offsetRow');
this.lastOffsetColumn = this.getSetting('offsetColumn');
this.wtTable.draw(selectionsOnly);
this.getSetting('onDraw');
return this;
};
Walkontable.prototype.update = function (settings, value) {
return this.wtSettings.update(settings, value);
};
Walkontable.prototype.scrollVertical = function (delta) {
return this.wtScroll.scrollVertical(delta);
};
Walkontable.prototype.scrollHorizontal = function (delta) {
return this.wtScroll.scrollHorizontal(delta);
};
Walkontable.prototype.scrollViewport = function (coords) {
this.wtScroll.scrollViewport(coords);
return this;
};
Walkontable.prototype.getViewport = function () {
return [
this.wtTable.rowFilter.visibleToSource(0),
this.wtTable.columnFilter.visibleToSource(0),
this.wtTable.getLastVisibleRow(),
this.wtTable.getLastVisibleColumn()
];
};
Walkontable.prototype.getSetting = function (key, param1, param2, param3) {
return this.wtSettings.getSetting(key, param1, param2, param3);
};
Walkontable.prototype.hasSetting = function (key) {
return this.wtSettings.has(key);
};
Walkontable.prototype.destroy = function () {
this.wtScrollbars.destroy();
clearTimeout(this.wheelTimeout);
clearTimeout(this.dblClickTimeout);
};
function WalkontableDom() {
}
//goes up the DOM tree (including given element) until it finds an element that matches the nodeName
WalkontableDom.prototype.closest = function (elem, nodeNames) {
while (elem != null) {
if (elem.nodeType === 1 && nodeNames.indexOf(elem.nodeName) > -1) {
return elem;
}
elem = elem.parentNode;
}
return null;
};
WalkontableDom.prototype.prevSiblings = function (elem) {
var out = [];
while ((elem = elem.previousSibling) != null) {
if (elem.nodeType === 1) {
out.push(elem);
}
}
return out;
};
if (document.documentElement.classList) {
// HTML5 classList API
WalkontableDom.prototype.hasClass = function (ele, cls) {
return ele.classList.contains(cls);
};
WalkontableDom.prototype.addClass = function (ele, cls) {
ele.classList.add(cls);
};
WalkontableDom.prototype.removeClass = function (ele, cls) {
ele.classList.remove(cls);
};
}
else {
//http://snipplr.com/view/3561/addclass-removeclass-hasclass/
WalkontableDom.prototype.hasClass = function (ele, cls) {
return ele.className.match(new RegExp('(\\s|^)' + cls + '(\\s|$)'));
};
WalkontableDom.prototype.addClass = function (ele, cls) {
if (!this.hasClass(ele, cls)) ele.className += " " + cls;
};
WalkontableDom.prototype.removeClass = function (ele, cls) {
if (this.hasClass(ele, cls)) { //is this really needed?
var reg = new RegExp('(\\s|^)' + cls + '(\\s|$)');
ele.className = ele.className.replace(reg, ' ').replace(/^\s\s*/, '').replace(/\s\s*$/, ''); //last 2 replaces do right trim (see http://blog.stevenlevithan.com/archives/faster-trim-javascript)
}
};
}
/*//http://net.tutsplus.com/tutorials/javascript-ajax/javascript-from-null-cross-browser-event-binding/
WalkontableDom.prototype.addEvent = (function () {
var that = this;
if (document.addEventListener) {
return function (elem, type, cb) {
if ((elem && !elem.length) || elem === window) {
elem.addEventListener(type, cb, false);
}
else if (elem && elem.length) {
var len = elem.length;
for (var i = 0; i < len; i++) {
that.addEvent(elem[i], type, cb);
}
}
};
}
else {
return function (elem, type, cb) {
if ((elem && !elem.length) || elem === window) {
elem.attachEvent('on' + type, function () {
//normalize
//http://stackoverflow.com/questions/4643249/cross-browser-event-object-normalization
var e = window['event'];
e.target = e.srcElement;
//e.offsetX = e.layerX;
//e.offsetY = e.layerY;
e.relatedTarget = e.relatedTarget || e.type == 'mouseover' ? e.fromElement : e.toElement;
if (e.target.nodeType === 3) e.target = e.target.parentNode; //Safari bug
return cb.call(elem, e)
});
}
else if (elem.length) {
var len = elem.length;
for (var i = 0; i < len; i++) {
that.addEvent(elem[i], type, cb);
}
}
};
}
})();
WalkontableDom.prototype.triggerEvent = function (element, eventName, target) {
var event;
if (document.createEvent) {
event = document.createEvent("MouseEvents");
event.initEvent(eventName, true, true);
} else {
event = document.createEventObject();
event.eventType = eventName;
}
event.eventName = eventName;
event.target = target;
if (document.createEvent) {
target.dispatchEvent(event);
} else {
target.fireEvent("on" + event.eventType, event);
}
};*/
WalkontableDom.prototype.removeTextNodes = function (elem, parent) {
if (elem.nodeType === 3) {
parent.removeChild(elem); //bye text nodes!
}
else if (['TABLE', 'THEAD', 'TBODY', 'TFOOT', 'TR'].indexOf(elem.nodeName) > -1) {
var childs = elem.childNodes;
for (var i = childs.length - 1; i >= 0; i--) {
this.removeTextNodes(childs[i], elem);
}
}
};
/**
* Remove childs function
* WARNING - this doesn't unload events and data attached by jQuery
* http://jsperf.com/jquery-html-vs-empty-vs-innerhtml/9
* @param element
* @returns {void}
*/
//
WalkontableDom.prototype.empty = function (element) {
var child;
while (child = element.lastChild) {
element.removeChild(child);
}
};
/**
* Insert content into element trying avoid innerHTML method.
* @return {void}
*/
WalkontableDom.prototype.avoidInnerHTML = function (element, content) {
if ((/(<(.*)>|&(.*);)/g).test(content)) {
element.innerHTML = content;
} else {
var child;
while (child = element.lastChild) {
element.removeChild(child);
}
element.appendChild(document.createTextNode(content));
}
};
/**
* Returns true if element is attached to the DOM and visible, false otherwise
* @param elem
* @returns {boolean}
*/
WalkontableDom.prototype.isVisible = function (elem) {
//fast method
try {//try/catch performance is not a problem here: http://jsperf.com/try-catch-performance-overhead/7
if (!elem.offsetParent) {
return false; //fixes problem with UI Bootstrap <tabs> directive
}
}
catch (e) {
return false; //IE7-8 throws "Unspecified error" when offsetParent is not found - we catch it here
}
// if (elem.offsetWidth > 0 || (elem.parentNode && elem.parentNode.offsetWidth > 0)) { //IE10 was mistaken here
if (elem.offsetWidth > 0) {
return true;
}
//slow method
var next = elem;
while (next !== document.documentElement) { //until <html> reached
if (next === null) { //parent detached from DOM
return false;
}
else if (next.nodeType === 11) {
if (next.nodeName === '#document-fragment') { //Shadow DOM
return true;
}
else { //IE7 reports nodeType === 11 after detaching element from DOM
return false;
}
}
else if (next.style.display === 'none') {
return false;
}
/*else if (next !== elem && next.offsetWidth === 0) {
//this is the technique used by jQuery is(':visible')
//but in IE7, clientWidth & offsetWidth sometimes returns 0 when it shouldn't
return false;
compare with jQuery :visible selector (search jquery.js for `reliableHiddenOffsets`)
}*/
next = next.parentNode;
}
return true;
};
/**
* seems getBounding is usually faster: http://jsperf.com/offset-vs-getboundingclientrect/4
* but maybe offset + cache would work?
* edit: after more tests turns out offsetLeft/Top is faster
*/
WalkontableDom.prototype.offset = function (elem) {
var offsetLeft = elem.offsetLeft
, offsetTop = elem.offsetTop;
while (elem = elem.offsetParent) {
offsetLeft += elem.offsetLeft;
offsetTop += elem.offsetTop;
}
return {
left: offsetLeft,
top: offsetTop
};
};
WalkontableDom.prototype.getComputedStyle = function (elem) {
return elem.currentStyle || document.defaultView.getComputedStyle(elem);
};
WalkontableDom.prototype.outerWidth = function (elem) {
return elem.offsetWidth;
};
WalkontableDom.prototype.outerHeight = function (elem) {
return elem.offsetHeight;
};
function WalkontableEvent(instance) {
var that = this;
//reference to instance
this.instance = instance;
this.wtDom = this.instance.wtDom;
var dblClickOrigin = [null, null, null, null];
this.instance.dblClickTimeout = null;
var onMouseDown = function (event) {
var cell = that.parentCell(event.target);
if (cell.TD && cell.TD.nodeName === 'TD') {
if (that.instance.hasSetting('onCellMouseDown')) {
that.instance.getSetting('onCellMouseDown', event, cell.coords, cell.TD);
}
}
else if (that.wtDom.hasClass(event.target, 'corner')) {
that.instance.getSetting('onCellCornerMouseDown', event, event.target);
}
if (event.button !== 2) { //if not right mouse button
if (cell.TD && cell.TD.nodeName === 'TD') {
dblClickOrigin.shift();
dblClickOrigin.push(cell.TD);
}
else if (that.wtDom.hasClass(event.target, 'corner')) {
dblClickOrigin.shift();
dblClickOrigin.push(event.target);
}
}
};
var lastMouseOver;
var onMouseOver = function (event) {
if (that.instance.hasSetting('onCellMouseOver')) {
var TD = that.wtDom.closest(event.target, ['TD', 'TH']);
if (TD && TD !== lastMouseOver) {
lastMouseOver = TD;
if (TD.nodeName === 'TD') {
that.instance.getSetting('onCellMouseOver', event, that.instance.wtTable.getCoords(TD), TD);
}
}
}
};
var onMouseUp = function (event) {
if (event.button !== 2) { //if not right mouse button
var cell = that.parentCell(event.target);
if (cell.TD && cell.TD.nodeName === 'TD') {
dblClickOrigin.shift();
dblClickOrigin.push(cell.TD);
}
else {
dblClickOrigin.shift();
dblClickOrigin.push(event.target);
}
if (dblClickOrigin[3] !== null && dblClickOrigin[3] === dblClickOrigin[2]) {
if (that.instance.dblClickTimeout && dblClickOrigin[2] === dblClickOrigin[1] && dblClickOrigin[1] === dblClickOrigin[0]) {
if (cell.TD) {
that.instance.getSetting('onCellDblClick', event, cell.coords, cell.TD);
}
else if (that.wtDom.hasClass(event.target, 'corner')) {
that.instance.getSetting('onCellCornerDblClick', event, cell.coords, cell.TD);
}
clearTimeout(that.instance.dblClickTimeout);
that.instance.dblClickTimeout = null;
}
else {
clearTimeout(that.instance.dblClickTimeout);
that.instance.dblClickTimeout = setTimeout(function () {
that.instance.dblClickTimeout = null;
}, 500);
}
}
}
};
$(this.instance.wtTable.parent).on('mousedown', onMouseDown);
$(this.instance.wtTable.TABLE).on('mouseover', onMouseOver);
$(this.instance.wtTable.parent).on('mouseup', onMouseUp);
}
WalkontableEvent.prototype.parentCell = function (elem) {
var cell = {};
cell.TD = this.wtDom.closest(elem, ['TD', 'TH']);
if (cell.TD) {
cell.coords = this.instance.wtTable.getCoords(cell.TD);
}
else if (!cell.TD && this.wtDom.hasClass(elem, 'wtBorder') && this.wtDom.hasClass(elem, 'current') && !this.wtDom.hasClass(elem, 'corner')) {
cell.coords = this.instance.selections.current.selected[0];
cell.TD = this.instance.wtTable.getCell(cell.coords);
}
return cell;
};
function walkontableRangesIntersect() {
var from = arguments[0];
var to = arguments[1];
for (var i = 1, ilen = arguments.length / 2; i < ilen; i++) {
if (from <= arguments[2 * i + 1] && to >= arguments[2 * i]) {
return true;
}
}
return false;
}
//http://stackoverflow.com/questions/3629183/why-doesnt-indexof-work-on-an-array-ie8
if (!Array.prototype.indexOf) {
Array.prototype.indexOf = function (elt /*, from*/) {
var len = this.length >>> 0;
var from = Number(arguments[1]) || 0;
from = (from < 0)
? Math.ceil(from)
: Math.floor(from);
if (from < 0)
from += len;
for (; from < len; from++) {
if (from in this &&
this[from] === elt)
return from;
}
return -1;
};
}
/**
* http://notes.jetienne.com/2011/05/18/cancelRequestAnimFrame-for-paul-irish-requestAnimFrame.html
*/
window.requestAnimFrame = (function () {
return window.requestAnimationFrame ||
window.webkitRequestAnimationFrame ||
window.mozRequestAnimationFrame ||
window.oRequestAnimationFrame ||
window.msRequestAnimationFrame ||
function (/* function */ callback, /* DOMElement */ element) {
return window.setTimeout(callback, 1000 / 60);
};
})();
window.cancelRequestAnimFrame = (function () {
return window.cancelAnimationFrame ||
window.webkitCancelRequestAnimationFrame ||
window.mozCancelRequestAnimationFrame ||
window.oCancelRequestAnimationFrame ||
window.msCancelRequestAnimationFrame ||
clearTimeout
})();
//http://snipplr.com/view/13523/
//modified for speed
//http://jsperf.com/getcomputedstyle-vs-style-vs-css/8
if (!window.getComputedStyle) {
(function () {
var elem;
var styleObj = {
getPropertyValue: function getPropertyValue(prop) {
if (prop == 'float') prop = 'styleFloat';
return elem.currentStyle[prop.toUpperCase()] || null;
}
}
window.getComputedStyle = function (el) {
elem = el;
return styleObj;
}
})();
}
/**
* WalkontableRowFilter
* @constructor
*/
function WalkontableRowFilter() {
}
WalkontableRowFilter.prototype = new WalkontableCellFilter();
WalkontableRowFilter.prototype.readSettings = function (instance) {
this.offset = instance.wtSettings.settings.offsetRow;
this.total = instance.getSetting('totalRows');
this.fixedCount = instance.getSetting('fixedRowsTop');
};
/**
* WalkontableRowStrategy
* @param containerSizeFn
* @param sizeAtIndex
* @constructor
*/
function WalkontableRowStrategy(containerSizeFn, sizeAtIndex) {
this.containerSizeFn = containerSizeFn;
this.sizeAtIndex = sizeAtIndex;
this.cellSizesSum = 0;
this.cellSizes = [];
this.cellCount = 0;
this.remainingSize = -Infinity;
}
WalkontableRowStrategy.prototype = new WalkontableCellStrategy();
WalkontableRowStrategy.prototype.add = function (i, TD) {
if (this.remainingSize < 0) {
var size = this.sizeAtIndex(i, TD);
if (size === void 0) {
return; //total rows exceeded
}
var containerSize = this.getContainerSize(this.cellSizesSum + size);
this.cellSizes.push(size);
this.cellSizesSum += size;
this.cellCount++;
this.remainingSize = this.cellSizesSum - containerSize;
}
};
function WalkontableScroll(instance) {
this.instance = instance;
}
WalkontableScroll.prototype.scrollVertical = function (delta) {
if (!this.instance.drawn) {
throw new Error('scrollVertical can only be called after table was drawn to DOM');
}
var instance = this.instance
, newOffset
, offset = instance.getSetting('offsetRow')
, fixedCount = instance.getSetting('fixedRowsTop')
, total = instance.getSetting('totalRows')
, maxSize = instance.wtViewport.getViewportHeight();
if (total > 0) {
newOffset = this.scrollLogic(delta, offset, total, fixedCount, maxSize, function (row) {
if (row - offset < fixedCount) {
return instance.getSetting('rowHeight', row - offset);
}
else {
return instance.getSetting('rowHeight', row);
}
});
}
else {
newOffset = 0;
}
if (newOffset !== offset) {
instance.update('offsetRow', newOffset);
}
return instance;
};
WalkontableScroll.prototype.scrollHorizontal = function (delta) {
if (!this.instance.drawn) {
throw new Error('scrollHorizontal can only be called after table was drawn to DOM');
}
var instance = this.instance
, newOffset
, offset = instance.getSetting('offsetColumn')
, fixedCount = instance.getSetting('fixedColumnsLeft')
, total = instance.getSetting('totalColumns')
, maxSize = instance.wtViewport.getViewportWidth();
if (total > 0) {
newOffset = this.scrollLogic(delta, offset, total, fixedCount, maxSize, function (col) {
if (col - offset < fixedCount) {
return instance.getSetting('columnWidth', col - offset);
}
else {
return instance.getSetting('columnWidth', col);
}
});
}
else {
newOffset = 0;
}
if (newOffset !== offset) {
instance.update('offsetColumn', newOffset);
}
return instance;
};
WalkontableScroll.prototype.scrollLogic = function (delta, offset, total, fixedCount, maxSize, cellSizeFn) {
var newOffset = offset + delta
, sum = 0
, col;
if (newOffset > fixedCount) {
if (newOffset >= total - fixedCount) {
newOffset = total - fixedCount - 1;
}
col = newOffset;
while (sum < maxSize && col < total) {
sum += cellSizeFn(col);
col++;
}
if (sum < maxSize) {
while (newOffset > 0) {
//if sum still less than available width, we cannot scroll that far (must move offset to the left)
sum += cellSizeFn(newOffset - 1);
if (sum < maxSize) {
newOffset--;
}
else {
break;
}
}
}
}
else if (newOffset < 0) {
newOffset = 0;
}
return newOffset;
};
/**
* Scrolls viewport to a cell by minimum number of cells
*/
WalkontableScroll.prototype.scrollViewport = function (coords) {
var offsetRow = this.instance.getSetting('offsetRow')
, offsetColumn = this.instance.getSetting('offsetColumn')
, lastVisibleRow = this.instance.wtTable.getLastVisibleRow()
, lastVisibleColumn = this.instance.wtTable.getLastVisibleColumn()
, totalRows = this.instance.getSetting('totalRows')
, totalColumns = this.instance.getSetting('totalColumns')
, fixedRowsTop = this.instance.getSetting('fixedRowsTop')
, fixedColumnsLeft = this.instance.getSetting('fixedColumnsLeft');
if (coords[0] < 0 || coords[0] > totalRows - 1) {
throw new Error('row ' + coords[0] + ' does not exist');
}
else if (coords[1] < 0 || coords[1] > totalColumns - 1) {
throw new Error('column ' + coords[1] + ' does not exist');
}
if (coords[0] > lastVisibleRow) {
this.scrollVertical(coords[0] - lastVisibleRow + 1);
}
else if (coords[0] === lastVisibleRow && this.instance.wtTable.rowStrategy.isLastIncomplete()) {
this.scrollVertical(coords[0] - lastVisibleRow + 1);
}
else if (coords[0] - fixedRowsTop < offsetRow) {
this.scrollVertical(coords[0] - fixedRowsTop - offsetRow);
}
else {
this.scrollVertical(0); //Craig's issue: remove row from the last scroll page should scroll viewport a row up if needed
}
if (coords[1] > lastVisibleColumn) {
this.scrollHorizontal(coords[1] - lastVisibleColumn + 1);
}
else if (coords[1] === lastVisibleColumn && this.instance.wtTable.columnStrategy.isLastIncomplete()) {
this.scrollHorizontal(coords[1] - lastVisibleColumn + 1);
}
else if (coords[1] - fixedColumnsLeft < offsetColumn) {
this.scrollHorizontal(coords[1] - fixedColumnsLeft - offsetColumn);
}
else {
this.scrollHorizontal(0); //Craig's issue
}
return this.instance;
};
function WalkontableScrollbar() {
}
WalkontableScrollbar.prototype.init = function () {
var that = this;
//reference to instance
this.$table = $(this.instance.wtTable.TABLE);
//create elements
this.slider = document.createElement('DIV');
this.sliderStyle = this.slider.style;
this.sliderStyle.position = 'absolute';
this.sliderStyle.top = '0';
this.sliderStyle.left = '0';
this.sliderStyle.display = 'none';
this.slider.className = 'dragdealer ' + this.type;
this.handle = document.createElement('DIV');
this.handleStyle = this.handle.style;
this.handle.className = 'handle';
this.slider.appendChild(this.handle);
this.container = this.instance.wtTable.parent;
this.container.appendChild(this.slider);
var firstRun = true;
this.dragTimeout = null;
var dragDelta;
var dragRender = function () {
that.onScroll(dragDelta);
};
this.dragdealer = new Dragdealer(this.slider, {
vertical: (this.type === 'vertical'),
horizontal: (this.type === 'horizontal'),
slide: false,
speed: 100,
animationCallback: function (x, y) {
if (firstRun) {
firstRun = false;
return;
}
that.skipRefresh = true;
dragDelta = that.type === 'vertical' ? y : x;
if (that.dragTimeout === null) {
that.dragTimeout = setInterval(dragRender, 100);
dragRender();
}
},
callback: function (x, y) {
that.skipRefresh = false;
clearInterval(that.dragTimeout);
that.dragTimeout = null;
dragDelta = that.type === 'vertical' ? y : x;
that.onScroll(dragDelta);
}
});
this.skipRefresh = false;
};
WalkontableScrollbar.prototype.onScroll = function (delta) {
if (this.instance.drawn) {
this.readSettings();
if (this.total > this.visibleCount) {
var newOffset = Math.round(this.handlePosition * this.total / this.sliderSize);
if (delta === 1) {
if (this.type === 'vertical') {
this.instance.scrollVertical(Infinity).draw();
}
else {
this.instance.scrollHorizontal(Infinity).draw();
}
}
else if (newOffset !== this.offset) { //is new offset different than old offset
if (this.type === 'vertical') {
this.instance.scrollVertical(newOffset - this.offset).draw();
}
else {
this.instance.scrollHorizontal(newOffset - this.offset).draw();
}
}
else {
this.refresh();
}
}
}
};
/**
* Returns what part of the scroller should the handle take
* @param viewportCount {Number} number of visible rows or columns
* @param totalCount {Number} total number of rows or columns
* @return {Number} 0..1
*/
WalkontableScrollbar.prototype.getHandleSizeRatio = function (viewportCount, totalCount) {
if (!totalCount || viewportCount > totalCount) {
return 1;
}
return viewportCount / totalCount;
};
WalkontableScrollbar.prototype.prepare = function () {
if (this.skipRefresh) {
return;
}
var ratio = this.getHandleSizeRatio(this.visibleCount, this.total);
if (((ratio === 1 || isNaN(ratio)) && this.scrollMode === 'auto') || this.scrollMode === 'none') {
//isNaN is needed because ratio equals NaN when totalRows/totalColumns equals 0
this.visible = false;
}
else {
this.visible = true;
}
};
WalkontableScrollbar.prototype.refresh = function () {
if (this.skipRefresh) {
return;
}
else if (!this.visible) {
this.sliderStyle.display = 'none';
return;
}
var ratio
, sliderSize
, handleSize
, handlePosition
, visibleCount = this.visibleCount
, tableWidth = this.instance.wtViewport.getWorkspaceWidth()
, tableHeight = this.instance.wtViewport.getWorkspaceHeight();
if (tableWidth === Infinity) {
tableWidth = this.instance.wtViewport.getWorkspaceActualWidth();
}
if (tableHeight === Infinity) {
tableHeight = this.instance.wtViewport.getWorkspaceActualHeight();
}
if (this.type === 'vertical') {
if (this.instance.wtTable.rowStrategy.isLastIncomplete()) {
visibleCount--;
}
sliderSize = tableHeight - 2; //2 is sliders border-width
this.sliderStyle.top = this.instance.wtDom.offset(this.$table[0]).top - this.instance.wtDom.offset(this.container).top + 'px';
this.sliderStyle.left = tableWidth - 1 + 'px'; //1 is sliders border-width
this.sliderStyle.height = Math.max(sliderSize, 0) + 'px';
}
else { //horizontal
if (this.instance.wtTable.columnStrategy.isLastIncomplete()) {
visibleCount--;
}
sliderSize = tableWidth - 2; //2 is sliders border-width
this.sliderStyle.left = this.instance.wtDom.offset(this.$table[0]).left - this.instance.wtDom.offset(this.container).left + 'px';
this.sliderStyle.top = tableHeight - 1 + 'px'; //1 is sliders border-width
this.sliderStyle.width = Math.max(sliderSize, 0) + 'px';
}
ratio = this.getHandleSizeRatio(visibleCount, this.total);
handleSize = Math.round(sliderSize * ratio);
if (handleSize < 10) {
handleSize = 15;
}
handlePosition = Math.floor(sliderSize * (this.offset / this.total));
if (handleSize + handlePosition > sliderSize) {
handlePosition = sliderSize - handleSize;
}
if (this.type === 'vertical') {
this.handleStyle.height = handleSize + 'px';
this.handleStyle.top = handlePosition + 'px';
}
else { //horizontal
this.handleStyle.width = handleSize + 'px';
this.handleStyle.left = handlePosition + 'px';
}
this.sliderStyle.display = 'block';
};
///
var WalkontableVerticalScrollbar = function (instance) {
this.instance = instance;
this.type = 'vertical';
this.init();
};
WalkontableVerticalScrollbar.prototype = new WalkontableScrollbar();
WalkontableVerticalScrollbar.prototype.readSettings = function () {
this.scrollMode = this.instance.getSetting('scrollV');
this.offset = this.instance.getSetting('offsetRow');
this.total = this.instance.getSetting('totalRows');
this.visibleCount = this.instance.wtTable.rowStrategy.countVisible();
if(this.visibleCount > 1 && this.instance.wtTable.rowStrategy.isLastIncomplete()) {
this.visibleCount--;
}
this.handlePosition = parseInt(this.handleStyle.top, 10);
this.sliderSize = parseInt(this.sliderStyle.height, 10);
this.fixedCount = this.instance.getSetting('fixedRowsTop');
};
///
var WalkontableHorizontalScrollbar = function (instance) {
this.instance = instance;
this.type = 'horizontal';
this.init();
};
WalkontableHorizontalScrollbar.prototype = new WalkontableScrollbar();
WalkontableHorizontalScrollbar.prototype.readSettings = function () {
this.scrollMode = this.instance.getSetting('scrollH');
this.offset = this.instance.getSetting('offsetColumn');
this.total = this.instance.getSetting('totalColumns');
this.visibleCount = this.instance.wtTable.columnStrategy.countVisible();
if(this.visibleCount > 1 && this.instance.wtTable.columnStrategy.isLastIncomplete()) {
this.visibleCount--;
}
this.handlePosition = parseInt(this.handleStyle.left, 10);
this.sliderSize = parseInt(this.sliderStyle.width, 10);
this.fixedCount = this.instance.getSetting('fixedColumnsLeft');
};
function WalkontableScrollbarNative() {
}
WalkontableScrollbarNative.prototype.init = function () {
this.fixedContainer = this.instance.wtTable.TABLE.parentNode.parentNode.parentNode;
this.fixed = this.instance.wtTable.TABLE.parentNode.parentNode;
this.$scrollHandler = $(window);
//tableView.js
var that = this;
this.$scrollHandler.on('scroll', function () {
console.log("SCROLLED");
that.onScroll();
that.instance.draw();
});
};
WalkontableScrollbarNative.prototype.onScroll = function () {
this.tableParentOffset = this.instance.wtDom.offset(this.fixedContainer);
this.windowSize = this.$scrollHandler.height();
this.windowScrollPosition = $(window).scrollTop();
var totalRows = this.instance.getSetting('totalRows');
var offsetRow = this.instance.getSetting('offsetRow');
var scrollDelta;
var newOffset = 0;
if (this.windowScrollPosition > this.tableParentOffset.top) {
scrollDelta = this.windowScrollPosition - this.tableParentOffset.top;
// newOffset = parseInt(scrollDelta / 20, 10);
newOffset = Math.ceil(scrollDelta / 20, 10);
newOffset = Math.min(newOffset, totalRows)
}
else {
newOffset = 0;
}
this.instance.update('offsetRow', newOffset);
};
WalkontableScrollbarNative.prototype.prepare = function () {
};
WalkontableScrollbarNative.prototype.refresh = function () {
var totalRows = this.instance.getSetting('totalRows');
var offsetRow = this.instance.getSetting('offsetRow');
console.log('offsetRows', offsetRow);
console.log('$(this.fixedContainer).height()', this.instance.wtDom.outerHeight(this.fixed));
console.log('totalRows - offsetRow', totalRows - this.instance.wtTable.getLastVisibleRow() - 1);
this.fixedContainer.style.paddingBottom = this.instance.wtDom.outerHeight(this.fixed) + (totalRows - this.instance.wtTable.getLastVisibleRow() - 1) * 20 + 'px';
};
WalkontableScrollbarNative.prototype.calc = function () {
this.tableParentOffset = this.instance.wtDom.offset(this.fixedContainer);
this.windowSize = this.$scrollHandler.height();
this.windowScrollPosition = $(window).scrollTop();
var totalRows = this.instance.getSetting('totalRows');
var offsetRow = this.instance.getSetting('offsetRow');
this.availableSize = null;
if (this.windowScrollPosition > this.tableParentOffset.top) {
this.availableSize = this.windowSize;
this.fixed.style.position = 'fixed';
this.fixed.style.top = '0';
this.fixed.style.left = this.tableParentOffset.left;
}
else {
this.availableSize = this.windowSize - (this.tableParentOffset.top - this.windowScrollPosition);
this.fixed.style.position = 'relative';
}
console.log("offsetRow", offsetRow);
this.fixedContainer.style.paddingTop = offsetRow * 20 + 'px';
};
///
var WalkontableVerticalScrollbarNative = function (instance) {
this.instance = instance;
this.type = 'vertical';
this.init();
};
WalkontableVerticalScrollbarNative.prototype = new WalkontableScrollbarNative();
WalkontableVerticalScrollbarNative.prototype.readSettings = function () {
};
function WalkontableScrollbars(instance) {
this.vertical = new WalkontableVerticalScrollbar(instance);
this.horizontal = new WalkontableHorizontalScrollbar(instance);
}
WalkontableScrollbars.prototype.destroy = function () {
clearInterval(this.vertical.dragdealer.interval);
clearInterval(this.horizontal.dragdealer.interval);
};
WalkontableScrollbars.prototype.refresh = function () {
this.horizontal.readSettings();
this.vertical.readSettings();
this.horizontal.prepare();
this.vertical.prepare();
this.horizontal.refresh();
this.vertical.refresh();
};
function WalkontableSelection(instance, settings) {
this.instance = instance;
this.settings = settings;
this.selected = [];
if (settings.border) {
this.border = new WalkontableBorder(instance, settings);
}
}
WalkontableSelection.prototype.add = function (coords) {
this.selected.push(coords);
};
WalkontableSelection.prototype.clear = function () {
this.selected.length = 0; //http://jsperf.com/clear-arrayxxx
};
/**
* Returns the top left (TL) and bottom right (BR) selection coordinates
* @returns {Object}
*/
WalkontableSelection.prototype.getCorners = function () {
var minRow
, minColumn
, maxRow
, maxColumn
, i
, ilen = this.selected.length;
if (ilen > 0) {
minRow = maxRow = this.selected[0][0];
minColumn = maxColumn = this.selected[0][1];
if (ilen > 1) {
for (i = 1; i < ilen; i++) {
if (this.selected[i][0] < minRow) {
minRow = this.selected[i][0];
}
else if (this.selected[i][0] > maxRow) {
maxRow = this.selected[i][0];
}
if (this.selected[i][1] < minColumn) {
minColumn = this.selected[i][1];
}
else if (this.selected[i][1] > maxColumn) {
maxColumn = this.selected[i][1];
}
}
}
}
return [minRow, minColumn, maxRow, maxColumn];
};
WalkontableSelection.prototype.draw = function () {
var corners, r, c, source_r, source_c;
var visibleRows = this.instance.wtTable.rowStrategy.countVisible()
, visibleColumns = this.instance.wtTable.columnStrategy.countVisible();
if (this.selected.length) {
corners = this.getCorners();
for (r = 0; r < visibleRows; r++) {
for (c = 0; c < visibleColumns; c++) {
source_r = this.instance.wtTable.rowFilter.visibleToSource(r);
source_c = this.instance.wtTable.columnFilter.visibleToSource(c);
if (source_r >= corners[0] && source_r <= corners[2] && source_c >= corners[1] && source_c <= corners[3]) {
//selected cell
this.instance.wtTable.currentCellCache.add(r, c, this.settings.className);
}
else if (source_r >= corners[0] && source_r <= corners[2]) {
//selection is in this row
this.instance.wtTable.currentCellCache.add(r, c, this.settings.highlightRowClassName);
}
else if (source_c >= corners[1] && source_c <= corners[3]) {
//selection is in this column
this.instance.wtTable.currentCellCache.add(r, c, this.settings.highlightColumnClassName);
}
}
}
this.border && this.border.appear(corners); //warning! border.appear modifies corners!
}
else {
this.border && this.border.disappear();
}
};
function WalkontableSettings(instance, settings) {
var that = this;
this.instance = instance;
//default settings. void 0 means it is required, null means it can be empty
this.defaults = {
table: void 0,
//presentation mode
scrollH: 'auto', //values: scroll (always show scrollbar), auto (show scrollbar if table does not fit in the container), none (never show scrollbar)
scrollV: 'auto', //values: see above
stretchH: 'hybrid', //values: hybrid, all, last, none
currentRowClassName: null,
currentColumnClassName: null,
//data source
data: void 0,
offsetRow: 0,
offsetColumn: 0,
fixedColumnsLeft: 0,
fixedRowsTop: 0,
rowHeaders: [], //this must be array of functions: [function (row, TH) {}]
columnHeaders: [], //this must be array of functions: [function (column, TH) {}]
totalRows: void 0,
totalColumns: void 0,
width: null,
height: null,
cellRenderer: function (row, column, TD) {
var cellData = that.getSetting('data', row, column);
that.instance.wtDom.avoidInnerHTML(TD, cellData === void 0 || cellData === null ? '' : cellData);
},
columnWidth: 50,
selections: null,
//callbacks
onCellMouseDown: null,
onCellMouseOver: null,
onCellDblClick: null,
onCellCornerMouseDown: null,
onCellCornerDblClick: null,
beforeDraw: null,
onDraw: null,
//constants
scrollbarWidth: 10,
scrollbarHeight: 10
};
//reference to settings
this.settings = {};
for (var i in this.defaults) {
if (this.defaults.hasOwnProperty(i)) {
if (settings[i] !== void 0) {
this.settings[i] = settings[i];
}
else if (this.defaults[i] === void 0) {
throw new Error('A required setting "' + i + '" was not provided');
}
else {
this.settings[i] = this.defaults[i];
}
}
}
}
/**
* generic methods
*/
WalkontableSettings.prototype.update = function (settings, value) {
if (value === void 0) { //settings is object
for (var i in settings) {
if (settings.hasOwnProperty(i)) {
this.settings[i] = settings[i];
}
}
}
else { //if value is defined then settings is the key
this.settings[settings] = value;
}
return this.instance;
};
WalkontableSettings.prototype.getSetting = function (key, param1, param2, param3) {
if (this[key]) {
return this[key](param1, param2, param3);
}
else {
return this._getSetting(key, param1, param2, param3);
}
};
WalkontableSettings.prototype._getSetting = function (key, param1, param2, param3) {
if (typeof this.settings[key] === 'function') {
return this.settings[key](param1, param2, param3);
}
else if (param1 !== void 0 && Object.prototype.toString.call(this.settings[key]) === '[object Array]' && param1 !== void 0) {
return this.settings[key][param1];
}
else {
return this.settings[key];
}
};
WalkontableSettings.prototype.has = function (key) {
return !!this.settings[key]
};
/**
* specific methods
*/
WalkontableSettings.prototype.rowHeight = function (row) {
var visible_r = this.instance.wtTable.rowFilter.sourceToVisible(row);
var size = this.instance.wtTable.rowStrategy.getSize(visible_r);
if (size !== void 0) {
return size;
}
return 20;
};
WalkontableSettings.prototype.columnWidth = function (column) {
return Math.min(200, this._getSetting('columnWidth', column));
};
var FLAG_VISIBLE_HORIZONTAL = 0x1; // 000001
var FLAG_VISIBLE_VERTICAL = 0x2; // 000010
var FLAG_PARTIALLY_VISIBLE_HORIZONTAL = 0x4; // 000100
var FLAG_PARTIALLY_VISIBLE_VERTICAL = 0x8; // 001000
var FLAG_NOT_VISIBLE_HORIZONTAL = 0x10; // 010000
var FLAG_NOT_VISIBLE_VERTICAL = 0x20; // 100000
function WalkontableTable(instance) {
//reference to instance
this.instance = instance;
this.TABLE = this.instance.getSetting('table');
this.wtDom = this.instance.wtDom;
this.wtDom.removeTextNodes(this.TABLE);
this.hasEmptyCellProblem = ($.browser.msie && (parseInt($.browser.version, 10) <= 7));
this.hasCellSpacingProblem = ($.browser.msie && (parseInt($.browser.version, 10) <= 7));
if (this.hasCellSpacingProblem) { //IE7
this.TABLE.cellSpacing = 0;
}
//wtSpreader
var parent = this.TABLE.parentNode;
if (!parent || parent.nodeType !== 1 || !this.wtDom.hasClass(parent, 'wtHolder')) {
var spreader = document.createElement('DIV');
spreader.className = 'wtSpreader';
if (parent) {
parent.insertBefore(spreader, this.TABLE); //if TABLE is detached (e.g. in Jasmine test), it has no parentNode so we cannot attach holder to it
}
spreader.appendChild(this.TABLE);
}
this.spreader = this.TABLE.parentNode;
//wtHider
parent = this.spreader.parentNode;
if (!parent || parent.nodeType !== 1 || !this.wtDom.hasClass(parent, 'wtHolder')) {
var hider = document.createElement('DIV');
hider.className = 'wtHider';
if (parent) {
parent.insertBefore(hider, this.spreader); //if TABLE is detached (e.g. in Jasmine test), it has no parentNode so we cannot attach holder to it
}
hider.appendChild(this.spreader);
}
this.hider = this.spreader.parentNode;
this.hiderStyle = this.hider.style;
this.hiderStyle.position = 'relative';
//wtHolder
parent = this.hider.parentNode;
if (!parent || parent.nodeType !== 1 || !this.wtDom.hasClass(parent, 'wtHolder')) {
var holder = document.createElement('DIV');
holder.style.position = 'relative';
holder.className = 'wtHolder';
if (parent) {
parent.insertBefore(holder, this.hider); //if TABLE is detached (e.g. in Jasmine test), it has no parentNode so we cannot attach holder to it
}
holder.appendChild(this.hider);
}
this.parent = this.hider.parentNode;
//bootstrap from settings
this.TBODY = this.TABLE.getElementsByTagName('TBODY')[0];
if (!this.TBODY) {
this.TBODY = document.createElement('TBODY');
this.TABLE.appendChild(this.TBODY);
}
this.THEAD = this.TABLE.getElementsByTagName('THEAD')[0];
if (!this.THEAD) {
this.THEAD = document.createElement('THEAD');
this.TABLE.insertBefore(this.THEAD, this.TBODY);
}
this.COLGROUP = this.TABLE.getElementsByTagName('COLGROUP')[0];
if (!this.COLGROUP) {
this.COLGROUP = document.createElement('COLGROUP');
this.TABLE.insertBefore(this.COLGROUP, this.THEAD);
}
if (this.instance.getSetting('columnHeaders').length) {
if (!this.THEAD.childNodes.length) {
var TR = document.createElement('TR');
this.THEAD.appendChild(TR);
}
}
this.colgroupChildrenLength = this.COLGROUP.childNodes.length;
this.theadChildrenLength = this.THEAD.firstChild ? this.THEAD.firstChild.childNodes.length : 0;
this.tbodyChildrenLength = this.TBODY.childNodes.length;
this.oldCellCache = new WalkontableClassNameCache();
this.currentCellCache = new WalkontableClassNameCache();
this.rowFilter = new WalkontableRowFilter();
this.columnFilter = new WalkontableColumnFilter();
}
WalkontableTable.prototype.refreshHiderDimensions = function () {
var height = this.instance.wtViewport.getWorkspaceHeight();
var width = this.instance.wtViewport.getWorkspaceWidth();
var spreaderStyle = this.spreader.style;
if (height !== Infinity || width !== Infinity) {
this.hiderStyle.overflow = 'hidden';
spreaderStyle.position = 'absolute';
spreaderStyle.top = '0';
spreaderStyle.left = '0';
spreaderStyle.width = '4000px';
spreaderStyle.height = '4000px';
if (height === Infinity) {
height = this.instance.wtViewport.getWorkspaceActualHeight();
}
this.hiderStyle.height = height + 'px';
if (width === Infinity) {
width = this.instance.wtViewport.getWorkspaceActualWidth();
}
this.hiderStyle.width = width + 'px';
}
else {
spreaderStyle.position = 'relative';
spreaderStyle.width = 'auto';
spreaderStyle.height = 'auto';
}
};
WalkontableTable.prototype.refreshStretching = function () {
var instance = this.instance
, stretchH = instance.getSetting('stretchH')
, totalRows = instance.getSetting('totalRows')
, totalColumns = instance.getSetting('totalColumns')
, offsetColumn = instance.getSetting('offsetColumn');
var containerWidthFn = function (cacheWidth) {
return that.instance.wtViewport.getViewportWidth(cacheWidth);
};
var that = this;
var columnWidthFn = function (i) {
var source_c = that.columnFilter.visibleToSource(i);
if (source_c < totalColumns) {
return instance.getSetting('columnWidth', source_c);
}
};
if (stretchH === 'hybrid') {
if (offsetColumn > 0) {
stretchH = 'last';
}
else {
stretchH = 'none';
}
}
var containerHeightFn = function (cacheHeight) {
return that.instance.wtViewport.getViewportHeight(cacheHeight);
};
var rowHeightFn = function (i, TD) {
var source_r = that.rowFilter.visibleToSource(i);
if (source_r < totalRows) {
return that.wtDom.outerHeight(TD);
}
};
this.columnStrategy = new WalkontableColumnStrategy(containerWidthFn, columnWidthFn, stretchH);
this.rowStrategy = new WalkontableRowStrategy(containerHeightFn, rowHeightFn);
};
WalkontableTable.prototype.adjustAvailableNodes = function () {
var displayTds
, rowHeaders = this.instance.getSetting('rowHeaders')
, displayThs = rowHeaders.length
, columnHeaders = this.instance.getSetting('columnHeaders')
, TR
, TD
, c;
//adjust COLGROUP
while (this.colgroupChildrenLength < displayThs) {
this.COLGROUP.appendChild(document.createElement('COL'));
this.colgroupChildrenLength++;
}
this.refreshStretching();
displayTds = this.columnStrategy.cellCount;
//adjust COLGROUP
while (this.colgroupChildrenLength < displayTds + displayThs) {
this.COLGROUP.appendChild(document.createElement('COL'));
this.colgroupChildrenLength++;
}
while (this.colgroupChildrenLength > displayTds + displayThs) {
this.COLGROUP.removeChild(this.COLGROUP.lastChild);
this.colgroupChildrenLength--;
}
//adjust THEAD
if (columnHeaders.length) {
TR = this.THEAD.firstChild;
while (this.theadChildrenLength < displayTds + displayThs) {
TR.appendChild(document.createElement('TH'));
this.theadChildrenLength++;
}
while (this.theadChildrenLength > displayTds + displayThs) {
TR.removeChild(TR.lastChild);
this.theadChildrenLength--;
}
}
//draw COLGROUP
for (c = 0; c < this.colgroupChildrenLength; c++) {
if (c < displayThs) {
this.wtDom.addClass(this.COLGROUP.childNodes[c], 'rowHeader');
}
else {
this.wtDom.removeClass(this.COLGROUP.childNodes[c], 'rowHeader');
}
}
//draw THEAD
if (columnHeaders.length) {
TR = this.THEAD.firstChild;
if (displayThs) {
TD = TR.firstChild; //actually it is TH but let's reuse single variable
for (c = 0; c < displayThs; c++) {
rowHeaders[c](-displayThs + c, TD);
if (this.hasEmptyCellProblem) { //IE7
TD.innerHTML = '&nbsp;';
}
TD = TD.nextSibling;
}
}
}
for (c = 0; c < displayTds; c++) {
if (columnHeaders.length) {
columnHeaders[0](this.columnFilter.visibleToSource(c), TR.childNodes[displayThs + c]);
}
}
};
WalkontableTable.prototype.adjustColumns = function (TR, desiredCount) {
var count = TR.childNodes.length;
while (count < desiredCount) {
var TD = document.createElement('TD');
TR.appendChild(TD);
count++;
}
while (count > desiredCount) {
TR.removeChild(TR.lastChild);
count--;
}
};
WalkontableTable.prototype.draw = function (selectionsOnly) {
this.rowFilter.readSettings(this.instance);
this.columnFilter.readSettings(this.instance);
if (!selectionsOnly) {
this.tableOffset = this.wtDom.offset(this.TABLE);
this._doDraw();
}
else {
this.instance.wtScrollbars.refresh();
}
this.refreshPositions(selectionsOnly);
this.instance.drawn = true;
return this;
};
WalkontableTable.prototype._doDraw = function () {
var r = 0
, source_r
, c
, source_c
, totalRows = this.instance.getSetting('totalRows')
, totalColumns = this.instance.getSetting('totalColumns')
, displayTds
, rowHeaders = this.instance.getSetting('rowHeaders')
, displayThs = rowHeaders.length
, TR
, TD
, adjusted = false;
this.instance.wtViewport.resetSettings();
//draw TBODY
if (totalColumns > 0) {
source_r = this.rowFilter.visibleToSource(r);
while (source_r < totalRows) {
if (r >= this.tbodyChildrenLength) {
TR = document.createElement('TR');
for (c = 0; c < displayThs; c++) {
TR.appendChild(document.createElement('TH'));
}
this.TBODY.appendChild(TR);
this.tbodyChildrenLength++;
}
else if (r === 0) {
TR = this.TBODY.firstChild;
}
else {
TR = TR.nextSibling; //http://jsperf.com/nextsibling-vs-indexed-childnodes
}
//TH
TD = TR.firstChild;
for (c = 0; c < displayThs; c++) {
rowHeaders[c](source_r, TD); //actually TH
TD = TD.nextSibling; //http://jsperf.com/nextsibling-vs-indexed-childnodes
}
if (r === 0) {
this.adjustAvailableNodes();
adjusted = true;
displayTds = this.columnStrategy.cellCount
}
//TD
this.adjustColumns(TR, displayTds + displayThs);
for (c = 0; c < displayTds; c++) {
source_c = this.columnFilter.visibleToSource(c);
if (c === 0) {
TD = TR.childNodes[this.columnFilter.sourceColumnToVisibleRowHeadedColumn(source_c)];
}
else {
TD = TD.nextSibling; //http://jsperf.com/nextsibling-vs-indexed-childnodes
}
TD.className = '';
TD.removeAttribute('style');
this.instance.getSetting('cellRenderer', source_r, source_c, TD);
if (this.hasEmptyCellProblem && TD.innerHTML === '') { //IE7
TD.innerHTML = '&nbsp;';
}
}
//after last column is rendered, check if last cell is fully displayed
this.rowStrategy.add(r, TD);
if (this.rowStrategy.isLastIncomplete()) {
break;
}
r++;
source_r = this.rowFilter.visibleToSource(r);
}
}
if (!adjusted) {
this.adjustAvailableNodes();
}
this.instance.wtScrollbars.refresh();
this.columnStrategy.stretch();
for (c = 0; c < displayTds; c++) {
this.COLGROUP.childNodes[c + displayThs].style.width = this.columnStrategy.getSize(c) + 'px';
}
r = this.rowStrategy.countVisible();
while (this.tbodyChildrenLength > r) {
this.TBODY.removeChild(this.TBODY.lastChild);
this.tbodyChildrenLength--;
}
};
WalkontableTable.prototype.refreshPositions = function (selectionsOnly) {
this.refreshHiderDimensions();
this.refreshSelections(selectionsOnly);
};
WalkontableTable.prototype.refreshSelections = function (selectionsOnly) {
var vr
, r
, vc
, c
, s
, slen
, classNames = []
, visibleRows = this.rowStrategy.countVisible()
, visibleColumns = this.columnStrategy.countVisible();
this.oldCellCache = this.currentCellCache;
this.currentCellCache = new WalkontableClassNameCache();
if (this.instance.selections) {
for (r in this.instance.selections) {
if (this.instance.selections.hasOwnProperty(r)) {
this.instance.selections[r].draw();
if (this.instance.selections[r].settings.className) {
classNames.push(this.instance.selections[r].settings.className);
}
if (this.instance.selections[r].settings.highlightRowClassName) {
classNames.push(this.instance.selections[r].settings.highlightRowClassName);
}
if (this.instance.selections[r].settings.highlightColumnClassName) {
classNames.push(this.instance.selections[r].settings.highlightColumnClassName);
}
}
}
}
slen = classNames.length;
for (vr = 0; vr < visibleRows; vr++) {
for (vc = 0; vc < visibleColumns; vc++) {
r = this.rowFilter.visibleToSource(vr);
c = this.columnFilter.visibleToSource(vc);
for (s = 0; s < slen; s++) {
if (this.currentCellCache.test(vr, vc, classNames[s])) {
this.wtDom.addClass(this.getCell([r, c]), classNames[s]);
}
else if (selectionsOnly && this.oldCellCache.test(vr, vc, classNames[s])) {
this.wtDom.removeClass(this.getCell([r, c]), classNames[s]);
}
}
}
}
};
WalkontableTable.prototype.isCellVisible = function (r, c) {
var out = 0;
if (this.isRowInViewport(r)) {
if (this.getLastVisibleRow() === c && this.rowStrategy.remainingSize > 0) {
out |= FLAG_PARTIALLY_VISIBLE_VERTICAL;
}
else {
out |= FLAG_VISIBLE_VERTICAL;
}
}
else {
out |= FLAG_NOT_VISIBLE_VERTICAL;
}
if (this.isColumnInViewport(c)) {
if (this.getLastVisibleColumn() === c && this.columnStrategy.remainingSize > 0) {
out |= FLAG_PARTIALLY_VISIBLE_HORIZONTAL;
}
else {
out |= FLAG_VISIBLE_HORIZONTAL;
}
}
else {
out |= FLAG_NOT_VISIBLE_HORIZONTAL;
}
return out;
};
/**
* getCell
* @param {Array} coords
* @return {Object} HTMLElement on success or {Number} one of the exit codes on error:
* -1 row before viewport
* -2 row after viewport
* -3 column before viewport
* -4 column after viewport
*
*/
WalkontableTable.prototype.getCell = function (coords) {
if (this.isRowBeforeViewport(coords[0])) {
return -1; //row before viewport
}
else if (this.isRowAfterViewport(coords[0])) {
return -2; //row after viewport
}
else {
if (this.isColumnBeforeViewport(coords[1])) {
return -3; //column before viewport
}
else if (this.isColumnAfterViewport(coords[1])) {
return -4; //column after viewport
}
else {
return this.TBODY.childNodes[this.rowFilter.sourceToVisible(coords[0])].childNodes[this.columnFilter.sourceColumnToVisibleRowHeadedColumn(coords[1])];
}
}
};
WalkontableTable.prototype.getCoords = function (TD) {
return [
this.rowFilter.visibleToSource(this.wtDom.prevSiblings(TD.parentNode).length),
this.columnFilter.visibleRowHeadedColumnToSourceColumn(TD.cellIndex)
];
};
WalkontableTable.prototype.getLastVisibleRow = function () {
return this.rowFilter.visibleToSource(this.rowStrategy.cellCount - 1);
};
WalkontableTable.prototype.getLastVisibleColumn = function () {
return this.columnFilter.visibleToSource(this.columnStrategy.cellCount - 1);
};
WalkontableTable.prototype.isRowBeforeViewport = function (r) {
return (this.rowFilter.sourceToVisible(r) < this.rowFilter.fixedCount && r >= this.rowFilter.fixedCount);
};
WalkontableTable.prototype.isRowAfterViewport = function (r) {
return (r > this.getLastVisibleRow());
};
WalkontableTable.prototype.isColumnBeforeViewport = function (c) {
return (this.columnFilter.sourceToVisible(c) < this.columnFilter.fixedCount && c >= this.columnFilter.fixedCount);
};
WalkontableTable.prototype.isColumnAfterViewport = function (c) {
return (c > this.getLastVisibleColumn());
};
WalkontableTable.prototype.isRowInViewport = function (r) {
return (!this.isRowBeforeViewport(r) && !this.isRowAfterViewport(r));
};
WalkontableTable.prototype.isColumnInViewport = function (c) {
return (!this.isColumnBeforeViewport(c) && !this.isColumnAfterViewport(c));
};
function WalkontableViewport(instance) {
this.instance = instance;
this.resetSettings();
}
//used by scrollbar
WalkontableViewport.prototype.getWorkspaceHeight = function (proposedHeight) {
var height = this.instance.getSetting('height');
if (height === Infinity || height === void 0 || height === null || height < 1) {
return Infinity;
}
else if (proposedHeight > height) {
height -= this.instance.getSetting('scrollbarHeight');
}
else if (this.instance.wtScrollbars.horizontal.visible) {
height -= this.instance.getSetting('scrollbarHeight');
}
return height;
};
WalkontableViewport.prototype.getWorkspaceWidth = function (proposedWidth) {
var width = this.instance.getSetting('width');
if (width === Infinity || width === void 0 || width === null || width < 1) {
return Infinity;
}
else if (proposedWidth > width) {
width -= this.instance.getSetting('scrollbarWidth');
}
else if (this.instance.wtScrollbars.vertical.visible) {
width -= this.instance.getSetting('scrollbarWidth');
}
return width;
};
WalkontableViewport.prototype.getWorkspaceActualHeight = function () {
return this.instance.wtDom.outerHeight(this.instance.wtTable.TABLE);
};
WalkontableViewport.prototype.getWorkspaceActualWidth = function () {
return this.instance.wtDom.outerWidth(this.instance.wtTable.TABLE) || this.instance.wtDom.outerWidth(this.instance.wtTable.TBODY) || this.instance.wtDom.outerWidth(this.instance.wtTable.THEAD); //IE8 reports 0 as <table> offsetWidth;
};
WalkontableViewport.prototype.getViewportHeight = function (proposedHeight) {
var containerHeight = this.getWorkspaceHeight(proposedHeight);
if (containerHeight === Infinity) {
return containerHeight;
}
if (isNaN(this.columnHeaderHeight)) {
var cellOffset = this.instance.wtDom.offset(this.instance.wtTable.TBODY)
, tableOffset = this.instance.wtTable.tableOffset;
this.columnHeaderHeight = cellOffset.top - tableOffset.top;
}
if (this.columnHeaderHeight > 0) {
return containerHeight - this.columnHeaderHeight;
}
else {
return containerHeight;
}
};
WalkontableViewport.prototype.getViewportWidth = function (proposedWidth) {
var containerWidth = this.getWorkspaceWidth(proposedWidth);
if (containerWidth === Infinity) {
return containerWidth;
}
if (isNaN(this.rowHeaderWidth)) {
var TR = this.instance.wtTable.TBODY ? this.instance.wtTable.TBODY.firstChild : null;
if (TR) {
var TD = TR.firstChild;
this.rowHeaderWidth = 0;
while (TD && TD.nodeName === 'TH') {
this.rowHeaderWidth += this.instance.wtDom.outerWidth(TD);
TD = TD.nextSibling;
}
}
}
if (this.rowHeaderWidth > 0) {
return containerWidth - this.rowHeaderWidth;
}
else {
return containerWidth;
}
};
WalkontableViewport.prototype.resetSettings = function () {
this.rowHeaderWidth = NaN;
this.columnHeaderHeight = NaN;
};
function WalkontableWheel(instance) {
var that = this;
//reference to instance
this.instance = instance;
$(this.instance.wtTable.TABLE).on('mousewheel', function (event, delta, deltaX, deltaY) {
clearTimeout(that.instance.wheelTimeout);
that.instance.wheelTimeout = setTimeout(function () { //timeout is needed because with fast-wheel scrolling mousewheel event comes dozen times per second
if (deltaY) {
//ceil is needed because jquery-mousewheel reports fractional mousewheel deltas on touchpad scroll
//see http://stackoverflow.com/questions/5527601/normalizing-mousewheel-speed-across-browsers
if (that.instance.wtScrollbars.vertical.visible) { // if we see scrollbar
that.instance.scrollVertical(-Math.ceil(deltaY)).draw();
}
}
else if (deltaX) {
if (that.instance.wtScrollbars.horizontal.visible) { // if we see scrollbar
that.instance.scrollHorizontal(Math.ceil(deltaX)).draw();
}
}
}, 0);
event.preventDefault();
});
}
/**
* Dragdealer JS v0.9.5 - patched by Walkontable at lines 66, 309-310, 339-340
* http://code.ovidiu.ch/dragdealer-js
*
* Copyright (c) 2010, Ovidiu Chereches
* MIT License
* http://legal.ovidiu.ch/licenses/MIT
*/
/* Cursor */
var Cursor =
{
x: 0, y: 0,
init: function()
{
this.setEvent('mouse');
this.setEvent('touch');
},
setEvent: function(type)
{
var moveHandler = document['on' + type + 'move'] || function(){};
document['on' + type + 'move'] = function(e)
{
moveHandler(e);
Cursor.refresh(e);
}
},
refresh: function(e)
{
if(!e)
{
e = window.event;
}
if(e.type == 'mousemove')
{
this.set(e);
}
else if(e.touches)
{
this.set(e.touches[0]);
}
},
set: function(e)
{
if(e.pageX || e.pageY)
{
this.x = e.pageX;
this.y = e.pageY;
}
else if(e.clientX || e.clientY)
{
this.x = e.clientX + document.body.scrollLeft + document.documentElement.scrollLeft;
this.y = e.clientY + document.body.scrollTop + document.documentElement.scrollTop;
}
}
};
Cursor.init();
/* Position */
var Position =
{
get: function(obj)
{
var curtop = 0, curleft = 0; //Walkontable patch. Original (var curleft = curtop = 0;) created curtop in global scope
if(obj.offsetParent)
{
do
{
curleft += obj.offsetLeft;
curtop += obj.offsetTop;
}
while((obj = obj.offsetParent));
}
return [curleft, curtop];
}
};
/* Dragdealer */
var Dragdealer = function(wrapper, options)
{
if(typeof(wrapper) == 'string')
{
wrapper = document.getElementById(wrapper);
}
if(!wrapper)
{
return;
}
var handle = wrapper.getElementsByTagName('div')[0];
if(!handle || handle.className.search(/(^|\s)handle(\s|$)/) == -1)
{
return;
}
this.init(wrapper, handle, options || {});
this.setup();
};
Dragdealer.prototype =
{
init: function(wrapper, handle, options)
{
this.wrapper = wrapper;
this.handle = handle;
this.options = options;
this.disabled = this.getOption('disabled', false);
this.horizontal = this.getOption('horizontal', true);
this.vertical = this.getOption('vertical', false);
this.slide = this.getOption('slide', true);
this.steps = this.getOption('steps', 0);
this.snap = this.getOption('snap', false);
this.loose = this.getOption('loose', false);
this.speed = this.getOption('speed', 10) / 100;
this.xPrecision = this.getOption('xPrecision', 0);
this.yPrecision = this.getOption('yPrecision', 0);
this.callback = options.callback || null;
this.animationCallback = options.animationCallback || null;
this.bounds = {
left: options.left || 0, right: -(options.right || 0),
top: options.top || 0, bottom: -(options.bottom || 0),
x0: 0, x1: 0, xRange: 0,
y0: 0, y1: 0, yRange: 0
};
this.value = {
prev: [-1, -1],
current: [options.x || 0, options.y || 0],
target: [options.x || 0, options.y || 0]
};
this.offset = {
wrapper: [0, 0],
mouse: [0, 0],
prev: [-999999, -999999],
current: [0, 0],
target: [0, 0]
};
this.change = [0, 0];
this.activity = false;
this.dragging = false;
this.tapping = false;
},
getOption: function(name, defaultValue)
{
return this.options[name] !== undefined ? this.options[name] : defaultValue;
},
setup: function()
{
this.setWrapperOffset();
this.setBoundsPadding();
this.setBounds();
this.setSteps();
this.addListeners();
},
setWrapperOffset: function()
{
this.offset.wrapper = Position.get(this.wrapper);
},
setBoundsPadding: function()
{
if(!this.bounds.left && !this.bounds.right)
{
this.bounds.left = Position.get(this.handle)[0] - this.offset.wrapper[0];
this.bounds.right = -this.bounds.left;
}
if(!this.bounds.top && !this.bounds.bottom)
{
this.bounds.top = Position.get(this.handle)[1] - this.offset.wrapper[1];
this.bounds.bottom = -this.bounds.top;
}
},
setBounds: function()
{
this.bounds.x0 = this.bounds.left;
this.bounds.x1 = this.wrapper.offsetWidth + this.bounds.right;
this.bounds.xRange = (this.bounds.x1 - this.bounds.x0) - this.handle.offsetWidth;
this.bounds.y0 = this.bounds.top;
this.bounds.y1 = this.wrapper.offsetHeight + this.bounds.bottom;
this.bounds.yRange = (this.bounds.y1 - this.bounds.y0) - this.handle.offsetHeight;
this.bounds.xStep = 1 / (this.xPrecision || Math.max(this.wrapper.offsetWidth, this.handle.offsetWidth));
this.bounds.yStep = 1 / (this.yPrecision || Math.max(this.wrapper.offsetHeight, this.handle.offsetHeight));
},
setSteps: function()
{
if(this.steps > 1)
{
this.stepRatios = [];
for(var i = 0; i <= this.steps - 1; i++)
{
this.stepRatios[i] = i / (this.steps - 1);
}
}
},
addListeners: function()
{
var self = this;
this.wrapper.onselectstart = function()
{
return false;
}
this.handle.onmousedown = this.handle.ontouchstart = function(e)
{
self.handleDownHandler(e);
};
this.wrapper.onmousedown = this.wrapper.ontouchstart = function(e)
{
self.wrapperDownHandler(e);
};
var mouseUpHandler = document.onmouseup || function(){};
document.onmouseup = function(e)
{
mouseUpHandler(e);
self.documentUpHandler(e);
};
var touchEndHandler = document.ontouchend || function(){};
document.ontouchend = function(e)
{
touchEndHandler(e);
self.documentUpHandler(e);
};
var resizeHandler = window.onresize || function(){};
window.onresize = function(e)
{
resizeHandler(e);
self.documentResizeHandler(e);
};
this.wrapper.onmousemove = function(e)
{
self.activity = true;
}
this.wrapper.onclick = function(e)
{
return !self.activity;
}
this.interval = setInterval(function(){ self.animate() }, 25);
self.animate(false, true);
},
handleDownHandler: function(e)
{
this.activity = false;
Cursor.refresh(e);
this.preventDefaults(e, true);
this.startDrag();
this.cancelEvent(e);
},
wrapperDownHandler: function(e)
{
Cursor.refresh(e);
this.preventDefaults(e, true);
this.startTap();
},
documentUpHandler: function(e)
{
this.stopDrag();
this.stopTap();
//this.cancelEvent(e);
},
documentResizeHandler: function(e)
{
this.setWrapperOffset();
this.setBounds();
this.update();
},
enable: function()
{
this.disabled = false;
this.handle.className = this.handle.className.replace(/\s?disabled/g, '');
},
disable: function()
{
this.disabled = true;
this.handle.className += ' disabled';
},
setStep: function(x, y, snap)
{
this.setValue(
this.steps && x > 1 ? (x - 1) / (this.steps - 1) : 0,
this.steps && y > 1 ? (y - 1) / (this.steps - 1) : 0,
snap
);
},
setValue: function(x, y, snap)
{
this.setTargetValue([x, y || 0]);
if(snap)
{
this.groupCopy(this.value.current, this.value.target);
}
},
startTap: function(target)
{
if(this.disabled)
{
return;
}
this.tapping = true;
this.setWrapperOffset();
this.setBounds();
if(target === undefined)
{
target = [
Cursor.x - this.offset.wrapper[0] - (this.handle.offsetWidth / 2),
Cursor.y - this.offset.wrapper[1] - (this.handle.offsetHeight / 2)
];
}
this.setTargetOffset(target);
},
stopTap: function()
{
if(this.disabled || !this.tapping)
{
return;
}
this.tapping = false;
this.setTargetValue(this.value.current);
this.result();
},
startDrag: function()
{
if(this.disabled)
{
return;
}
this.setWrapperOffset();
this.setBounds();
this.offset.mouse = [
Cursor.x - Position.get(this.handle)[0],
Cursor.y - Position.get(this.handle)[1]
];
this.dragging = true;
},
stopDrag: function()
{
if(this.disabled || !this.dragging)
{
return;
}
this.dragging = false;
var target = this.groupClone(this.value.current);
if(this.slide)
{
var ratioChange = this.change;
target[0] += ratioChange[0] * 4;
target[1] += ratioChange[1] * 4;
}
this.setTargetValue(target);
this.result();
},
feedback: function()
{
var value = this.value.current;
if(this.snap && this.steps > 1)
{
value = this.getClosestSteps(value);
}
if(!this.groupCompare(value, this.value.prev))
{
if(typeof(this.animationCallback) == 'function')
{
this.animationCallback(value[0], value[1]);
}
this.groupCopy(this.value.prev, value);
}
},
result: function()
{
if(typeof(this.callback) == 'function')
{
this.callback(this.value.target[0], this.value.target[1]);
}
},
animate: function(direct, first)
{
if(direct && !this.dragging)
{
return;
}
if(this.dragging)
{
var prevTarget = this.groupClone(this.value.target);
var offset = [
Cursor.x - this.offset.wrapper[0] - this.offset.mouse[0],
Cursor.y - this.offset.wrapper[1] - this.offset.mouse[1]
];
this.setTargetOffset(offset, this.loose);
this.change = [
this.value.target[0] - prevTarget[0],
this.value.target[1] - prevTarget[1]
];
}
if(this.dragging || first)
{
this.groupCopy(this.value.current, this.value.target);
}
if(this.dragging || this.glide() || first)
{
this.update();
this.feedback();
}
},
glide: function()
{
var diff = [
this.value.target[0] - this.value.current[0],
this.value.target[1] - this.value.current[1]
];
if(!diff[0] && !diff[1])
{
return false;
}
if(Math.abs(diff[0]) > this.bounds.xStep || Math.abs(diff[1]) > this.bounds.yStep)
{
this.value.current[0] += diff[0] * this.speed;
this.value.current[1] += diff[1] * this.speed;
}
else
{
this.groupCopy(this.value.current, this.value.target);
}
return true;
},
update: function()
{
if(!this.snap)
{
this.offset.current = this.getOffsetsByRatios(this.value.current);
}
else
{
this.offset.current = this.getOffsetsByRatios(
this.getClosestSteps(this.value.current)
);
}
this.show();
},
show: function()
{
if(!this.groupCompare(this.offset.current, this.offset.prev))
{
if(this.horizontal)
{
this.handle.style.left = String(this.offset.current[0]) + 'px';
}
if(this.vertical)
{
this.handle.style.top = String(this.offset.current[1]) + 'px';
}
this.groupCopy(this.offset.prev, this.offset.current);
}
},
setTargetValue: function(value, loose)
{
var target = loose ? this.getLooseValue(value) : this.getProperValue(value);
this.groupCopy(this.value.target, target);
this.offset.target = this.getOffsetsByRatios(target);
},
setTargetOffset: function(offset, loose)
{
var value = this.getRatiosByOffsets(offset);
var target = loose ? this.getLooseValue(value) : this.getProperValue(value);
this.groupCopy(this.value.target, target);
this.offset.target = this.getOffsetsByRatios(target);
},
getLooseValue: function(value)
{
var proper = this.getProperValue(value);
return [
proper[0] + ((value[0] - proper[0]) / 4),
proper[1] + ((value[1] - proper[1]) / 4)
];
},
getProperValue: function(value)
{
var proper = this.groupClone(value);
proper[0] = Math.max(proper[0], 0);
proper[1] = Math.max(proper[1], 0);
proper[0] = Math.min(proper[0], 1);
proper[1] = Math.min(proper[1], 1);
if((!this.dragging && !this.tapping) || this.snap)
{
if(this.steps > 1)
{
proper = this.getClosestSteps(proper);
}
}
return proper;
},
getRatiosByOffsets: function(group)
{
return [
this.getRatioByOffset(group[0], this.bounds.xRange, this.bounds.x0),
this.getRatioByOffset(group[1], this.bounds.yRange, this.bounds.y0)
];
},
getRatioByOffset: function(offset, range, padding)
{
return range ? (offset - padding) / range : 0;
},
getOffsetsByRatios: function(group)
{
return [
this.getOffsetByRatio(group[0], this.bounds.xRange, this.bounds.x0),
this.getOffsetByRatio(group[1], this.bounds.yRange, this.bounds.y0)
];
},
getOffsetByRatio: function(ratio, range, padding)
{
return Math.round(ratio * range) + padding;
},
getClosestSteps: function(group)
{
return [
this.getClosestStep(group[0]),
this.getClosestStep(group[1])
];
},
getClosestStep: function(value)
{
var k = 0;
var min = 1;
for(var i = 0; i <= this.steps - 1; i++)
{
if(Math.abs(this.stepRatios[i] - value) < min)
{
min = Math.abs(this.stepRatios[i] - value);
k = i;
}
}
return this.stepRatios[k];
},
groupCompare: function(a, b)
{
return a[0] == b[0] && a[1] == b[1];
},
groupCopy: function(a, b)
{
a[0] = b[0];
a[1] = b[1];
},
groupClone: function(a)
{
return [a[0], a[1]];
},
preventDefaults: function(e, selection)
{
if(!e)
{
e = window.event;
}
if(e.preventDefault)
{
e.preventDefault();
}
e.returnValue = false;
if(selection && document.selection)
{
document.selection.empty();
}
},
cancelEvent: function(e)
{
if(!e)
{
e = window.event;
}
if(e.stopPropagation)
{
e.stopPropagation();
}
e.cancelBubble = true;
}
};
/**
* jQuery.browser shim that makes Walkontable working with jQuery 1.9+
*/
if (!jQuery.browser) {
(function () {
var matched, browser;
/*
* Copyright 2011, John Resig
* Dual licensed under the MIT or GPL Version 2 licenses.
* http://jquery.org/license
*/
jQuery.uaMatch = function (ua) {
ua = ua.toLowerCase();
var match = /(chrome)[ \/]([\w.]+)/.exec(ua) ||
/(webkit)[ \/]([\w.]+)/.exec(ua) ||
/(opera)(?:.*version|)[ \/]([\w.]+)/.exec(ua) ||
/(msie) ([\w.]+)/.exec(ua) ||
ua.indexOf("compatible") < 0 && /(mozilla)(?:.*? rv:([\w.]+)|)/.exec(ua) ||
[];
return {
browser: match[ 1 ] || "",
version: match[ 2 ] || "0"
};
};
matched = jQuery.uaMatch(navigator.userAgent);
browser = {};
if (matched.browser) {
browser[ matched.browser ] = true;
browser.version = matched.version;
}
// Chrome is Webkit, but Webkit is also Safari.
if (browser.chrome) {
browser.webkit = true;
}
else if (browser.webkit) {
browser.safari = true;
}
jQuery.browser = browser;
})();
}
/*! Copyright (c) 2011 Brandon Aaron (http://brandonaaron.net)
* Licensed under the MIT License (LICENSE.txt).
*
* Thanks to: http://adomas.org/javascript-mouse-wheel/ for some pointers.
* Thanks to: Mathias Bank(http://www.mathias-bank.de) for a scope bug fix.
* Thanks to: Seamus Leahy for adding deltaX and deltaY
*
* Version: 3.0.6
*
* Requires: 1.2.2+
*/
(function($) {
var types = ['DOMMouseScroll', 'mousewheel'];
if ($.event.fixHooks) {
for ( var i=types.length; i; ) {
$.event.fixHooks[ types[--i] ] = $.event.mouseHooks;
}
}
$.event.special.mousewheel = {
setup: function() {
if ( this.addEventListener ) {
for ( var i=types.length; i; ) {
this.addEventListener( types[--i], handler, false );
}
} else {
this.onmousewheel = handler;
}
},
teardown: function() {
if ( this.removeEventListener ) {
for ( var i=types.length; i; ) {
this.removeEventListener( types[--i], handler, false );
}
} else {
this.onmousewheel = null;
}
}
};
$.fn.extend({
mousewheel: function(fn) {
return fn ? this.bind("mousewheel", fn) : this.trigger("mousewheel");
},
unmousewheel: function(fn) {
return this.unbind("mousewheel", fn);
}
});
function handler(event) {
var orgEvent = event || window.event, args = [].slice.call( arguments, 1 ), delta = 0, returnValue = true, deltaX = 0, deltaY = 0;
event = $.event.fix(orgEvent);
event.type = "mousewheel";
// Old school scrollwheel delta
if ( orgEvent.wheelDelta ) { delta = orgEvent.wheelDelta/120; }
if ( orgEvent.detail ) { delta = -orgEvent.detail/3; }
// New school multidimensional scroll (touchpads) deltas
deltaY = delta;
// Gecko
if ( orgEvent.axis !== undefined && orgEvent.axis === orgEvent.HORIZONTAL_AXIS ) {
deltaY = 0;
deltaX = -1*delta;
}
// Webkit
if ( orgEvent.wheelDeltaY !== undefined ) { deltaY = orgEvent.wheelDeltaY/120; }
if ( orgEvent.wheelDeltaX !== undefined ) { deltaX = -1*orgEvent.wheelDeltaX/120; }
// Add event and delta to the front of the arguments
args.unshift(event, delta, deltaX, deltaY);
return ($.event.dispatch || $.event.handle).apply(this, args);
}
})(jQuery);
})(jQuery, window, Handsontable);
/* =============================================================
* bootstrap-typeahead.js v2.3.1
* http://twitter.github.com/bootstrap/javascript.html#typeahead
* =============================================================
* Copyright 2012 Twitter, Inc.
*
* Licensed under the Apache License, Version 2.0 (the "License");
* you may not use this file except in compliance with the License.
* You may obtain a copy of the License at
*
* http://www.apache.org/licenses/LICENSE-2.0
*
* Unless required by applicable law or agreed to in writing, software
* distributed under the License is distributed on an "AS IS" BASIS,
* WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
* See the License for the specific language governing permissions and
* limitations under the License.
* ============================================================ */
!function($){
"use strict"; // jshint ;_;
/* TYPEAHEAD PUBLIC CLASS DEFINITION
* ================================= */
var Typeahead = function (element, options) {
this.$element = $(element)
this.options = $.extend({}, $.fn.typeahead.defaults, options)
this.matcher = this.options.matcher || this.matcher
this.sorter = this.options.sorter || this.sorter
this.highlighter = this.options.highlighter || this.highlighter
this.updater = this.options.updater || this.updater
this.source = this.options.source
this.$menu = $(this.options.menu)
this.shown = false
this.listen()
}
Typeahead.prototype = {
constructor: Typeahead
, select: function () {
var val = this.$menu.find('.active').attr('data-value')
this.$element
.val(this.updater(val))
.change()
return this.hide()
}
, updater: function (item) {
return item
}
, show: function () {
var pos = $.extend({}, this.$element.position(), {
height: this.$element[0].offsetHeight
})
this.$menu
.insertAfter(this.$element)
.css({
top: pos.top + pos.height
, left: pos.left
})
.show()
this.shown = true
return this
}
, hide: function () {
this.$menu.hide()
this.shown = false
return this
}
, lookup: function (event) {
var items
this.query = this.$element.val()
if (!this.query || this.query.length < this.options.minLength) {
return this.shown ? this.hide() : this
}
items = $.isFunction(this.source) ? this.source(this.query, $.proxy(this.process, this)) : this.source
return items ? this.process(items) : this
}
, process: function (items) {
var that = this
items = $.grep(items, function (item) {
return that.matcher(item)
})
items = this.sorter(items)
if (!items.length) {
return this.shown ? this.hide() : this
}
return this.render(items.slice(0, this.options.items)).show()
}
, matcher: function (item) {
return ~item.toLowerCase().indexOf(this.query.toLowerCase())
}
, sorter: function (items) {
var beginswith = []
, caseSensitive = []
, caseInsensitive = []
, item
while (item = items.shift()) {
if (!item.toLowerCase().indexOf(this.query.toLowerCase())) beginswith.push(item)
else if (~item.indexOf(this.query)) caseSensitive.push(item)
else caseInsensitive.push(item)
}
return beginswith.concat(caseSensitive, caseInsensitive)
}
, highlighter: function (item) {
var query = this.query.replace(/[\-\[\]{}()*+?.,\\\^$|#\s]/g, '\\$&')
return item.replace(new RegExp('(' + query + ')', 'ig'), function ($1, match) {
return '<strong>' + match + '</strong>'
})
}
, render: function (items) {
var that = this
items = $(items).map(function (i, item) {
i = $(that.options.item).attr('data-value', item)
i.find('a').html(that.highlighter(item))
return i[0]
})
items.first().addClass('active')
this.$menu.html(items)
return this
}
, next: function (event) {
var active = this.$menu.find('.active').removeClass('active')
, next = active.next()
if (!next.length) {
next = $(this.$menu.find('li')[0])
}
next.addClass('active')
}
, prev: function (event) {
var active = this.$menu.find('.active').removeClass('active')
, prev = active.prev()
if (!prev.length) {
prev = this.$menu.find('li').last()
}
prev.addClass('active')
}
, listen: function () {
this.$element
.on('focus', $.proxy(this.focus, this))
.on('blur', $.proxy(this.blur, this))
.on('keypress', $.proxy(this.keypress, this))
.on('keyup', $.proxy(this.keyup, this))
if (this.eventSupported('keydown')) {
this.$element.on('keydown', $.proxy(this.keydown, this))
}
this.$menu
.on('click', $.proxy(this.click, this))
.on('mouseenter', 'li', $.proxy(this.mouseenter, this))
.on('mouseleave', 'li', $.proxy(this.mouseleave, this))
}
, eventSupported: function(eventName) {
var isSupported = eventName in this.$element
if (!isSupported) {
this.$element.setAttribute(eventName, 'return;')
isSupported = typeof this.$element[eventName] === 'function'
}
return isSupported
}
, move: function (e) {
if (!this.shown) return
switch(e.keyCode) {
case 9: // tab
case 13: // enter
case 27: // escape
e.preventDefault()
break
case 38: // up arrow
e.preventDefault()
this.prev()
break
case 40: // down arrow
e.preventDefault()
this.next()
break
}
e.stopPropagation()
}
, keydown: function (e) {
this.suppressKeyPressRepeat = ~$.inArray(e.keyCode, [40,38,9,13,27])
this.move(e)
}
, keypress: function (e) {
if (this.suppressKeyPressRepeat) return
this.move(e)
}
, keyup: function (e) {
switch(e.keyCode) {
case 40: // down arrow
case 38: // up arrow
case 16: // shift
case 17: // ctrl
case 18: // alt
break
case 9: // tab
case 13: // enter
if (!this.shown) return
this.select()
break
case 27: // escape
if (!this.shown) return
this.hide()
break
default:
this.lookup()
}
e.stopPropagation()
e.preventDefault()
}
, focus: function (e) {
this.focused = true
}
, blur: function (e) {
this.focused = false
if (!this.mousedover && this.shown) this.hide()
}
, click: function (e) {
e.stopPropagation()
e.preventDefault()
this.select()
this.$element.focus()
}
, mouseenter: function (e) {
this.mousedover = true
this.$menu.find('.active').removeClass('active')
$(e.currentTarget).addClass('active')
}
, mouseleave: function (e) {
this.mousedover = false
if (!this.focused && this.shown) this.hide()
}
}
/* TYPEAHEAD PLUGIN DEFINITION
* =========================== */
var old = $.fn.typeahead
$.fn.typeahead = function (option) {
return this.each(function () {
var $this = $(this)
, data = $this.data('typeahead')
, options = typeof option == 'object' && option
if (!data) $this.data('typeahead', (data = new Typeahead(this, options)))
if (typeof option == 'string') data[option]()
})
}
$.fn.typeahead.defaults = {
source: []
, items: 8
, menu: '<ul class="typeahead dropdown-menu"></ul>'
, item: '<li><a href="#"></a></li>'
, minLength: 1
}
$.fn.typeahead.Constructor = Typeahead
/* TYPEAHEAD NO CONFLICT
* =================== */
$.fn.typeahead.noConflict = function () {
$.fn.typeahead = old
return this
}
/* TYPEAHEAD DATA-API
* ================== */
$(document).on('focus.typeahead.data-api', '[data-provide="typeahead"]', function (e) {
var $this = $(this)
if ($this.data('typeahead')) return
$this.typeahead($this.data())
})
}(window.jQuery);
// numeral.js
// version : 1.4.7
// author : Adam Draper
// license : MIT
// http://adamwdraper.github.com/Numeral-js/
(function () {
/************************************
Constants
************************************/
var numeral,
VERSION = '1.4.7',
// internal storage for language config files
languages = {},
currentLanguage = 'en',
zeroFormat = null,
// check for nodeJS
hasModule = (typeof module !== 'undefined' && module.exports);
/************************************
Constructors
************************************/
// Numeral prototype object
function Numeral (number) {
this._n = number;
}
/**
* Implementation of toFixed() that treats floats more like decimals
*
* Fixes binary rounding issues (eg. (0.615).toFixed(2) === '0.61') that present
* problems for accounting- and finance-related software.
*/
function toFixed (value, precision, optionals) {
var power = Math.pow(10, precision),
output;
// Multiply up by precision, round accurately, then divide and use native toFixed():
output = (Math.round(value * power) / power).toFixed(precision);
if (optionals) {
var optionalsRegExp = new RegExp('0{1,' + optionals + '}$');
output = output.replace(optionalsRegExp, '');
}
return output;
}
/************************************
Formatting
************************************/
// determine what type of formatting we need to do
function formatNumeral (n, format) {
var output;
// figure out what kind of format we are dealing with
if (format.indexOf('$') > -1) { // currency!!!!!
output = formatCurrency(n, format);
} else if (format.indexOf('%') > -1) { // percentage
output = formatPercentage(n, format);
} else if (format.indexOf(':') > -1) { // time
output = formatTime(n, format);
} else { // plain ol' numbers or bytes
output = formatNumber(n, format);
}
// return string
return output;
}
// revert to number
function unformatNumeral (n, string) {
if (string.indexOf(':') > -1) {
n._n = unformatTime(string);
} else {
if (string === zeroFormat) {
n._n = 0;
} else {
var stringOriginal = string;
if (languages[currentLanguage].delimiters.decimal !== '.') {
string = string.replace(/\./g,'').replace(languages[currentLanguage].delimiters.decimal, '.');
}
// see if abbreviations are there so that we can multiply to the correct number
var thousandRegExp = new RegExp(languages[currentLanguage].abbreviations.thousand + '(?:\\)|(\\' + languages[currentLanguage].currency.symbol + ')?(?:\\))?)?$'),
millionRegExp = new RegExp(languages[currentLanguage].abbreviations.million + '(?:\\)|(\\' + languages[currentLanguage].currency.symbol + ')?(?:\\))?)?$'),
billionRegExp = new RegExp(languages[currentLanguage].abbreviations.billion + '(?:\\)|(\\' + languages[currentLanguage].currency.symbol + ')?(?:\\))?)?$'),
trillionRegExp = new RegExp(languages[currentLanguage].abbreviations.trillion + '(?:\\)|(\\' + languages[currentLanguage].currency.symbol + ')?(?:\\))?)?$');
// see if bytes are there so that we can multiply to the correct number
var prefixes = ['KB', 'MB', 'GB', 'TB', 'PB', 'EB', 'ZB', 'YB'],
bytesMultiplier = false;
for (var power = 0; power <= prefixes.length; power++) {
bytesMultiplier = (string.indexOf(prefixes[power]) > -1) ? Math.pow(1024, power + 1) : false;
if (bytesMultiplier) {
break;
}
}
// do some math to create our number
n._n = ((bytesMultiplier) ? bytesMultiplier : 1) * ((stringOriginal.match(thousandRegExp)) ? Math.pow(10, 3) : 1) * ((stringOriginal.match(millionRegExp)) ? Math.pow(10, 6) : 1) * ((stringOriginal.match(billionRegExp)) ? Math.pow(10, 9) : 1) * ((stringOriginal.match(trillionRegExp)) ? Math.pow(10, 12) : 1) * ((string.indexOf('%') > -1) ? 0.01 : 1) * Number(((string.indexOf('(') > -1) ? '-' : '') + string.replace(/[^0-9\.-]+/g, ''));
// round if we are talking about bytes
n._n = (bytesMultiplier) ? Math.ceil(n._n) : n._n;
}
}
return n._n;
}
function formatCurrency (n, format) {
var prependSymbol = (format.indexOf('$') <= 1) ? true : false;
// remove $ for the moment
var space = '';
// check for space before or after currency
if (format.indexOf(' $') > -1) {
space = ' ';
format = format.replace(' $', '');
} else if (format.indexOf('$ ') > -1) {
space = ' ';
format = format.replace('$ ', '');
} else {
format = format.replace('$', '');
}
// format the number
var output = formatNumeral(n, format);
// position the symbol
if (prependSymbol) {
if (output.indexOf('(') > -1 || output.indexOf('-') > -1) {
output = output.split('');
output.splice(1, 0, languages[currentLanguage].currency.symbol + space);
output = output.join('');
} else {
output = languages[currentLanguage].currency.symbol + space + output;
}
} else {
if (output.indexOf(')') > -1) {
output = output.split('');
output.splice(-1, 0, space + languages[currentLanguage].currency.symbol);
output = output.join('');
} else {
output = output + space + languages[currentLanguage].currency.symbol;
}
}
return output;
}
function formatPercentage (n, format) {
var space = '';
// check for space before %
if (format.indexOf(' %') > -1) {
space = ' ';
format = format.replace(' %', '');
} else {
format = format.replace('%', '');
}
n._n = n._n * 100;
var output = formatNumeral(n, format);
if (output.indexOf(')') > -1 ) {
output = output.split('');
output.splice(-1, 0, space + '%');
output = output.join('');
} else {
output = output + space + '%';
}
return output;
}
function formatTime (n, format) {
var hours = Math.floor(n._n/60/60),
minutes = Math.floor((n._n - (hours * 60 * 60))/60),
seconds = Math.round(n._n - (hours * 60 * 60) - (minutes * 60));
return hours + ':' + ((minutes < 10) ? '0' + minutes : minutes) + ':' + ((seconds < 10) ? '0' + seconds : seconds);
}
function unformatTime (string) {
var timeArray = string.split(':'),
seconds = 0;
// turn hours and minutes into seconds and add them all up
if (timeArray.length === 3) {
// hours
seconds = seconds + (Number(timeArray[0]) * 60 * 60);
// minutes
seconds = seconds + (Number(timeArray[1]) * 60);
// seconds
seconds = seconds + Number(timeArray[2]);
} else if (timeArray.lenght === 2) {
// minutes
seconds = seconds + (Number(timeArray[0]) * 60);
// seconds
seconds = seconds + Number(timeArray[1]);
}
return Number(seconds);
}
function formatNumber (n, format) {
var negP = false,
optDec = false,
abbr = '',
bytes = '',
ord = '',
abs = Math.abs(n._n);
// check if number is zero and a custom zero format has been set
if (n._n === 0 && zeroFormat !== null) {
return zeroFormat;
} else {
// see if we should use parentheses for negative number
if (format.indexOf('(') > -1) {
negP = true;
format = format.slice(1, -1);
}
// see if abbreviation is wanted
if (format.indexOf('a') > -1) {
// check for space before abbreviation
if (format.indexOf(' a') > -1) {
abbr = ' ';
format = format.replace(' a', '');
} else {
format = format.replace('a', '');
}
if (abs >= Math.pow(10, 12)) {
// trillion
abbr = abbr + languages[currentLanguage].abbreviations.trillion;
n._n = n._n / Math.pow(10, 12);
} else if (abs < Math.pow(10, 12) && abs >= Math.pow(10, 9)) {
// billion
abbr = abbr + languages[currentLanguage].abbreviations.billion;
n._n = n._n / Math.pow(10, 9);
} else if (abs < Math.pow(10, 9) && abs >= Math.pow(10, 6)) {
// million
abbr = abbr + languages[currentLanguage].abbreviations.million;
n._n = n._n / Math.pow(10, 6);
} else if (abs < Math.pow(10, 6) && abs >= Math.pow(10, 3)) {
// thousand
abbr = abbr + languages[currentLanguage].abbreviations.thousand;
n._n = n._n / Math.pow(10, 3);
}
}
// see if we are formatting bytes
if (format.indexOf('b') > -1) {
// check for space before
if (format.indexOf(' b') > -1) {
bytes = ' ';
format = format.replace(' b', '');
} else {
format = format.replace('b', '');
}
var prefixes = ['B', 'KB', 'MB', 'GB', 'TB', 'PB', 'EB', 'ZB', 'YB'],
min,
max;
for (var power = 0; power <= prefixes.length; power++) {
min = Math.pow(1024, power);
max = Math.pow(1024, power+1);
if (n._n >= min && n._n < max) {
bytes = bytes + prefixes[power];
if (min > 0) {
n._n = n._n / min;
}
break;
}
}
}
// see if ordinal is wanted
if (format.indexOf('o') > -1) {
// check for space before
if (format.indexOf(' o') > -1) {
ord = ' ';
format = format.replace(' o', '');
} else {
format = format.replace('o', '');
}
ord = ord + languages[currentLanguage].ordinal(n._n);
}
if (format.indexOf('[.]') > -1) {
optDec = true;
format = format.replace('[.]', '.');
}
var w = n._n.toString().split('.')[0],
precision = format.split('.')[1],
thousands = format.indexOf(','),
d = '',
neg = false;
if (precision) {
if (precision.indexOf('[') > -1) {
precision = precision.replace(']', '');
precision = precision.split('[');
d = toFixed(n._n, (precision[0].length + precision[1].length), precision[1].length);
} else {
d = toFixed(n._n, precision.length);
}
w = d.split('.')[0];
if (d.split('.')[1].length) {
d = languages[currentLanguage].delimiters.decimal + d.split('.')[1];
} else {
d = '';
}
if (optDec && Number(d) === 0) {
d = '';
}
} else {
w = toFixed(n._n, null);
}
// format number
if (w.indexOf('-') > -1) {
w = w.slice(1);
neg = true;
}
if (thousands > -1) {
w = w.toString().replace(/(\d)(?=(\d{3})+(?!\d))/g, '$1' + languages[currentLanguage].delimiters.thousands);
}
if (format.indexOf('.') === 0) {
w = '';
}
return ((negP && neg) ? '(' : '') + ((!negP && neg) ? '-' : '') + w + d + ((ord) ? ord : '') + ((abbr) ? abbr : '') + ((bytes) ? bytes : '') + ((negP && neg) ? ')' : '');
}
}
/************************************
Top Level Functions
************************************/
numeral = function (input) {
if (numeral.isNumeral(input)) {
input = input.value();
} else if (!Number(input)) {
input = 0;
}
return new Numeral(Number(input));
};
// version number
numeral.version = VERSION;
// compare numeral object
numeral.isNumeral = function (obj) {
return obj instanceof Numeral;
};
// This function will load languages and then set the global language. If
// no arguments are passed in, it will simply return the current global
// language key.
numeral.language = function (key, values) {
if (!key) {
return currentLanguage;
}
if (key && !values) {
currentLanguage = key;
}
if (values || !languages[key]) {
loadLanguage(key, values);
}
return numeral;
};
numeral.language('en', {
delimiters: {
thousands: ',',
decimal: '.'
},
abbreviations: {
thousand: 'k',
million: 'm',
billion: 'b',
trillion: 't'
},
ordinal: function (number) {
var b = number % 10;
return (~~ (number % 100 / 10) === 1) ? 'th' :
(b === 1) ? 'st' :
(b === 2) ? 'nd' :
(b === 3) ? 'rd' : 'th';
},
currency: {
symbol: '$'
}
});
numeral.zeroFormat = function (format) {
if (typeof(format) === 'string') {
zeroFormat = format;
} else {
zeroFormat = null;
}
};
/************************************
Helpers
************************************/
function loadLanguage(key, values) {
languages[key] = values;
}
/************************************
Numeral Prototype
************************************/
numeral.fn = Numeral.prototype = {
clone : function () {
return numeral(this);
},
format : function (inputString) {
return formatNumeral(this, inputString ? inputString : numeral.defaultFormat);
},
unformat : function (inputString) {
return unformatNumeral(this, inputString ? inputString : numeral.defaultFormat);
},
value : function () {
return this._n;
},
valueOf : function () {
return this._n;
},
set : function (value) {
this._n = Number(value);
return this;
},
add : function (value) {
this._n = this._n + Number(value);
return this;
},
subtract : function (value) {
this._n = this._n - Number(value);
return this;
},
multiply : function (value) {
this._n = this._n * Number(value);
return this;
},
divide : function (value) {
this._n = this._n / Number(value);
return this;
},
difference : function (value) {
var difference = this._n - Number(value);
if (difference < 0) {
difference = -difference;
}
return difference;
}
};
/************************************
Exposing Numeral
************************************/
// CommonJS module is defined
if (hasModule) {
module.exports = numeral;
}
/*global ender:false */
if (typeof ender === 'undefined') {
// here, `this` means `window` in the browser, or `global` on the server
// add `numeral` as a global object via a string identifier,
// for Closure Compiler 'advanced' mode
this['numeral'] = numeral;
}
/*global define:false */
if (typeof define === 'function' && define.amd) {
define([], function () {
return numeral;
});
}
}).call(this);
/*!
* jQuery contextMenu - Plugin for simple contextMenu handling
*
* Version: 1.5.25
*
* Authors: Rodney Rehm, Addy Osmani (patches for FF)
* Web: http://medialize.github.com/jQuery-contextMenu/
*
* Licensed under
* MIT License http://www.opensource.org/licenses/mit-license
* GPL v3 http://opensource.org/licenses/GPL-3.0
*
*/
(function($, undefined){
// TODO: -
// ARIA stuff: menuitem, menuitemcheckbox und menuitemradio
// create <menu> structure if $.support[htmlCommand || htmlMenuitem] and !opt.disableNative
// determine html5 compatibility
$.support.htmlMenuitem = ('HTMLMenuItemElement' in window);
$.support.htmlCommand = ('HTMLCommandElement' in window);
$.support.eventSelectstart = ("onselectstart" in document.documentElement);
/* // should the need arise, test for css user-select
$.support.cssUserSelect = (function(){
var t = false,
e = document.createElement('div');
$.each('Moz|Webkit|Khtml|O|ms|Icab|'.split('|'), function(i, prefix) {
var propCC = prefix + (prefix ? 'U' : 'u') + 'serSelect',
prop = (prefix ? ('-' + prefix.toLowerCase() + '-') : '') + 'user-select';
e.style.cssText = prop + ': text;';
if (e.style[propCC] == 'text') {
t = true;
return false;
}
return true;
});
return t;
})();
*/
var // currently active contextMenu trigger
$currentTrigger = null,
// is contextMenu initialized with at least one menu?
initialized = false,
// window handle
$win = $(window),
// number of registered menus
counter = 0,
// mapping selector to namespace
namespaces = {},
// mapping namespace to options
menus = {},
// custom command type handlers
types = {},
// default values
defaults = {
// selector of contextMenu trigger
selector: null,
// where to append the menu to
appendTo: null,
// method to trigger context menu ["right", "left", "hover"]
trigger: "right",
// hide menu when mouse leaves trigger / menu elements
autoHide: false,
// ms to wait before showing a hover-triggered context menu
delay: 200,
// determine position to show menu at
determinePosition: function($menu) {
// position to the lower middle of the trigger element
if ($.ui && $.ui.position) {
// .position() is provided as a jQuery UI utility
// (...and it won't work on hidden elements)
$menu.css('display', 'block').position({
my: "center top",
at: "center bottom",
of: this,
offset: "0 5",
collision: "fit"
}).css('display', 'none');
} else {
// determine contextMenu position
var offset = this.offset();
offset.top += this.outerHeight();
offset.left += this.outerWidth() / 2 - $menu.outerWidth() / 2;
$menu.css(offset);
}
},
// position menu
position: function(opt, x, y) {
var $this = this,
offset;
// determine contextMenu position
if (!x && !y) {
opt.determinePosition.call(this, opt.$menu);
return;
} else if (x === "maintain" && y === "maintain") {
// x and y must not be changed (after re-show on command click)
offset = opt.$menu.position();
} else {
// x and y are given (by mouse event)
var triggerIsFixed = opt.$trigger.parents().andSelf()
.filter(function() {
return $(this).css('position') == "fixed";
}).length;
if (triggerIsFixed) {
y -= $win.scrollTop();
x -= $win.scrollLeft();
}
offset = {top: y, left: x};
}
// correct offset if viewport demands it
var bottom = $win.scrollTop() + $win.height(),
right = $win.scrollLeft() + $win.width(),
height = opt.$menu.height(),
width = opt.$menu.width();
if (offset.top + height > bottom) {
offset.top -= height;
}
if (offset.left + width > right) {
offset.left -= width;
}
opt.$menu.css(offset);
},
// position the sub-menu
positionSubmenu: function($menu) {
if ($.ui && $.ui.position) {
// .position() is provided as a jQuery UI utility
// (...and it won't work on hidden elements)
$menu.css('display', 'block').position({
my: "left top",
at: "right top",
of: this,
collision: "fit"
}).css('display', '');
} else {
// determine contextMenu position
var offset = {
top: 0,
left: this.outerWidth()
};
$menu.css(offset);
}
},
// offset to add to zIndex
zIndex: 1,
// show hide animation settings
animation: {
duration: 50,
show: 'slideDown',
hide: 'slideUp'
},
// events
events: {
show: $.noop,
hide: $.noop
},
// default callback
callback: null,
// list of contextMenu items
items: {}
},
// mouse position for hover activation
hoveract = {
timer: null,
pageX: null,
pageY: null
},
// determine zIndex
zindex = function($t) {
var zin = 0,
$tt = $t;
while (true) {
zin = Math.max(zin, parseInt($tt.css('z-index'), 10) || 0);
$tt = $tt.parent();
if (!$tt || !$tt.length || "html body".indexOf($tt.prop('nodeName').toLowerCase()) > -1 ) {
break;
}
}
return zin;
},
// event handlers
handle = {
// abort anything
abortevent: function(e){
e.preventDefault();
e.stopImmediatePropagation();
},
// contextmenu show dispatcher
contextmenu: function(e) {
var $this = $(this);
// disable actual context-menu
e.preventDefault();
e.stopImmediatePropagation();
// abort native-triggered events unless we're triggering on right click
if (e.data.trigger != 'right' && e.originalEvent) {
return;
}
if (!$this.hasClass('context-menu-disabled')) {
// theoretically need to fire a show event at <menu>
// http://www.whatwg.org/specs/web-apps/current-work/multipage/interactive-elements.html#context-menus
// var evt = jQuery.Event("show", { data: data, pageX: e.pageX, pageY: e.pageY, relatedTarget: this });
// e.data.$menu.trigger(evt);
$currentTrigger = $this;
if (e.data.build) {
var built = e.data.build($currentTrigger, e);
// abort if build() returned false
if (built === false) {
return;
}
// dynamically build menu on invocation
e.data = $.extend(true, {}, defaults, e.data, built || {});
// abort if there are no items to display
if (!e.data.items || $.isEmptyObject(e.data.items)) {
// Note: jQuery captures and ignores errors from event handlers
if (window.console) {
(console.error || console.log)("No items specified to show in contextMenu");
}
throw new Error('No Items sepcified');
}
// backreference for custom command type creation
e.data.$trigger = $currentTrigger;
op.create(e.data);
}
// show menu
op.show.call($this, e.data, e.pageX, e.pageY);
}
},
// contextMenu left-click trigger
click: function(e) {
e.preventDefault();
e.stopImmediatePropagation();
$(this).trigger($.Event("contextmenu", { data: e.data, pageX: e.pageX, pageY: e.pageY }));
},
// contextMenu right-click trigger
mousedown: function(e) {
// register mouse down
var $this = $(this);
// hide any previous menus
if ($currentTrigger && $currentTrigger.length && !$currentTrigger.is($this)) {
$currentTrigger.data('contextMenu').$menu.trigger('contextmenu:hide');
}
// activate on right click
if (e.button == 2) {
$currentTrigger = $this.data('contextMenuActive', true);
}
},
// contextMenu right-click trigger
mouseup: function(e) {
// show menu
var $this = $(this);
if ($this.data('contextMenuActive') && $currentTrigger && $currentTrigger.length && $currentTrigger.is($this) && !$this.hasClass('context-menu-disabled')) {
e.preventDefault();
e.stopImmediatePropagation();
$currentTrigger = $this;
$this.trigger($.Event("contextmenu", { data: e.data, pageX: e.pageX, pageY: e.pageY }));
}
$this.removeData('contextMenuActive');
},
// contextMenu hover trigger
mouseenter: function(e) {
var $this = $(this),
$related = $(e.relatedTarget),
$document = $(document);
// abort if we're coming from a menu
if ($related.is('.context-menu-list') || $related.closest('.context-menu-list').length) {
return;
}
// abort if a menu is shown
if ($currentTrigger && $currentTrigger.length) {
return;
}
hoveract.pageX = e.pageX;
hoveract.pageY = e.pageY;
hoveract.data = e.data;
$document.on('mousemove.contextMenuShow', handle.mousemove);
hoveract.timer = setTimeout(function() {
hoveract.timer = null;
$document.off('mousemove.contextMenuShow');
$currentTrigger = $this;
$this.trigger($.Event("contextmenu", { data: hoveract.data, pageX: hoveract.pageX, pageY: hoveract.pageY }));
}, e.data.delay );
},
// contextMenu hover trigger
mousemove: function(e) {
hoveract.pageX = e.pageX;
hoveract.pageY = e.pageY;
},
// contextMenu hover trigger
mouseleave: function(e) {
// abort if we're leaving for a menu
var $related = $(e.relatedTarget);
if ($related.is('.context-menu-list') || $related.closest('.context-menu-list').length) {
return;
}
try {
clearTimeout(hoveract.timer);
} catch(e) {}
hoveract.timer = null;
},
// click on layer to hide contextMenu
layerClick: function(e) {
var $this = $(this),
root = $this.data('contextMenuRoot'),
mouseup = false,
button = e.button,
x = e.pageX,
y = e.pageY,
target,
offset,
selectors;
e.preventDefault();
e.stopImmediatePropagation();
// This hack looks about as ugly as it is
// Firefox 12 (at least) fires the contextmenu event directly "after" mousedown
// for some reason `root.$layer.hide(); document.elementFromPoint()` causes this
// contextmenu event to be triggered on the uncovered element instead of on the
// layer (where every other sane browser, including Firefox nightly at the time)
// triggers the event. This workaround might be obsolete by September 2012.
$this.on('mouseup', function() {
mouseup = true;
});
setTimeout(function() {
var $window, hideshow;
// test if we need to reposition the menu
if ((root.trigger == 'left' && button == 0) || (root.trigger == 'right' && button == 2)) {
if (document.elementFromPoint) {
root.$layer.hide();
target = document.elementFromPoint(x - $win.scrollLeft(), y - $win.scrollTop());
root.$layer.show();
selectors = [];
for (var s in namespaces) {
selectors.push(s);
}
target = $(target).closest(selectors.join(', '));
if (target.length) {
if (target.is(root.$trigger[0])) {
root.position.call(root.$trigger, root, x, y);
return;
}
}
} else {
offset = root.$trigger.offset();
$window = $(window);
// while this looks kinda awful, it's the best way to avoid
// unnecessarily calculating any positions
offset.top += $window.scrollTop();
if (offset.top <= e.pageY) {
offset.left += $window.scrollLeft();
if (offset.left <= e.pageX) {
offset.bottom = offset.top + root.$trigger.outerHeight();
if (offset.bottom >= e.pageY) {
offset.right = offset.left + root.$trigger.outerWidth();
if (offset.right >= e.pageX) {
// reposition
root.position.call(root.$trigger, root, x, y);
return;
}
}
}
}
}
}
hideshow = function(e) {
if (e) {
e.preventDefault();
e.stopImmediatePropagation();
}
root.$menu.trigger('contextmenu:hide');
if (target && target.length) {
setTimeout(function() {
target.contextMenu({x: x, y: y});
}, 50);
}
};
if (mouseup) {
// mouseup has already happened
hideshow();
} else {
// remove only after mouseup has completed
$this.on('mouseup', hideshow);
}
}, 50);
},
// key handled :hover
keyStop: function(e, opt) {
if (!opt.isInput) {
e.preventDefault();
}
e.stopPropagation();
},
key: function(e) {
var opt = $currentTrigger.data('contextMenu') || {},
$children = opt.$menu.children(),
$round;
switch (e.keyCode) {
case 9:
case 38: // up
handle.keyStop(e, opt);
// if keyCode is [38 (up)] or [9 (tab) with shift]
if (opt.isInput) {
if (e.keyCode == 9 && e.shiftKey) {
e.preventDefault();
opt.$selected && opt.$selected.find('input, textarea, select').blur();
opt.$menu.trigger('prevcommand');
return;
} else if (e.keyCode == 38 && opt.$selected.find('input, textarea, select').prop('type') == 'checkbox') {
// checkboxes don't capture this key
e.preventDefault();
return;
}
} else if (e.keyCode != 9 || e.shiftKey) {
opt.$menu.trigger('prevcommand');
return;
}
// omitting break;
// case 9: // tab - reached through omitted break;
case 40: // down
handle.keyStop(e, opt);
if (opt.isInput) {
if (e.keyCode == 9) {
e.preventDefault();
opt.$selected && opt.$selected.find('input, textarea, select').blur();
opt.$menu.trigger('nextcommand');
return;
} else if (e.keyCode == 40 && opt.$selected.find('input, textarea, select').prop('type') == 'checkbox') {
// checkboxes don't capture this key
e.preventDefault();
return;
}
} else {
opt.$menu.trigger('nextcommand');
return;
}
break;
case 37: // left
handle.keyStop(e, opt);
if (opt.isInput || !opt.$selected || !opt.$selected.length) {
break;
}
if (!opt.$selected.parent().hasClass('context-menu-root')) {
var $parent = opt.$selected.parent().parent();
opt.$selected.trigger('contextmenu:blur');
opt.$selected = $parent;
return;
}
break;
case 39: // right
handle.keyStop(e, opt);
if (opt.isInput || !opt.$selected || !opt.$selected.length) {
break;
}
var itemdata = opt.$selected.data('contextMenu') || {};
if (itemdata.$menu && opt.$selected.hasClass('context-menu-submenu')) {
opt.$selected = null;
itemdata.$selected = null;
itemdata.$menu.trigger('nextcommand');
return;
}
break;
case 35: // end
case 36: // home
if (opt.$selected && opt.$selected.find('input, textarea, select').length) {
return;
} else {
(opt.$selected && opt.$selected.parent() || opt.$menu)
.children(':not(.disabled, .not-selectable)')[e.keyCode == 36 ? 'first' : 'last']()
.trigger('contextmenu:focus');
e.preventDefault();
return;
}
break;
case 13: // enter
handle.keyStop(e, opt);
if (opt.isInput) {
if (opt.$selected && !opt.$selected.is('textarea, select')) {
e.preventDefault();
return;
}
break;
}
opt.$selected && opt.$selected.trigger('mouseup');
return;
case 32: // space
case 33: // page up
case 34: // page down
// prevent browser from scrolling down while menu is visible
handle.keyStop(e, opt);
return;
case 27: // esc
handle.keyStop(e, opt);
opt.$menu.trigger('contextmenu:hide');
return;
default: // 0-9, a-z
var k = (String.fromCharCode(e.keyCode)).toUpperCase();
if (opt.accesskeys[k]) {
// according to the specs accesskeys must be invoked immediately
opt.accesskeys[k].$node.trigger(opt.accesskeys[k].$menu
? 'contextmenu:focus'
: 'mouseup'
);
return;
}
break;
}
// pass event to selected item,
// stop propagation to avoid endless recursion
e.stopPropagation();
opt.$selected && opt.$selected.trigger(e);
},
// select previous possible command in menu
prevItem: function(e) {
e.stopPropagation();
var opt = $(this).data('contextMenu') || {};
// obtain currently selected menu
if (opt.$selected) {
var $s = opt.$selected;
opt = opt.$selected.parent().data('contextMenu') || {};
opt.$selected = $s;
}
var $children = opt.$menu.children(),
$prev = !opt.$selected || !opt.$selected.prev().length ? $children.last() : opt.$selected.prev(),
$round = $prev;
// skip disabled
while ($prev.hasClass('disabled') || $prev.hasClass('not-selectable')) {
if ($prev.prev().length) {
$prev = $prev.prev();
} else {
$prev = $children.last();
}
if ($prev.is($round)) {
// break endless loop
return;
}
}
// leave current
if (opt.$selected) {
handle.itemMouseleave.call(opt.$selected.get(0), e);
}
// activate next
handle.itemMouseenter.call($prev.get(0), e);
// focus input
var $input = $prev.find('input, textarea, select');
if ($input.length) {
$input.focus();
}
},
// select next possible command in menu
nextItem: function(e) {
e.stopPropagation();
var opt = $(this).data('contextMenu') || {};
// obtain currently selected menu
if (opt.$selected) {
var $s = opt.$selected;
opt = opt.$selected.parent().data('contextMenu') || {};
opt.$selected = $s;
}
var $children = opt.$menu.children(),
$next = !opt.$selected || !opt.$selected.next().length ? $children.first() : opt.$selected.next(),
$round = $next;
// skip disabled
while ($next.hasClass('disabled') || $next.hasClass('not-selectable')) {
if ($next.next().length) {
$next = $next.next();
} else {
$next = $children.first();
}
if ($next.is($round)) {
// break endless loop
return;
}
}
// leave current
if (opt.$selected) {
handle.itemMouseleave.call(opt.$selected.get(0), e);
}
// activate next
handle.itemMouseenter.call($next.get(0), e);
// focus input
var $input = $next.find('input, textarea, select');
if ($input.length) {
$input.focus();
}
},
// flag that we're inside an input so the key handler can act accordingly
focusInput: function(e) {
var $this = $(this).closest('.context-menu-item'),
data = $this.data(),
opt = data.contextMenu,
root = data.contextMenuRoot;
root.$selected = opt.$selected = $this;
root.isInput = opt.isInput = true;
},
// flag that we're inside an input so the key handler can act accordingly
blurInput: function(e) {
var $this = $(this).closest('.context-menu-item'),
data = $this.data(),
opt = data.contextMenu,
root = data.contextMenuRoot;
root.isInput = opt.isInput = false;
},
// :hover on menu
menuMouseenter: function(e) {
var root = $(this).data().contextMenuRoot;
root.hovering = true;
},
// :hover on menu
menuMouseleave: function(e) {
var root = $(this).data().contextMenuRoot;
if (root.$layer && root.$layer.is(e.relatedTarget)) {
root.hovering = false;
}
},
// :hover done manually so key handling is possible
itemMouseenter: function(e) {
var $this = $(this),
data = $this.data(),
opt = data.contextMenu,
root = data.contextMenuRoot;
root.hovering = true;
// abort if we're re-entering
if (e && root.$layer && root.$layer.is(e.relatedTarget)) {
e.preventDefault();
e.stopImmediatePropagation();
}
// make sure only one item is selected
(opt.$menu ? opt : root).$menu
.children('.hover').trigger('contextmenu:blur');
if ($this.hasClass('disabled') || $this.hasClass('not-selectable')) {
opt.$selected = null;
return;
}
$this.trigger('contextmenu:focus');
},
// :hover done manually so key handling is possible
itemMouseleave: function(e) {
var $this = $(this),
data = $this.data(),
opt = data.contextMenu,
root = data.contextMenuRoot;
if (root !== opt && root.$layer && root.$layer.is(e.relatedTarget)) {
root.$selected && root.$selected.trigger('contextmenu:blur');
e.preventDefault();
e.stopImmediatePropagation();
root.$selected = opt.$selected = opt.$node;
return;
}
$this.trigger('contextmenu:blur');
},
// contextMenu item click
itemClick: function(e) {
var $this = $(this),
data = $this.data(),
opt = data.contextMenu,
root = data.contextMenuRoot,
key = data.contextMenuKey,
callback;
// abort if the key is unknown or disabled or is a menu
if (!opt.items[key] || $this.hasClass('disabled') || $this.hasClass('context-menu-submenu')) {
return;
}
e.preventDefault();
e.stopImmediatePropagation();
if ($.isFunction(root.callbacks[key])) {
// item-specific callback
callback = root.callbacks[key];
} else if ($.isFunction(root.callback)) {
// default callback
callback = root.callback;
} else {
// no callback, no action
return;
}
// hide menu if callback doesn't stop that
if (callback.call(root.$trigger, key, root) !== false) {
root.$menu.trigger('contextmenu:hide');
} else if (root.$menu.parent().length) {
op.update.call(root.$trigger, root);
}
},
// ignore click events on input elements
inputClick: function(e) {
e.stopImmediatePropagation();
},
// hide <menu>
hideMenu: function(e, data) {
var root = $(this).data('contextMenuRoot');
op.hide.call(root.$trigger, root, data && data.force);
},
// focus <command>
focusItem: function(e) {
e.stopPropagation();
var $this = $(this),
data = $this.data(),
opt = data.contextMenu,
root = data.contextMenuRoot;
$this.addClass('hover')
.siblings('.hover').trigger('contextmenu:blur');
// remember selected
opt.$selected = root.$selected = $this;
// position sub-menu - do after show so dumb $.ui.position can keep up
if (opt.$node) {
root.positionSubmenu.call(opt.$node, opt.$menu);
}
},
// blur <command>
blurItem: function(e) {
e.stopPropagation();
var $this = $(this),
data = $this.data(),
opt = data.contextMenu,
root = data.contextMenuRoot;
$this.removeClass('hover');
opt.$selected = null;
}
},
// operations
op = {
show: function(opt, x, y) {
var $this = $(this),
offset,
css = {};
// hide any open menus
$('#context-menu-layer').trigger('mousedown');
// backreference for callbacks
opt.$trigger = $this;
// show event
if (opt.events.show.call($this, opt) === false) {
$currentTrigger = null;
return;
}
// create or update context menu
op.update.call($this, opt);
// position menu
opt.position.call($this, opt, x, y);
// make sure we're in front
if (opt.zIndex) {
css.zIndex = zindex($this) + opt.zIndex;
}
// add layer
op.layer.call(opt.$menu, opt, css.zIndex);
// adjust sub-menu zIndexes
opt.$menu.find('ul').css('zIndex', css.zIndex + 1);
// position and show context menu
opt.$menu.css( css )[opt.animation.show](opt.animation.duration);
// make options available
$this.data('contextMenu', opt);
// register key handler
$(document).off('keydown.contextMenu').on('keydown.contextMenu', handle.key);
// register autoHide handler
if (opt.autoHide) {
// trigger element coordinates
var pos = $this.position();
pos.right = pos.left + $this.outerWidth();
pos.bottom = pos.top + this.outerHeight();
// mouse position handler
$(document).on('mousemove.contextMenuAutoHide', function(e) {
if (opt.$layer && !opt.hovering && (!(e.pageX >= pos.left && e.pageX <= pos.right) || !(e.pageY >= pos.top && e.pageY <= pos.bottom))) {
// if mouse in menu...
opt.$menu.trigger('contextmenu:hide');
}
});
}
},
hide: function(opt, force) {
var $this = $(this);
if (!opt) {
opt = $this.data('contextMenu') || {};
}
// hide event
if (!force && opt.events && opt.events.hide.call($this, opt) === false) {
return;
}
if (opt.$layer) {
// keep layer for a bit so the contextmenu event can be aborted properly by opera
setTimeout((function($layer){ return function(){
$layer.remove();
};
})(opt.$layer), 10);
try {
delete opt.$layer;
} catch(e) {
opt.$layer = null;
}
}
// remove handle
$currentTrigger = null;
// remove selected
opt.$menu.find('.hover').trigger('contextmenu:blur');
opt.$selected = null;
// unregister key and mouse handlers
//$(document).off('.contextMenuAutoHide keydown.contextMenu'); // http://bugs.jquery.com/ticket/10705
$(document).off('.contextMenuAutoHide').off('keydown.contextMenu');
// hide menu
opt.$menu && opt.$menu[opt.animation.hide](opt.animation.duration, function (){
// tear down dynamically built menu after animation is completed.
if (opt.build) {
opt.$menu.remove();
$.each(opt, function(key, value) {
switch (key) {
case 'ns':
case 'selector':
case 'build':
case 'trigger':
return true;
default:
opt[key] = undefined;
try {
delete opt[key];
} catch (e) {}
return true;
}
});
}
});
},
create: function(opt, root) {
if (root === undefined) {
root = opt;
}
// create contextMenu
opt.$menu = $('<ul class="context-menu-list ' + (opt.className || "") + '"></ul>').data({
'contextMenu': opt,
'contextMenuRoot': root
});
$.each(['callbacks', 'commands', 'inputs'], function(i,k){
opt[k] = {};
if (!root[k]) {
root[k] = {};
}
});
root.accesskeys || (root.accesskeys = {});
// create contextMenu items
$.each(opt.items, function(key, item){
var $t = $('<li class="context-menu-item ' + (item.className || "") +'"></li>'),
$label = null,
$input = null;
item.$node = $t.data({
'contextMenu': opt,
'contextMenuRoot': root,
'contextMenuKey': key
});
// register accesskey
// NOTE: the accesskey attribute should be applicable to any element, but Safari5 and Chrome13 still can't do that
if (item.accesskey) {
var aks = splitAccesskey(item.accesskey);
for (var i=0, ak; ak = aks[i]; i++) {
if (!root.accesskeys[ak]) {
root.accesskeys[ak] = item;
item._name = item.name.replace(new RegExp('(' + ak + ')', 'i'), '<span class="context-menu-accesskey">$1</span>');
break;
}
}
}
if (typeof item == "string") {
$t.addClass('context-menu-separator not-selectable');
} else if (item.type && types[item.type]) {
// run custom type handler
types[item.type].call($t, item, opt, root);
// register commands
$.each([opt, root], function(i,k){
k.commands[key] = item;
if ($.isFunction(item.callback)) {
k.callbacks[key] = item.callback;
}
});
} else {
// add label for input
if (item.type == 'html') {
$t.addClass('context-menu-html not-selectable');
} else if (item.type) {
$label = $('<label></label>').appendTo($t);
$('<span></span>').html(item._name || item.name).appendTo($label);
$t.addClass('context-menu-input');
opt.hasTypes = true;
$.each([opt, root], function(i,k){
k.commands[key] = item;
k.inputs[key] = item;
});
} else if (item.items) {
item.type = 'sub';
}
switch (item.type) {
case 'text':
$input = $('<input type="text" value="1" name="context-menu-input-'+ key +'" value="">')
.val(item.value || "").appendTo($label);
break;
case 'textarea':
$input = $('<textarea name="context-menu-input-'+ key +'"></textarea>')
.val(item.value || "").appendTo($label);
if (item.height) {
$input.height(item.height);
}
break;
case 'checkbox':
$input = $('<input type="checkbox" value="1" name="context-menu-input-'+ key +'" value="">')
.val(item.value || "").prop("checked", !!item.selected).prependTo($label);
break;
case 'radio':
$input = $('<input type="radio" value="1" name="context-menu-input-'+ item.radio +'" value="">')
.val(item.value || "").prop("checked", !!item.selected).prependTo($label);
break;
case 'select':
$input = $('<select name="context-menu-input-'+ key +'">').appendTo($label);
if (item.options) {
$.each(item.options, function(value, text) {
$('<option></option>').val(value).text(text).appendTo($input);
});
$input.val(item.selected);
}
break;
case 'sub':
$('<span></span>').html(item._name || item.name).appendTo($t);
item.appendTo = item.$node;
op.create(item, root);
$t.data('contextMenu', item).addClass('context-menu-submenu');
item.callback = null;
break;
case 'html':
$(item.html).appendTo($t);
break;
default:
$.each([opt, root], function(i,k){
k.commands[key] = item;
if ($.isFunction(item.callback)) {
k.callbacks[key] = item.callback;
}
});
$('<span></span>').html(item._name || item.name || "").appendTo($t);
break;
}
// disable key listener in <input>
if (item.type && item.type != 'sub' && item.type != 'html') {
$input
.on('focus', handle.focusInput)
.on('blur', handle.blurInput);
if (item.events) {
$input.on(item.events, opt);
}
}
// add icons
if (item.icon) {
$t.addClass("icon icon-" + item.icon);
}
}
// cache contained elements
item.$input = $input;
item.$label = $label;
// attach item to menu
$t.appendTo(opt.$menu);
// Disable text selection
if (!opt.hasTypes && $.support.eventSelectstart) {
// browsers support user-select: none,
// IE has a special event for text-selection
// browsers supporting neither will not be preventing text-selection
$t.on('selectstart.disableTextSelect', handle.abortevent);
}
});
// attach contextMenu to <body> (to bypass any possible overflow:hidden issues on parents of the trigger element)
if (!opt.$node) {
opt.$menu.css('display', 'none').addClass('context-menu-root');
}
opt.$menu.appendTo(opt.appendTo || document.body);
},
update: function(opt, root) {
var $this = this;
if (root === undefined) {
root = opt;
// determine widths of submenus, as CSS won't grow them automatically
// position:absolute > position:absolute; min-width:100; max-width:200; results in width: 100;
// kinda sucks hard...
opt.$menu.find('ul').andSelf().css({position: 'static', display: 'block'}).each(function(){
var $this = $(this);
$this.width($this.css('position', 'absolute').width())
.css('position', 'static');
}).css({position: '', display: ''});
}
// re-check disabled for each item
opt.$menu.children().each(function(){
var $item = $(this),
key = $item.data('contextMenuKey'),
item = opt.items[key],
disabled = ($.isFunction(item.disabled) && item.disabled.call($this, key, root)) || item.disabled === true;
// dis- / enable item
$item[disabled ? 'addClass' : 'removeClass']('disabled');
if (item.type) {
// dis- / enable input elements
$item.find('input, select, textarea').prop('disabled', disabled);
// update input states
switch (item.type) {
case 'text':
case 'textarea':
item.$input.val(item.value || "");
break;
case 'checkbox':
case 'radio':
item.$input.val(item.value || "").prop('checked', !!item.selected);
break;
case 'select':
item.$input.val(item.selected || "");
break;
}
}
if (item.$menu) {
// update sub-menu
op.update.call($this, item, root);
}
});
},
layer: function(opt, zIndex) {
// add transparent layer for click area
// filter and background for Internet Explorer, Issue #23
var $layer = opt.$layer = $('<div id="context-menu-layer" style="position:fixed; z-index:' + zIndex + '; top:0; left:0; opacity: 0; filter: alpha(opacity=0); background-color: #000;"></div>')
.css({height: $win.height(), width: $win.width(), display: 'block'})
.data('contextMenuRoot', opt)
.insertBefore(this)
.on('contextmenu', handle.abortevent)
.on('mousedown', handle.layerClick);
// IE6 doesn't know position:fixed;
if (!$.support.fixedPosition) {
$layer.css({
'position' : 'absolute',
'height' : $(document).height()
});
}
return $layer;
}
};
// split accesskey according to http://www.whatwg.org/specs/web-apps/current-work/multipage/editing.html#assigned-access-key
function splitAccesskey(val) {
var t = val.split(/\s+/),
keys = [];
for (var i=0, k; k = t[i]; i++) {
k = k[0].toUpperCase(); // first character only
// theoretically non-accessible characters should be ignored, but different systems, different keyboard layouts, ... screw it.
// a map to look up already used access keys would be nice
keys.push(k);
}
return keys;
}
// handle contextMenu triggers
$.fn.contextMenu = function(operation) {
if (operation === undefined) {
this.first().trigger('contextmenu');
} else if (operation.x && operation.y) {
this.first().trigger($.Event("contextmenu", {pageX: operation.x, pageY: operation.y}));
} else if (operation === "hide") {
var $menu = this.data('contextMenu').$menu;
$menu && $menu.trigger('contextmenu:hide');
} else if (operation) {
this.removeClass('context-menu-disabled');
} else if (!operation) {
this.addClass('context-menu-disabled');
}
return this;
};
// manage contextMenu instances
$.contextMenu = function(operation, options) {
if (typeof operation != 'string') {
options = operation;
operation = 'create';
}
if (typeof options == 'string') {
options = {selector: options};
} else if (options === undefined) {
options = {};
}
// merge with default options
var o = $.extend(true, {}, defaults, options || {}),
$document = $(document);
switch (operation) {
case 'create':
// no selector no joy
if (!o.selector) {
throw new Error('No selector specified');
}
// make sure internal classes are not bound to
if (o.selector.match(/.context-menu-(list|item|input)($|\s)/)) {
throw new Error('Cannot bind to selector "' + o.selector + '" as it contains a reserved className');
}
if (!o.build && (!o.items || $.isEmptyObject(o.items))) {
throw new Error('No Items sepcified');
}
counter ++;
o.ns = '.contextMenu' + counter;
namespaces[o.selector] = o.ns;
menus[o.ns] = o;
// default to right click
if (!o.trigger) {
o.trigger = 'right';
}
if (!initialized) {
// make sure item click is registered first
$document
.on({
'contextmenu:hide.contextMenu': handle.hideMenu,
'prevcommand.contextMenu': handle.prevItem,
'nextcommand.contextMenu': handle.nextItem,
'contextmenu.contextMenu': handle.abortevent,
'mouseenter.contextMenu': handle.menuMouseenter,
'mouseleave.contextMenu': handle.menuMouseleave
}, '.context-menu-list')
.on('mouseup.contextMenu', '.context-menu-input', handle.inputClick)
.on({
'mouseup.contextMenu': handle.itemClick,
'contextmenu:focus.contextMenu': handle.focusItem,
'contextmenu:blur.contextMenu': handle.blurItem,
'contextmenu.contextMenu': handle.abortevent,
'mouseenter.contextMenu': handle.itemMouseenter,
'mouseleave.contextMenu': handle.itemMouseleave
}, '.context-menu-item');
initialized = true;
}
// engage native contextmenu event
$document
.on('contextmenu' + o.ns, o.selector, o, handle.contextmenu);
switch (o.trigger) {
case 'hover':
$document
.on('mouseenter' + o.ns, o.selector, o, handle.mouseenter)
.on('mouseleave' + o.ns, o.selector, o, handle.mouseleave);
break;
case 'left':
$document.on('click' + o.ns, o.selector, o, handle.click);
break;
/*
default:
// http://www.quirksmode.org/dom/events/contextmenu.html
$document
.on('mousedown' + o.ns, o.selector, o, handle.mousedown)
.on('mouseup' + o.ns, o.selector, o, handle.mouseup);
break;
*/
}
// create menu
if (!o.build) {
op.create(o);
}
break;
case 'destroy':
if (!o.selector) {
$document.off('.contextMenu .contextMenuAutoHide');
$.each(namespaces, function(key, value) {
$document.off(value);
});
namespaces = {};
menus = {};
counter = 0;
initialized = false;
$('#context-menu-layer, .context-menu-list').remove();
} else if (namespaces[o.selector]) {
var $visibleMenu = $('.context-menu-list').filter(':visible');
if ($visibleMenu.length && $visibleMenu.data().contextMenuRoot.$trigger.is(o.selector)) {
$visibleMenu.trigger('contextmenu:hide', {force: true});
}
try {
if (menus[namespaces[o.selector]].$menu) {
menus[namespaces[o.selector]].$menu.remove();
}
delete menus[namespaces[o.selector]];
} catch(e) {
menus[namespaces[o.selector]] = null;
}
$document.off(namespaces[o.selector]);
}
break;
case 'html5':
// if <command> or <menuitem> are not handled by the browser,
// or options was a bool true,
// initialize $.contextMenu for them
if ((!$.support.htmlCommand && !$.support.htmlMenuitem) || (typeof options == "boolean" && options)) {
$('menu[type="context"]').each(function() {
if (this.id) {
$.contextMenu({
selector: '[contextmenu=' + this.id +']',
items: $.contextMenu.fromMenu(this)
});
}
}).css('display', 'none');
}
break;
default:
throw new Error('Unknown operation "' + operation + '"');
}
return this;
};
// import values into <input> commands
$.contextMenu.setInputValues = function(opt, data) {
if (data === undefined) {
data = {};
}
$.each(opt.inputs, function(key, item) {
switch (item.type) {
case 'text':
case 'textarea':
item.value = data[key] || "";
break;
case 'checkbox':
item.selected = data[key] ? true : false;
break;
case 'radio':
item.selected = (data[item.radio] || "") == item.value ? true : false;
break;
case 'select':
item.selected = data[key] || "";
break;
}
});
};
// export values from <input> commands
$.contextMenu.getInputValues = function(opt, data) {
if (data === undefined) {
data = {};
}
$.each(opt.inputs, function(key, item) {
switch (item.type) {
case 'text':
case 'textarea':
case 'select':
data[key] = item.$input.val();
break;
case 'checkbox':
data[key] = item.$input.prop('checked');
break;
case 'radio':
if (item.$input.prop('checked')) {
data[item.radio] = item.value;
}
break;
}
});
return data;
};
// find <label for="xyz">
function inputLabel(node) {
return (node.id && $('label[for="'+ node.id +'"]').val()) || node.name;
}
// convert <menu> to items object
function menuChildren(items, $children, counter) {
if (!counter) {
counter = 0;
}
$children.each(function() {
var $node = $(this),
node = this,
nodeName = this.nodeName.toLowerCase(),
label,
item;
// extract <label><input>
if (nodeName == 'label' && $node.find('input, textarea, select').length) {
label = $node.text();
$node = $node.children().first();
node = $node.get(0);
nodeName = node.nodeName.toLowerCase();
}
/*
* <menu> accepts flow-content as children. that means <embed>, <canvas> and such are valid menu items.
* Not being the sadistic kind, $.contextMenu only accepts:
* <command>, <menuitem>, <hr>, <span>, <p> <input [text, radio, checkbox]>, <textarea>, <select> and of course <menu>.
* Everything else will be imported as an html node, which is not interfaced with contextMenu.
*/
// http://www.whatwg.org/specs/web-apps/current-work/multipage/commands.html#concept-command
switch (nodeName) {
// http://www.whatwg.org/specs/web-apps/current-work/multipage/interactive-elements.html#the-menu-element
case 'menu':
item = {name: $node.attr('label'), items: {}};
counter = menuChildren(item.items, $node.children(), counter);
break;
// http://www.whatwg.org/specs/web-apps/current-work/multipage/commands.html#using-the-a-element-to-define-a-command
case 'a':
// http://www.whatwg.org/specs/web-apps/current-work/multipage/commands.html#using-the-button-element-to-define-a-command
case 'button':
item = {
name: $node.text(),
disabled: !!$node.attr('disabled'),
callback: (function(){ return function(){ $node.click(); }; })()
};
break;
// http://www.whatwg.org/specs/web-apps/current-work/multipage/commands.html#using-the-command-element-to-define-a-command
case 'menuitem':
case 'command':
switch ($node.attr('type')) {
case undefined:
case 'command':
case 'menuitem':
item = {
name: $node.attr('label'),
disabled: !!$node.attr('disabled'),
callback: (function(){ return function(){ $node.click(); }; })()
};
break;
case 'checkbox':
item = {
type: 'checkbox',
disabled: !!$node.attr('disabled'),
name: $node.attr('label'),
selected: !!$node.attr('checked')
};
break;
case 'radio':
item = {
type: 'radio',
disabled: !!$node.attr('disabled'),
name: $node.attr('label'),
radio: $node.attr('radiogroup'),
value: $node.attr('id'),
selected: !!$node.attr('checked')
};
break;
default:
item = undefined;
}
break;
case 'hr':
item = '-------';
break;
case 'input':
switch ($node.attr('type')) {
case 'text':
item = {
type: 'text',
name: label || inputLabel(node),
disabled: !!$node.attr('disabled'),
value: $node.val()
};
break;
case 'checkbox':
item = {
type: 'checkbox',
name: label || inputLabel(node),
disabled: !!$node.attr('disabled'),
selected: !!$node.attr('checked')
};
break;
case 'radio':
item = {
type: 'radio',
name: label || inputLabel(node),
disabled: !!$node.attr('disabled'),
radio: !!$node.attr('name'),
value: $node.val(),
selected: !!$node.attr('checked')
};
break;
default:
item = undefined;
break;
}
break;
case 'select':
item = {
type: 'select',
name: label || inputLabel(node),
disabled: !!$node.attr('disabled'),
selected: $node.val(),
options: {}
};
$node.children().each(function(){
item.options[this.value] = $(this).text();
});
break;
case 'textarea':
item = {
type: 'textarea',
name: label || inputLabel(node),
disabled: !!$node.attr('disabled'),
value: $node.val()
};
break;
case 'label':
break;
default:
item = {type: 'html', html: $node.clone(true)};
break;
}
if (item) {
counter++;
items['key' + counter] = item;
}
});
return counter;
}
// convert html5 menu
$.contextMenu.fromMenu = function(element) {
var $this = $(element),
items = {};
menuChildren(items, $this.children());
return items;
};
// make defaults accessible
$.contextMenu.defaults = defaults;
$.contextMenu.types = types;
})(jQuery);